The reaction:Na, SO, • 10H20) + Na,SO(s)+10H2O()has a K, = 4.2r10 26 at 300.15K. What is its K.?

Answered: Image /qna-images/answer/c78f8514-01a8-41de-973d-9dd121b3d5ea.jpg

Answered: The reaction: Naz SO, • 10H20,) + Naz…

Science

Chemistry

The reaction: Naz SO, • 10H20,) + Naz SO:(s)+10H2O() has a K, = 4.2z10-25 at 300.15K. What is its K.?

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter5: Introduction To Chemical Equilibrium

Section: Chapter Questions

Problem 5.42E

See similar textbooks

Related questions

Q: For the reaction A(l) =A(g), the equilibrium constant is 0.333 at 25.0 ◦C and 0.666 at 75.0 ◦C.…

Q: What concentration of SO is in equilibrium with Ag, SO,(s) and 1.00 x 10 M Ag*? The Ksp of Ag, SO,…

A: Given datas ; [Ag+] = 1.00 × 10-3 M [SO32-] = ? M Ksp of Ag2SO3 = 1.50 × 10-14

Q: Calculate the equilibrium constant K, at 25 "C for the reaction below. NH,Cs) = NH(g) + HCIg)…

A: Given: The standard free energy of formation(∆Gfo) of NH4Cl(s) = -203.10 kJ•mol-1 ∆Gfo of NH3(g)=…

Q: Kp for the reaction CO2(g) + C(s) <--> 2CO(g) is 1.47 at 727°C. What would Kc at this…

A: Given:Kp= 1.47Temperature = 727 oC = 1000.15 K

Q: For the reaction A + B = C, with the equilibrium constant is K25 = 20 at 25 C, and it is K40= 10 at…

A: According to the Clausius Clapeyron equation ln(KT2 / KT1) = -(∆H/R) X ( 1/T2 - 1/T1 ) where KT2 =…

Q: -certain nucleotide, N, specifically activates an enzyme according to Enzyme+N + Enzyme – N At 311…

Q: Consider the following equilibrium: C,H6(g) + C3H12(g) = CH4(g) + C,H14(g); Kp = 9.57 at 500 K…

Q: Stearic acid dimerizes when dissolved in hexane: 2 C1,H35COOH(hexane) (C1,H35COOH),(hexane) The…

A: We are provided with two rate constants at equilibrium, two temperatures and we have to calculate…

Q: Nitrogen trioxide dissociation according to the reaction. N2O3(g) = NO2(g) + NO(g) When one mole…

A: The reaction taking place is N2O3 (g) ------> NO2 (g) + NO (g)

Q: c A four-phase equilibrium is not usually possible-Justify the statement.

Q: In the gas-phase reaction A + B ⇋ C + 2 D, it was found that, when 2.00 mol A, 1.00 mol B, and 3.00…

A: A + B⇌ C + 2Dt=0 2mol 1mol 0 3molt=eqn 2-x 1-x 0+x…

Q: At 750 K, the Kc is equal to 2.78 x 10−4 for the reaction given below. What is the Kp of…

Q: The equilibrium constant for the reaction N2(g) + 3H2(g) ➡ 2NH3(g) is 1.0 x 10-1 at…

A: The relationship between rate constant , temperature and enthalpy change is given by logK2K1 =…

Q: For the reaction 2Mo(s) + CH4(g) MO2C(s) + H2(g) Kp = 3.55 at 973K. What will have to be the initial…

A: Let the initial pressure of CH4 is y. Kp = 3.55 (PH2) = 0.75atm

Q: A solution is prepared by dissolving 3 x 103 mol PbCl2 (s) in 1L of hot water. a) Write the correct…

A: Number of moles = 3*10-3 Molarity = Number of moles / 1L Volume = 1L Concentration = 3*10-3/1L…

Q: ol. What is the ratio of the equilibrium constant at 400 K to that at 200 K?

Q: 5. Consider the reaction, H₂ + 12 → 2HI. The equilibrium constant values have been determined for…

A: According to Van't Hoff equation ln(K2/K1) = (- deltaH0 /R) [1/T2-1/T1] ln (16*10-3 /3.2*10-3) =(-…

Q: At 25C RG for the reaction N204 (g) 2NO2 (g) is 1380 cal/mol. What is the degree of dissociation at…

A: Given data contains, ∆G=1380 cal/mol Temperature=25°C=25+273.15 K=298.15 K P=10 atm

Q: 17.30 The equilibrium constant Kp for the reaction Co(g) + Cl(g) COCI,(g) is 5.62 x 1035 at 25°C.…

A: Relation between G= -RT ln Kp

Q: please explain why 18.1 and 0.543 is wrong? You place 1.95 mol of NOCI(g) in a reaction vessel.…

A: Standard enthalpy of formation ∆H°f is change in enthalpy when 1 mole of substance is formed from…

Q: Consider the reaction NH3(g) + HCI(g) NHẠCI(s) --> Given the following table of thermodynamic data:…

Q: I. The AG° of the reaction is 2.60 kJ/mol. I initial pressures are PH2 = 4.26 atm andPz =0.23 atm.…

A: Gibbs free energy or free enthalpy is the quantity that is used to measure the maximum amount of…

Q: For the reaction: CrCl3(TAP)(s) qe CrCl3(g) + TAP(g), Kc = 4.23*1014 (513 K), TAP =…

Q: The Ksp for a very insoluble salt is 4.2 * 10-47 at 298 K. What is ∆G° for the dissolution of the…

A: Ksp = 4.2 × 10-47 T = 298 K

Q: For the exothermic reaction 2HI = H + I) , K, = 1.81 x 10² at 700K. %3D a. If a 1.00 L container of…

A: The given reaction is: 2 HI (g) ⇌ H2 (g) + I2 (g) T= 700 KKp =…

Q: Nitrogen trioxide dissociation according to the reaction. N2O3(g)= NO2(g)+ NO(g) When one mole of…

A: The reaction taking place is N2O3 (g) ------> NO2 (g) + NO (g)

Q: Pentene (C5H10) reacts with ethanoic acid to form pentyl ethanoate, the equilibrium CH3CO2H +…

A: Equilibrium constant of a chemical reaction is the value of its reaction quotient at chemical…

Q: The AH of the reaction is 1367 k. Calculate A for the reaction at 25C O+1365 O 134

A: ∆H°=-1367kJ T=25°C=(25+273)K=298K ∆E°=?

Q: .The equilibrium constant for the reaction of decomposition of AB3 (AB3(g) = A(g) + 3B (g)) is K =…

A: For a reaction , AB = A + B The dissociation constant of the reaction will be, k = [A][B] / [AB]…

Q: For the gas-phase reaction 2SO, +O, ² 250,, observed mole fractions for a certain equilibrium…

A: According to Dalton's law of partial pressures, .

Q: Methanol (CH3OH) is produced commercially by thecatalyzed reaction of carbon monoxide and…

A: Since the concentration of any gaseous substance is given by concentration = moles / volume of…

Q: The equilbrium constant, K, for the fellowing reaction is 1.20x10 at 50K An equlibrium misture of…

A: The equilibrium reaction given is PCl5 (g) ⇌ PCl3 (g) + Cl2 (g) The equilibrium constant (K) for the…

Q: You are studying a protein called Protein C, which is a drug target for cancer, as inhibiting its…

Q: The equilibrium constant for the reaction of decomposition of AB3 (AB3(g)= A(g) + 3B (g) is [A][B]³…

Q: Nitrogen trioxide dissociation according to the reaction. N2O (g) = NO2(g) + NO(g) When one mole…

A: The reaction given is N2O3 (g) ------> NO2 (g) + NO (g)

Q: Question attached

A: The equilibrium constant , denoted as Kc where the subscript 'c' indicates the molar concentrations…

Q: For the reaction, the value of Kp is 41.0 (at 400.0 K), and ΔH° = –92.2 kJ. N2(g) + 3H2(g)…

A: Kp at 735.0 K for the given reaction can be determined using van't Hoff equation.

Q: Considering the following decomposition reaction: AB(aq) A(aq) + B(aq) Ke = 3.2x10-6 at 600 K %3D…

A: Kc is the equilibrium constant and it is ratio of product and reactant concentration at equilibrium…

Q: A solution is prepared by adding 0.10 mole of Ni(NH, )Cla to 0.501 of 3.4M NH Calculate NI…

A: Ans.

Q: Consider the equilibrium system described by the chemical reaction below. The decomposition of NOBr…

Q: Dinitrogen tetroxide is 18.46 per cent dissociated at 25°C and 1.00 bar in the equilibrium N2O4(g) ⇌…

Q: udent ran the following reaction in the laboratory at 479 K: (g) + Cl₂(9) ⇒PCI5(9) n she introduced…

Q: Nitric oxide reacts with chlorine to form NOCI. 2NO(g) + Cl2g)→ 2NOCI(g) The equilibrium constant K…

A: In this question we want to determine the value of Equilibrium constant K How we can determine, you…

Q: Nitrogen trioxide dissociation according to the reaction. N2O3(g) = NO2(g)+NO(g) When one mole of…

A: The energy involved in particular chemical reaction for performing works is basically "Gibbs free…

Q: IN(g) + H2(g) <....> INH2(g), Given IN=0.060atm, H2=0.0350atm), and INH2(g) = 0atm, Kp= 1.48…

A: In the given question, pressure of InH2 is given as 0 atm which is not possible. Hence, a possible…

Q: For the reaction: H2S(g) + I2(l) HI(g) + S(s, rhombic) Kp=1.33x10-5atm at 60 degrees Celcius.…

Q: For the equilibrium A + B = C + DK was measured to be 1.20 at 25°C and 3.55 x 10-2 at 300°C. What is…

A: Given Reaction A + B ⇌ C + D ( Keq )1 = 1.2 T1 = 25 ℃ = ( 25…

Q: Dinitrogen tetroxide is 18.46 per cent dissociated at 25 °C and 1.00 bar in the equilibrium N2O4(g)…

A: Introduction: Partial pressure: The partial pressure may be defined as the pressure exerted by the…

Question

The reaction:
Na, SO, • 10H20) + Na,SO(s)+10H2O()
has a K, = 4.2r10 26 at 300.15K. What is its K.?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
At a certain temperature, the reaction Xe(g)+2F2(g)XeF4(g)gives a 50.0% yield of XeF4, starting with Xe(Pxe=0.20atm) and F2(PF2=0.40atm). Calculate K at this temperature. What must the initial pressure of F2 be to convert 75.0% of the xenon to XeF4?
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Which reaction mechanism assumptions are unimportant in describing simple ionic reactions between cations and anions? Why?
A student studies the equilibrium I2(g)2I(g)at a high temperature. She finds that the total pressure at equilibrium is 40% greater than it was originally, when only I2 was present. What is K for this reaction at that temperature?