Selenium tetrafluoride is produced from a reaction of elemental Se with chlorine trifluoride according to the balanced chemical equation: 3 Se(g) + 4 CIF3(g) → 3 SeF4(g) + 2 Cl2(g) AHrxn = -1874 kJ Using AHrxn and the table of bond energies below, determine the bond energy of the Se-F bonds in SeF4. Note that all bonds in the reactants and products are single bonds. Bond Bond Energy (kJ/mol) CI-F 253 Cl-CI 243 The units are kJ/mol. Do not include units in your answer. Scientific notation is optional. To write scientific notation in Canvas, type "e" to replace “x 10". For example, “1 × 1014" is written “1e+14" in Canvas.

Selenium tetrafluoride is produced from a reaction of elemental Se with chlorine trifluoride according to the balanced chemical equation: 3 Se(g) + 4 CIF3(g) → 3 SeF4(g) + 2 Cl2(g) AHrxn = -1874 kJ Using AHrxn and the table of bond energies below, determine the bond energy of the Se-F bonds in SeF4. Note that all bonds in the reactants and products are single bonds. Bond Bond Energy (kJ/mol) CI-F 253 Cl-CI 243 The units are kJ/mol. Do not include units in your answer. Scientific notation is optional. To write scientific notation in Canvas, type "e" to replace “x 10". For example, “1 × 1014" is written “1e+14" in Canvas.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter6: Covalent Bonding

Section: Chapter Questions

Problem 118QRT

See similar textbooks

Similar questions

Light of appropriate wavelength can break chemical bonds. Light having λ < 240 nm can dissociate gaseous O2. It requires light with λ < 819 nm to dissociate gaseous H2O2 to 2 OH. Assume that all of the photon energy is used solely for these dissociations. (a) Calculate the energy required to dissociate (i) O2 and (ii) H2O2. (b) Consider the results of part (a). How well do they correlate with the Lewis structures of O2 and H2O2? Explain your answer.
The compound oxygen difluoride is quite reactive, giving oxygen and HF when treated with water: OF2(g) + H2O(g) O2(g) + 2 HF(g) rH = 318 kl/mol-rxn Using bond dissociation enthalpies, calculate the bond dissociation enthalpy of the OF bond in OF2.
Bromine-containing species play a role in environmental chemistry. For example, they are evolved in volcanic eruptions. (a) The following molecules are important in bromine environmental chemistry: HBr, BrO, and HOBr. Which is an odd-electron molecule? (b) Use bond dissociation enthalpies to estimate rH for three reactions of bromine: Br2(g) 2 Br(g) 2 Br(g) + O2(g) 2 BrO(g) BrO(g) + H2O(g) HOBr(g) + OH(g) (c) Using bond dissociation enthalpies, estimate the standard enthalpy of formation of HOBr(g) from H2(g), O2(g), and Br2(g). (d) Are the reactions in parts (b) and (c) exothermic or endothermic?
Bond Enthalpy When atoms of the hypothetical element X are placed together, they rapidly undergo reaction to form the X2 molecule: X(g)+X(g)X2(g) a Would you predict that this reaction is exothermic or endothermic? Explain. b Is the bond enthalpy of X2 a positive or a negative quantity? Why? c Suppose H for the reaction is 500 kJ/mol. Estimate the bond enthalpy of the X2 molecule. d Another hypothetical molecular compound, Y2(g), has a bond enthalpy of 750 kJ/mol, and the molecular compound XY(g) has a bond enthalpy of 1500 kJ/mol. Using bond enthalpy information, calculate H for the following reaction. X2(g)+Y2(g)2XY(g) e Given the following information, as well as the information previously presented, predict whether or not the hypothetical ionic compound AX is likely to form. In this compound, A forms the A+ cation, and X forms the X anion. Be sure to justify your answer. Reaction: A(g)+12X2(g)AX(s)The first ionization energy of A(g) is 400 kJ/mol. The electron affinity of X(g) is 525 kJ/mol. The lattice energy of AX(s) is 100 kJ/mol. f If you predicted that no ionic compound would form from the reaction in Part e, what minimum amount of AX(s) lattice energy might lead to compound formation?
Write Lewis structures for CO32, HCO3, and H2CO3. When acid is added to an aqueous solution containing carbonate or bicarbonate ions, carbon dioxide gas is formed. We generally say that carbonic acid (H2CO3) is unstable. Use bond energies to estimate H for the reaction (in the gas phase) H2CO3 CO2 + H2O Specify a possible cause for the instability of carbonic acid.
The oxygen oxygen bond in O2 is 112 pm and in O2 is 121 pm. Explain why the bond length in O2+ is shorter than in O2. Would you expect the bond length in O2 to be longer or shorter than that in O2? Why?
Although nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (Nl3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s)+3IF(g)BF3(g)+NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction ( 307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) ( 96 kJ/mol), and BF3(g) ( 1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every l mole of BN. one of the by-products isolated is [IF2]+ [BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?
The bond length in HI(1.62) is close to the sum of the atomic radii of H (0.37 Å) and I (1.33 Å). What does this fact indicate about the polarity of the bond?
Consider the following bond lengths: CO143pmC9O123 pmC:O109 pm In the Co32 ion, all three C8O bonds have identical bond lengths of 136 pm. Why?