Using the provided table, determine the enthalpy for the reactionC(s) + CO2 (g)→ 2 CO (g)SubstanceAH¡ (kJ/mol)kJ/molC (s)СО2 (9)-393.5123CO (g)-110.546.C789.+/-х 100+LO

For a chemical reaction, the enthalpy of reaction is the difference in enthalpy between products and…

Answered: Using the provided table, determine the…

Using the provided table, determine the enthalpy for the reaction C(s) + CO2 (g)–→ 2 CO (g) Substance AHť (kJ/mol) C (s) CO2 (g) -393.5 CO (g) -110.5

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter15: Energy And Chemical Change

Section: Chapter Questions

Problem 71A

See similar textbooks

Related questions

Q: In a coffee cup calorimeter, a student adds 2.50 g of calcium, followed by addition of 50.0 mL of…

A: Since the temperature change in positive, heat is absorbed by the solution and released by the…

Q: 2. Given the following thermochemical equations and the corresponding enthalpy change for each…

A: Given: 2C (graphite) + H2 (g) → C2H2 ∆H = +226.7 KJ equation (1) C (graphite)…

Q: A scientist measures the standard enthalpy change for the following reaction to be -976.0 kJ:…

A: Answer :- The standard enthalpy of formation of H2O(g) = -253.5 kJ/mol.…

Q: their enthalpy changes, N2 (g) + O2 (g) --> 2 NO (g)…

Q: The enthalpy change for the reaction of hydrogen gas with fluorine gas to produce hydrogen fluoride…

A: The formation of hydrogen fluoride from hydrogen gas and fluorine gas is expressed as, H2g+F2g→2HFg…

Q: When 15.3 g of sodium nitrate, NaNO, (85 g/mol), was dissolved in water in a constant-pressure…

Q: When 50.0 mL of 1.20 M of HCl(aq) is combined with 50.0 mL of 1.30 M of NaOH(aq) in a coffee-cup…

Q: When a 0.740-g sample of trinitrotoluene (TNT), C7H5N206, is burned in a bomb calorineter, the…

A: In a bomb calorimeter, heat of combustion is calculated as: q=mC∆T where m is mass, C is heat…

Q: Using the provided table, determine the enthalpy for the reaction C's) + CO, (g) -2 CО (9) Substance…

Q: When a student mixes 50 mL of 1.0 M HCl and 50 mL of 1.0 M NaOH in a coffee-cup calorimeter, the…

A: Given: Total volume of solution= 100 mL Initial temperature= 21°C Final temperature= 27.5°C

Q: A scientist measures the standard enthalpy change for the following reaction to be 5.4 kJ : Fe(s) +…

A: The Standard enthalpy change for the reaction (∆H°rxn) = 5.4 KJ Reaction: Fe(s) + 2 HCl (aq)…

Q: In a calorimeter, 1.80 g of NH&NO%0) (80.04 gmol') is mixed with 74.0 g of water at an initial…

A: Given data,Mass of NH4NO3=1.80gMass of water=74.0gInitial temperature=25oCFinal…

Q: When a 0.740-g sample of trinitrotoluene (TNT), C,H,NO, is burned in a bomb calorimeter, the…

A: Dear student , since you have posted multiple questions we will allow to solve only first question…

Q: 3. When a student mixes 50 mL of 1.0 M HCI and 50 mL of 1.0M NaOH in a coffee- cup calorimeter, the…

A: given - 50 ml of 0.1 HCl 50 ml. of 0.1 NaOH density = 1 g/ml specific heat = s = 4.18 J/g K initial…

Q: A 1.99 g sample of a soluble salt dissolves in 23.8 mL of water in a coffee cup calorimeter. When…

A: Given, mass of sample of salt m = 1.99 g increase in temperature = 24.3 °C specific heat of solution…

Q: For which one of the following substances is the standard enthalpy of formation, AHf, equal to zero?…

A: Answer: option b: lead [Pb(s)]; having standard enthalpy of formation (∆Hf), equal to zero.

Q: Determine the standard enthalpy change for each of the following reactions. Report your answers to…

Q: A scientist measures the standard enthalpy change for the following reaction to be 11.0 kJ…

A: Given: Standard reaction enthalpy= 11.0 kJ

Q: Which balanced chemical equation corresponds to the enthalpy of formation (ΔHfo) of formaldehyde,…

A: Enthalpy of Formation is defined as the energy change to form one mole of compounds from its…

Q: A scientist measures the standard enthalpy change for the following reaction to be -819.0 kJ :CH4(g)…

A: The given reaction is, Standard enthalpy of formation of CH4(g), O2(g) and H2O(g) is given below,

Q: A scientist measures the standard enthalpy change for the following reaction to be 215.5 kJ : CH4(g)…

Q: A scientist measures the standard enthalpy change for the following reaction to be -200.7 kJ :…

A: The given reaction is as follows: CO(g) + 3H2(g) → CH4(g) + H2O(g) The standard enthalpy change for…

Q: In the recovery of iron from iron ore, the reduction of the ore is actually accomplished by…

Q: Using the provided table, determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO, (g)→…

A: Solution - According to the question - Given - The enthalpy change for the reaction is given as…

Q: Combine the following equations to determine the enthalpy change for the combustion of 1 mole of…

A: The heat content of any substance or reaction system can be expressed in terms of enthalpy whereas…

Q: A calorimeter contains 16.0 mL of water at 14.5 °C. When 2.20 g of X (a substance with molar mass of…

A: Given : Mass of X = 2.20 g Volume of water = 16.0 mL Heat capacity (C) = 4.18 ∆T = 25.5 - 14.5 =…

Q: At 850°C, CaCO3 undergoes substantial decomposition to yield CaO and CO2. Assuming that the ∆H°f…

A: Standard enthalpy of formation of CaCO3 (s) = -1207 KJ/mol Standard enthalpy of formation of CaO (s)…

Q: What is the change in the enthalpy (in kJ) for the complete combustion of 39.0 g of fructose,…

A: Heat of reaction or enthalpy change∆Hrxn is defined as heat released and absorbed during a reaction.…

Q: A scientist measures the standard enthalpy change for the following reaction to be -57.0 kJ:…

A: Given balanced chemical equation, Ca(OH)2(aq) + 2 HCl(aq) → CaCl2(s) + 2 H2O(l) The enthalpy change…

Q: The work done by a system is 8 J, when 40 J heat is supplied to it. What is the

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: At 850°C, CaCO3 undergoes substantial decomposition to yield CaO and CO2 Assuming that the ΔH°f…

A: The balanced chemical equation is given below, CaCO3(s)→CaO(s)+CO2(g) To calculate ΔH°f values. Add…

Q: A scientist measures the standard enthalpy change for the following reaction to be 208.5 kJ :…

Q: (a) Combustion of 1 mole of butane gas, C4H10 involves 2874 kJ of heat. (i) Write a thermochemical…

A: Since you have posted multiple questions, we will solve only the first question for you according to…

Q: In the recovery of iron from iron ore, the reduction of the ore is actually accomplished by…

Q: A scientist measures the standard enthalpy change for the following reaction to be 209.4 kJ : CHĄ(g)…

A: Given chemical equation: CH4g+H2Og→3H2g+COg

Q: A scientist measures the standard enthalpy change for the following reaction to be -67.6 kJ :…

A: The expression for the calculation of change in enthalpy is shown below: where; ∆Hproducts =…

Q: A 1.27-g sample of fumaric acid (C4H4O4) is burned in a bomb calorimeter and the temperature…

A: Divide the total heat gain by the calorimeter with number of moles of fumaric acid.

Q: [2] When 1.045 g of CaO is added to 50.0 ml of water at 22.0 °C in a coffee-cup calorimeter, the…

A: Heat release during reaction = heat gain by water and calorimeter.

Q: calculate the heat (in J) of the reaction if 50.0 mL of HCl is added to 50.0 mL of NaOH in a…

A: When an acid and base react to form a salt and water and heat evolved in resultant solution is…

Q: When 50.0 mL of 1.27 M of HCl(aq) is combined with 50.0 mL of 1.32 M of NaOH(aq) in a coffee-cup…

Q: In the recovery of iron from iron ore, the reduction of the ore is actually accomplished by…

A: Interpretation - In the given above all the reactions , here we have to calculate the ∆Ho for the…

Q: When a reaction occurs in a calorimeter, the temperature of 60 g of a reaction mixture increased by…

A: Given that : Mass of mixture (m) = 60 g Change in temperature (∆T) = 5°C Specific heat capacity (s)…

Q: Copper metal can be produced by heating copper(II) oxide and hydrogen gas. Another product of the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -737.2 kJ :…

A: 2CO (g) + 2NO (g) → 2CO2 (g) + N2 (g) The standard enthalpy change for the reaction is : - 737.2 KJ…

Q: The combustion of propane is represented by the following reaction: 50 21g) 3CO2(8) 4H2O(g) 2043 kJ…

A: The balanced reaction taking place is given as, => C3H8 (g) + 5 O2 (g) ---------> 3 CO2 (g) +…

Q: Using the provided table, determine the enthalpy (in kJ/ mol) for the reaction 2 NH3 (g) + 3 N,0…

A: The given reaction is: 2NH3 (g) + 3N2O (g) → 4N2 (g) + 3H2O (g) The given enthalpies of formation…

Q: 6.81 Compounds with carbon-carbon double bonds, such as ethylene, C,H4, add hydrogen in a reaction…

Q: In the recovery of iron from iron ore, the reduction of the ore is actually accomplished by…

Q: Consider the decomposition of hydrogen bromide to form hydrogen and gaseous bromine, Br2(g):…

A: The given forward reaction is : HBr(g) = 1/2H2(g) + 1/2Br2(g) H = 72.5 kJ a. The reverse reaction…

Concept explainers

Thermochemistry

Thermochemistry can be considered as a branch of thermodynamics that deals with the connections between warmth, work, and various types of energy, formed because of different synthetic and actual cycles. Thermochemistry describes the energy changes that occur as a result of reactions or chemical changes in a substance.

Exergonic Reaction

The term exergonic is derived from the Greek word in which ‘ergon’ means work and exergonic means ‘work outside’. Exergonic reactions releases work energy. Exergonic reactions are different from exothermic reactions, the one that releases only heat energy during the course of the reaction. So, exothermic reaction is one type of exergonic reaction. Exergonic reaction releases work energy in different forms like heat, light or sound. For example, a glow stick releases light making that an exergonic reaction and not an exothermic reaction since no heat is released. Even endothermic reactions at very high temperature are exergonic.

Question

100%

Using the provided table, determine the enthalpy for the reaction
C(s) + CO2 (g)→ 2 CO (g)
Substance
AH¡ (kJ/mol)
kJ/mol
C (s)
СО2 (9)
-393.5
1
2
3
CO (g)
-110.5
4
6.
C
7
8
9.
+/-
х 100
+
LO

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Benzoic acid, C6H5COOH, is a common standard used in bomb calorimeters, which maintain a constant volume. If 1.20 g of benzoic acid gives off 31, 723 J of energy when burned in the presence of excess oxygen and in a water bath having a temperature of 24.6 C, calculate q, w, H, and U for the reaction.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
The reaction enthalpy for oxidation of styrene, C8H8, has been measured by calorimetry. C8H8() + 10 O2(g) 8 CO2(g) + 4 H2O() rH = 4395.0 kJ/mol Use this value, along with the data from Table 4.2, to calculate the standard formation enthalpy of styrene, in kJ/mol. Table 4.2 Selected Standard Formation Enthalpies, fH, at 25C
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?