The coordination complex (complex 1) shown below displays isomerism. Coordination compounds incorporating the organic ligand shown in complex 1 have played crucial roles in developing our understanding of the thermodynamics and kinetics of complexation of metal ions, the bonding, photochemistry, photophysics and electrochemistry of metal complexes. As a bidentate metal-binding species, the ligand has also found widespread application as a scaffold in supramolecular and metallosupramolecular chemistry. 2+ NI NH3 NH3 Complex 1 (a) Write the correct name and formula of the complex ion shown. Identify its isomer/s and write their name, formula and draw their structures. (b) Assume that complex 1 becomes complex 2 by removing the two NH3 ligands. Write the name and formula, and draw the possible structures of this new complex. (c) For any structure of each complex, 1 and 2, draw a completely labelled crystal field splitting energy level diagram (relative to the spherical field) and confirm by calculation the type of magnetism that each complex exhibits.

The coordination complex (complex 1) shown below displays isomerism. Coordination compounds incorporating the organic ligand shown in complex 1 have played crucial roles in developing our understanding of the thermodynamics and kinetics of complexation of metal ions, the bonding, photochemistry, photophysics and electrochemistry of metal complexes. As a bidentate metal-binding species, the ligand has also found widespread application as a scaffold in supramolecular and metallosupramolecular chemistry. 2+ NI NH3 NH3 Complex 1 (a) Write the correct name and formula of the complex ion shown. Identify its isomer/s and write their name, formula and draw their structures. (b) Assume that complex 1 becomes complex 2 by removing the two NH3 ligands. Write the name and formula, and draw the possible structures of this new complex. (c) For any structure of each complex, 1 and 2, draw a completely labelled crystal field splitting energy level diagram (relative to the spherical field) and confirm by calculation the type of magnetism that each complex exhibits.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 108IP: a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the...

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Give the coordination numbers and write the formulas for each of the following, including all isomers where appropriate: (a) tetrahydroxozincate(ll) ion (tetrahedral). (b) hexacyanopalladate(IV) ion. (c) dichlomaurate(I) ion (note that aurum is Latin for "gold"). (d) diamminedichloroplatinum(Il). (e) potassium diamminetetrachlorochromate(III). (f) hexaamminecobalt(III) hexacyanochromate(III). (g) dibromobis(ethylenediamine) cobalt(III) nitrate
The (2-aminoethyl)phosphine ligand, acts as a bidentate ligand with metalsof Transition.i) How many possible isomers of [dichlorobis{(2-aminoethyl)phosphine}nickel(II)] inoctahedral coordination exist? Draw them and identify the pairs of enantiomers.ii) Classify the configuration of the chiral isomers as D or L
Are bipyridines (bipy) and analogous amines, phenanthroline (phen) and terpyridine (terpy) chelate ligands?Is there the possibility of the formation of complexes of these ligands with metals in a low oxidation state? Why?
Explain in detail π backbonding using the molecular orbitals of CO and a d-transition metal. How does this influence Infrared Spectroscopy and explain how the bond order for the C-O bond changes and how the bond order for the metal-ligand bond changes. Provide pictures and explanations. (Inorganic Chemistry)
Generally speaking, for a given metal and ligand, the stability of a coordination compound is greater for the metal in the +3 rather than in the +2 oxidation state (for metals that form stable +3 ions in the first place). Suggest an explanation, keeping in mind the Lewis acid–base natureof the metal–ligand bond.
Strong-field ligands (such as CN-) stabilise the M2* oxidation state. Reflect on the reason.
What are the characters for the operations C2, C4, σd, and σv(xz) respectively, on the LCAO Ψ(L1+L3) – Ψ(L2+L4) in the square planar metal complex ML4? The arrangement of the four ligands is shown in the structure.
Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain the splitting and the relativeenergies of the dxyand dx2-y2 the orbitals.
please answer the following question: 1. discuss how crystal field theory satisfactorily explains the existence of colour in some coordination complexes
. Explain why octahedral coordination complexes withthree and eight d electrons on the central metal atom areparticularly stable. Under what circumstances would youexpect complexes with five or six d electrons on the central metal atom to be particularly stable?