Practice Exercises 4.6Pure aluminum (Al) metal reacts with hydrochloric acid (HCI) to produce aluminum chloride(AICI,) and hydrogen (H,) gas.a.Write the balanced chemical equation for the reaction described above.b.If the expected mass of AICI, to be formed is 3.5 g, what should be the initial mass of thepurealuminum metal?С.If the actual mass of AICI, produced is 3.1 g, what is the percentage yield of the reaction?3.Love of LabReaction Yield on pages 102C-102D

Given values-> Expected mass of AlCl3 formed = 3.5 gm (Theoretical yield) Actual mass of AlCl3…

Pure aluminum (Al) metal reacts with hydrochloric acid (HCI) to produce aluminum chloride AICI,) and hydrogen (H,) gas. Write the balanced chemical equation for the reaction described above. If the expected mass of AlCI, to be formed is 3.5 g, what should be the initial mass of the pure aluminum metal? If the actual mass of AICI, produced is 3.1 g, what is the percentage yield of the reaction?

Pure aluminum (Al) metal reacts with hydrochloric acid (HCI) to produce aluminum chloride AICI,) and hydrogen (H,) gas. Write the balanced chemical equation for the reaction described above. If the expected mass of AlCI, to be formed is 3.5 g, what should be the initial mass of the pure aluminum metal? If the actual mass of AICI, produced is 3.1 g, what is the percentage yield of the reaction?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Nitrogen and oxygen react as follows: N2(g)+2O2(g)2NO2(g) Suppose 1.25mol of N2 and 50.0g of O2 are mixed together. a.Which one is the limiting reactant? b.What is the maximum mass in grams of NO2 that can be produced from the mixture?
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
When elemental boron, B, is burned in oxygen gas, the product is diboron trioxide. If the diboron trioxide is then reacted with a measured quantity of water, it reacts with the water to form what is commonly known as boric acid, B(OH)3 . Write a balanced chemical equation for each of these processes.
Urea, CO( NH2)2, is manufactured on a large scale for use in producing urea-formaldehyde plastics and as a fertilizer. What is the maximum mass of urea that can be manufactured from the CO2 produced by combustion of 1.00103 kg of carbon followed by the reaction? CO2(g)+2NH3(g)CO( NH2)2(s)+H2O(l)
A common experiment in introductory chemistry courses involves heating a weighed mixture of potassium chlorate, KClO3 , and potassium chloride. Potassium chlorate decomposes when heated, producing potassium chloride and evolving oxygen gas. By measuring the volume of oxygen gas produced in this experiment, students can calculate the relative percentage of KClO3 and KCl in the original mixture. Write the balanced chemical equation for this process.
The reaction of an element X() with element Y() is represented in the following diagram. Which of the elements bestdescribes this reaction? mg src=Images/HTML_99425-6-16ALQ_image001.jpg alt="" align="top"/> msp;3X+6YX3Y8 msp;3X+6YX3Y6 msp;X+2YXY2 msp;3X+8Y3XY2+2Y
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
A product weighing 14.37g was isolated from a reaction. The amount of product possible according to a calculation was 17.55g. What was the percentage yield?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
Solid ammonium chloride decomposes to form ammonia and hydrogen chloride gases. How many grams of ammonia will be formed upon the complete reaction of 28.3g of ammonium chloride? Solid ammonium chloride decomposes upon heating, forming gaseous ammonia and hydrogen chloride. As the two gases cool, they react to re-form solid ammonium chloride, which appears as smoke.