The reaction under study is an Oxidation-Reduction reaction. Assign an Oxidation State to the Carbon and the Manganese in each relevant species. Identify the Oxidation and the Reduction.

Q: Find the molarity of Ba(OH)2 used by a laboratory analysts for standardization. It took 23.28 mL of ...

A:

Q: Classify these compounds by whether they behave as strong acids, weak acids, strong bases, or weak b...

A: Compound can be classified as acid or base There are several theory to define acid or base 

Q: Why do scientists expect fusion to eventually replace fission as a nuclear process? Use the papercli...

A: Answer:  Note : Fission means splitting of a heavy & unstable nuclie into 2 or more  lighter ato...

Q: Predict the product for the following reaction. CH;CH,NH2 OH NHCH2CH3 `NHCH2CH3 NCH2CH3 II II ОН NCH...

A:

Q: Qu What is the concentration of H* in a 2.5 M HCI (100 mL) and 0.1 M HBr (100 mL) solution? O 1.8 M ...

A:

Q: 1. Use the standard electrode potentials to calculate the cell potential and determine whether the r...

A: Since you've asked multiple questions with multiple sub-parts, we will solve first question (1,a and...

Q: A sample of unknown hydrate, AC·XH2O, has a mass of 1.000 g before heating and a mass of 0.781 g aft...

A:

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6HCI(aq) -› 2 MCl, (ag) + ...

A: For the given reaction., 1) 2M(s) + 6HCl (aq)⟶2 MCl3 (aq)+ 3H2 (g) Δ?1 = −801.0 kJ 2) HCl (g) ⟶ HCl(...

Q: What is the pH of a 0.010 M solution of HF? The Ka for HF is 6.8 x 10^-4.

A: Given,   Concentration of HF = 0.010 M  Ka for HF is = 6.8x10-4   

Q: KI and CaCl2 are ionic. Which factors will result in a stronger ionic bond overall? Choose one or m...

A: The charge on KI is K+ and Cl- , , but the charge on CaCl2 can be written as Ca2+ and 2Cl- . In both...

Q: How do intermolecular force affect the boiling point and melting point of a compound?

A: Boiling point deals with boiling of a liquid and melting point deals with melting of a solid. In bot...

Q: Which of the following compounds, upon oxidation with KMnO4 will NOT produce a carboxylic acid?

A: The oxidation of alcohol depends on the number of hydrogen atoms attached to the carbon atom that co...

Q: A 52.0-mLmL volume of 0.35 MM CH3COOHCH3COOH (Ka=1.8×10−5Ka=1.8×10−5) is titrated with 0.40 MM NaOHN...

A: Given :  1. Concentration(Molarity) of acetic acid = 0.35M. 2. Volume of acetic acid = 52.00mL .    ...

Q: A 1.3-mol sample of ideal gas at 23.0°C is allowed to expand reversibly and adiabatically from 400 c...

A:

Q: James is climbing a mountain. Is the distance he travels to the top of the mountain a state function...

A: A question based chemical thermodynamics that is to be accomplished.

Q: *** 21 - Calculate R from student collected data and percent error A student weighs out 0.0422 g of ...

A:

Q: Saved cept- Calculate mass of Mg to produce hydrogen gas Magnesium metal is reacted with hydrochlori...

A:

Q: 1-10716-2022 Wtr / Chemistry- Unit 2 Chemical Reactions Chapter 3 Pages 84-187 / Balance Chemical Eq...

A:

Q: How many grams of sulfur (S8) must be dissolved in 100.0 g naphthalene (C10H8) to make a 0.12 m solu...

A:

Q: Given: A weak acid, HA (whose Ka is 1.00 x 10-6 and KD is 100) that distributes between benzene and ...

A:

Q: Draw the structure for ethanethio

A:

Q: 3.  Which of the following is NOT considered to be a factor for effective collisions? Select one: ...

A: for effective collisions molecule should have  molecules must be under go collision with proper orie...

Q: Draw the product of the following compounds with the given image. 1. A. BH3 B. H2O2, OH- 2. A. O3 B....

A:

Q: 2. Draw the structure of the disaccharide a -glycosyl(1-6)-galactose in the B anomeric form and circ...

A:

Q: consider the following metals, A, B, C and D at room temperature.  10 g of each metal absorbs 15 kJ....

