Theoretical yield of chemical reactions Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H,0). What is the theoretical yield of sodium bromide formed from the reaction of 47.7 g of hydrobromic acid and 41.8 g of sodium hydroxide? Round your answer to 3 significant figures. dlo

Theoretical yield of chemical reactions Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H,0). What is the theoretical yield of sodium bromide formed from the reaction of 47.7 g of hydrobromic acid and 41.8 g of sodium hydroxide? Round your answer to 3 significant figures. dlo

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 60QAP: The text explains that one reason why the actual yield for a reaction may be less than the...

See similar textbooks

Similar questions

For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
For each of the following unbalanced chemical equations, suppose exactly 5.0 g of each reactant is taken. Determine which reactant is limiting, and calculate what mass of each product is expected, assuming that the limiting reactant is completely consumed. msp;Na(s)+Br2(l)NaBr(s) msp;Zn(s)+CuSO4(aq)ZnSO4(aq)+Cu(s) msp;NH4Cl(aq)+NaOH(aq)NH3(g)+H2O(l)+NaCl(aq) msp;Fe2O3(s)+CO(g)Fe(s)+CO2(g)
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
You react nitrogen and hydrogen in a container to produce ammonia, NH3(g). The following figure depicts the contents of the container after the reaction is complete. a Write a balanced chemical equation for the reaction. b What is the limiting reactant? c How many molecules of the limiting reactant would you need to add to the container in order to have a complete reaction (convert all reactants to products)?