Answered: The equilibrium constant (K.) is 0.0025…

The equilibrium constant (K.) is 0.0025 at 2127°C. If an equilibrium mixture at this temperature contains 0.028 mol N2 and 0.053 mol O2 per liter, what is the concentration of NO?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 110QRT: The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the...

See similar textbooks

Related questions

Q: The equilibrium constant, K,, for the following reaction is 0.215 at 673 K. NH,I(s) NH3(g)+ HI(g) If…

A: In order to solve this question, we will first find out the partial pressure of NH4I and NH3 and…

Q: You are measuring the K, for the reaction: A (g) + B (g) +C (g) A 2.00 mol sample of A is sealed in…

A: Kc is the equilibrium constant with respect to concentration aA+bB ---->cC+dD Then Kc =…

Q: Assume the equilibrium: 2NOCI(g) 2 NO (g) + Cl2(g). At 100 °C, the equilibrium concentrations are…

A: Given data, T = 100 °C = 273 K +100 = 373 K equilibrium concentration are [NO] = 1.32×10-3 M [Cl2]…

Q: A student ran the following reaction in the laboratory at 1094 K: 2503(g)2s02(g) + O2(g) When she…

A: First, determine the equilibrium mixture for the determination of equilibrium constant Kc as…

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH2Cl2(g) CH4(g) +…

A: The given equilibrium is Volume of the flask = 1.00 L Hence, the molar concentration and number of…

Q: Question is attached

A: In equilibrium concepts, it is quite common to come across various equilibrium constants. The…

Q: The following equilibrium was studied by analyzing the equilibrium mixture for the amount of HCl…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: The equilibrium constant, K, for the following reaction is 1.29×10² at 600 K. COCI2(g) CO(g)+ Cl2(g)…

A: The reaction is as follows: COCl2(g) ⇌ CO(g) + Cl2(g). The volume of the…

Q: A student ran the following reaction in the laboratory at 271 K: 2NO(g) + Br2(g) = 2NOBR(g) When she…

Q: The reaction CO (g) + H2O (g) ↔ CO2 (g) + H2 (g) is used to increase the ratio of hydrogen…

A: ICE table for the reaction is shown below.

Q: At a certain temperature, the equilibrium constant, ?c, for this reaction is 53.3.…

Q: Enter your answer in the provided box. Carbonyl chloride (COCI,), also called phosgene, was used in…

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH,Cl2(g)=CH4(g) +…

Q: The equilibrium constant, K, for the following reaction is 1.29x10-2 at 600 K. COCI,(g) CO(g) +…

Q: The equilibrium constant, Ke, for the following reaction is 6.50x103 at 298K. 2NOBI(g)2NO(g) +…

A: The equilibrium constant (Kc ) of a reaction is given by the ratio of products to that of the…

Q: The equilibrium constant, K, for the following reaction is 1.20x10-2 at 500 K. PCI5(g) PC13(g) +…

Q: NOBr? K. Br,NO²

A: Given:

Q: The equilibrium constant (Kc) for the reaction PC13 (g) + Cl₂ (g) → PC1, (g) equals 49 at 230°C. If…

Q: The equilibrium constant Kc for the reactionPCl3(g) + Cl2(g) ⇌ PCl5(g)is 49 at 230°C. If 0.70 mol of…

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350K. 2CH,Cl2(g) =CH4(g) +…

Q: The equilibrium constant, K, for the following reaction is 1.29x10-2 at 600. K. COCI₂(g) →CO(g) +…

Q: Consider the reaction H2(g) + F2(g) = 2HF(g) at some temperature where the equilibrium…

A: The equilibrium reaction taking place is given as, => H2 (g) + F2 (g) -------> 2 HF Given:…

Q: The equilibrium constant, K. , for the following reaction is 1.80×104 at 298 K. NH,HS(s)=NH3(g) +…

A: Given data,Kc=1.8×10-4Volume of container=4.85LMoles of NH4HS=2.86molMoles of NH3=0.393mol

Q: Suppose a 250. mL flask is filled with 0.60 mol of CHCI3, 0.50 mol of HCl and 1.7 mol of CCl. The…

A: First we will find molarity of each reactant or product added. Then draw ICE table to calculate…

Q: The equilibrium constant, K, for the following reaction is 1.29x102 at 600 K. COC,(g)CO(g) + Cl2(g)…

Q: The equilibrium constant, K., for the following reaction is 5.10x106 at 548 K. NH,CI(s) NH3(g) +…

A: The equilibrium constant of the reaction is 5.10 ×10-6 The expression of Kc of the above reaction is…

Q: The equilibrium constant, K, for the following reaction is 2.44x10 at 518 K. PCl(g)PC(g)+ Clylg) An…

A: The given equilibrium reaction is shown below. PCl5g⇌PCl3g+Cl2g The initial concentration of PCl5,…

Q: For the reaction 2SO2(g) + O2(g) ⇌ 2SO3(g), the concentrations at equilibrium are [SO2] = 0.90 M,…

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350 К. 2CH2Cl2(g) CH4(g) +…

A: Given that: Reaction = 2CH2Cl2(g) → CH4(g) + CCl4(g) Concentration of three gases is, [CH2Cl2] =…

Q: The equilibrium concentrations for the reaction between carbon monoxide and molecular chlorine to…

A: using the given information to find kc then to find kp.

Q: Question attached

A: Consider the given reaction as; NH4HS s ⇌ NH3 g + H2S g ; Kc=1.80×10-4…

Q: If, at a given temperature, the equilibrium constant for the reaction H2(g) + Cl2(g) 2HCl(g) is Kp,…

A: Given reaction and information, The equilibrium constant for the reaction H2(g) + Cl2(g)…

Q: 5. Consider the reaction: CO (g) + 2 H2 (g) → CH30H (g) at 298 K An equilibrium mixture of this…

A: Consider the given reaction as; CO g + 2 H2 g ↔ CH3OH g Given information is as follows:…

Q: The equilibrium constant for the reaction 2SO,(g) + O2(g) = 250;(g) is 3.1 x 102 at a certain…

A: Given: Equilibrium concentration of [SO2] = 0.0191 M Equilibrium concentration of [O2] = 0.041 M…

Q: The equilibrium constant, K., for the following reaction is 7.00x10 at 673 K. NHI(s) NH3(g) + HI(g)…

Q: A student ran the following reaction in the laboratory at 251 K: 2NO(g) + Brz(9) = 2NOBR(g) When she…

Q: The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH;Cl½(g) CH,(g) + CC4(g)…

A: Given : Equilibrium constant (K) = 10.5 [CH4] =[CCl4] = 0.176 M [CH2Cl2] = 5.43 x 10-2 M On…

Q: For the reaction 2SO2(g) + O2(g) → 2SO3(g) at a certain temperature, the equilibrium…

Q: A student ran the following reaction in the laboratory at 293 K: 2NO(g) + Br2(g) 2NOBr(g) When…

A: Given: Moles of NO = 0.145 mol Moles of Br2 = 0.109 mol Volume of container = 1.0 L Equilibrium…

Q: A student ran the following reaction in the laboratory at 288 K: 2NO(g) + Br2(g) = 2NOBr(g) When she…

A: Given data, Number of moles of NO = 0.140 mol Number of moles of Br2 = 0.117 mol volume of…

Q: The equilibrium constant, K., for the following reaction is 1.80x10 at 298 K. NH,HS(s) NH3(g) +…

Q: The equilibrium constant (K.) for the reaction PCI3 (g) + Cl2 (9) PCI5 (g) equals 49 at 230°C. If…

Q: A student ran the following reaction in the laboratory at 709 K: N2(g) + 3H2(g)2NH3(g) When she…

Q: The equilibrium constant, K.. for the following reaction is 6.50x103 at 298K. 2NOBR(g)2NO(g) +…

A: Solution:- Reaction:- 2NOBr(g) ↔ 2NO(g) + Br2(g) Kc = 6.50 x 10-3 Volume = 17.2 L…

Question

The equilibrium constant (K.) is 0.0025 at 2127°C. If an equilibrium mixture at this temperature contains 0.028 mol N2 and 0.053 mol O2 per
liter, what is the concentration of NO?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Equilibrium exists between butane and isobutane when [butane] = 0.020 M and [isobutane] = 0.050 M. An additional 0.0200 mol/L of isobutane is added to the mixture. What are the concentrations of butane and isobutane after equilibrium has again been attained?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?