A:

Q: CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2);COOH

A: IUPAC name of the given fatty acid:

Q: In which of the solutions below Lead sulfate, PbSO4, be most soluble in? Justify your answer. a. pur...

A: The solubility of a compound can be identified based on the common ion factor, and Le chatelier prin...

Q: Identify each of the following as a redox or non-redox reaction. Explain. a. H2SO4 + NaOH → Na2SO4 +...

A:

Q: The constant-pressure heat capacity of a sample of a perfect gas was found.to vary with temperature ...

A:

Q: aqueous solution of HN3 when solid KN3 is added? Group of answer choices pOH increases. pOH decrease...

A: HN3(aq.) ---> H+(aq.) + N3-(aq.) If we add KN3 In the solution of HN3. Due to common ion N3- , eq...

Q: 3. If 7,500 J of energy is added to 1.43 kg of iron (originally at 25.0°C), what temperature will it...

A:

Q: In which direction will the following equilibrium shift when solid sodium chloride is added to an aq...

A: Answer: This question is based on the Le-chatalier's principle which suggests on changing any parame...

Q: Aqueous sodium oxalate can react with aqueous calcium citrate [Ca3(CoHsO»)l to produce solid calcium...

A: Aqueos sodium oxalate ( Na2C2O4 ) reacts with aqueos calcium citrate ( Ca3(C6H5O7)2 ) to form calciu...

Q: Calculate the standard enthalpy change for the reaction at 25 C. Standard enthalpy of formation valu...

A: enthalpy is a thermodynamic property. for the given displacement reaction we are required to find th...

Q: [H30*] = %3D

A:

Q: lexothermic Is this reaction exothermic, endothermic, or neither? O endothermic O neither If you sai...

A:

Q: The sum of the exponents of the concentration terms in the rate equation for the reaction is called ...

A: Ans b order

Q: If you will measure 90µl of liquid, what pipet calibration should you use appropriately?  10 ul - 1...

A: A pipette is laboratory glassware used for the accurate measurement of the volume of a liquid.

Q: An analytical chemist is titrating 213.4 mL of a 0.3200M solution of butanoic acid (HC,H,CO, with a ...

A:

Q: Pure aluminum (Al) metal reacts with hydrochloric acid (HCI) to produce aluminum chloride AICI,) and...

A: Given values-> Expected mass of AlCl3 formed = 3.5 gm (Theoretical yield) Actual mass of AlCl3 pr...

Q: Calculate [H,O*] for a 8.92 × 10–3 M HBr solution. [H,O*] = M Calculate [H,O+] for a 1.20 x 10-2 M K...

A: Given,  (A).  [HBr] = 8.92 x 10-3 M  [H3O+] = ? (B).  [KOH] = 1.20 x 10-2 M  [H3O+] = ?    

Q: Sancy ways: 1) v vs. [S] and 2) 1/v vs 1/[S] using Microsoft Excel. Rate (v) of product (ug/ minute)...

A: Solution -

Q: An electrochemical cell has the following reaction occuring at the anode. 2+ (aq) Zn (s)- Zn Which o...

A: For an electrochemical cell- Ecell = Eanode + Ecathode

Q: C. What kind of chemical reactions can the -NO2 group undergo? What is the expected product? What is...

A:

Q: What is the pH of a solution of 3.21 M HClO? What the percent dissociation of this solution?

A:

Q: Arrange the compounds in order of INCREASING reactivity towards bromination. 1.  Toluene, Nitrobenz...

A: Concept is based on Electrophilic substitution reaction:

Q: What is the half wave potential (E1/2)s of the free Cd2+ metal ion in the absence of ammonia ligand ...

A: The redox reaction under study is: Cd2++6 NH3↔Cd(NH3)62+                        E0=0.16 V

Q: Use two concentration tables to calculate the concentrations of the following species present in a 0...

A: Ionic salts dissociates completely in aqueous solution where covalent compound  doesn't.  Strong aci...

Q: How does nuclear fission generate electricity? Use the paperclip button below to attac

A:     What is nuclear Energy?  Nuclear energy comes from the binding energy that is stored in the ce...

Q: Calculate the theoretical percentage of water in Cu2SO4·2H2O (Molar mass of the hydrate is 259.19 g/...

A: