Answered: Using the standard reduction potential,…

Using the standard reduction potential, Calculate the standard emf for each of the following reactions: 2A13* (aq) + 3Ca(s) ---> 2A1S) + 3Ca" (aq) (in (V) 3 decimal places,

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105CP

See similar textbooks

Related questions

Q: Given the standard reduction potentials for an element A, at 25 °C: А2"(аg) + е > A (ag) E1° = 1.09…

A: Standard cell potential is an intensive property which does not depend on amount or mass of the…

Q: A voltaic cell is constructed with a Cu(s) |Cu2+ (aq) half cell and a Ag(s) |Ag+ (aq) half cell. If…

Q: How many seconds are required to deposit 0.189 grams of manganese metal from a solution that…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: Assuming SATP conditions, (a) calculate the standard cell potential of a copper-zinc cell based on…

A: Given reaction is Cu(s) + Zn2+(aq) -------> Cu2+(aq) + Zn (s) The standard reduction potentials…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2vo, (aq) +…

A: Given-> Concentration of VO2+ = 3.63 M Concentration of H+ = 1.38 M Concentration of VO2+ = 0.607…

Q: How long will it take for a uniform current of 6.00 A to deposit 78.0 g gold (197.0 g/mol) from a…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: The equilibrium constant, K, for a redox reaction is related to the standard cell potential, E by…

A: A) The reaction taking place is given as, => Fe (s) + Ni2+ (aq) ---------> Fe2+ (aq) + Ni (s)…

Q: Calculate the standard cell potential, ?∘cell, for the reaction shown. Use these standard reduction…

A: Interpretation - To calculate the standard cell potential for the given reaction by using their…

Q: At 25 oC, if the potential of a Zn–H + cell is 0.55 V at 25oC when [Zn2+] = 1.0 M and PH2 = 1.0 atm,…

A: Given Temperature = 25°C = (25 + 273.15)K = 298.15 KGiven Cell Zn-HCell reaction Zn(s) + 2H+…

Q: Calculate the standard cell potential, E, for the equation cell Cr(s) + F, (g) – Cr*(aq) + 2F (aq)…

Q: The galvanic cell utilizes the following reaction of oxidation of iron and reduction of cadmium at…

A: Fe + Cd+2 - - - - - > Fe+2 + Cd Cd+2 +2e- - - - - - > Cd E° = - 0.40 V Fe - - -…

Q: Suppose a metal electrode is being coated with silver according to the half-reaction, Ag+(aq) + e-…

A: Current = 0.850 A Time = 20.0 min ....Or = 20.0 min × (60 sec / 1 min ) ...(because, 1 min = 60…

Q: Fe(s) Fe²+ (aq) || MnO4 (aq), Mn²+ (aq)| Pt(s) | Write the half reactions: Oxidation: Reduction: Net…

A: Given in following question a cell reaction Fe(s)/Fe+2(aq)//Mno4-(aq),MN+2 /pt thus cell…

Q: S. Given the following reduction half-reactions at 298 K: Half-Reaction E (V) at 298 K Fe" (aq) + e→…

A: The electrode which has less negative reduction potential will act as a cathode and will undergo…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Recall the given redox reaction, 6 Cl- aq + 2 NO3- aq + 8 H+ aq → 3 Cl2 g…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: Use the Ksp value and the standard reduction potential of Fe2+1aq2 to calculate the standard…

A: Ksp of a compound determines the equilibrium between solid and its ions formed in a solution. It…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: Calculate the cell potential, ε for this galvanic cell and ΔG for the cell reaction these…

A: The cell reaction is Overall reaction is given by,

Q: The corrosion of iron is an electrochemical process that involves the standard reduction potentials…

A: given data are- Fe(s) ⟶ Fe2+(aq) + 2e-Eo = -0.44 V O2(g) + 4H+(aq) + 4e- ⟶ 2H2O(l) Eo = 1.23 V…

Q: Following is a diagram of a voltaic cell. If the standard reduction potentials for Zn2+ (aq, 1 M) +…

A: A Galvanic cell is made up of an anode and a cathode. Reduction reaction occurs at cathode whereas…

Q: Calculate the standard cell potential, Ee, for the equation Sn(s) + F,(g) → Sn²+(aq) + 2F¯(aq) Use…

A: Standard reduction potential can be obtained using its respective table. We know more negative…

Q: Diagram below shows a galvanic cell that operates under standard conditions represented by the…

A: For a Galvanic cell, The electrode in which the oxidation takes place is called the anode, and the…

Q: 8. Given the following unbalanced redox reaction: CIO (aq) + (aq) → 103(aq) + CH(aq) Basic solution.…

Q: Consider the following reaction and its AG AG° = -408.0 kJ/mol Mg(s) + Ni?+(aq) → Mg²+(aq) + Ni(s)…

A: Given-> Mg(s) + Ni2+(aq) ----> Mg2+(aq) + Ni(s) ∆G° = -408.0 KJ/mole = -408000 J/mole (1 KJ =…

Q: Given the following standard reduction potentials, determine K for the following reaction at 25°C.…

A: Given cell reaction; Pb2+(aq) + SO42−(aq) → PbSO4 (s) The standard reduction potential are: Pb2+(aq)…

Q: Half-Reaction Standard Reduction Potential , E°(V) Ag+(aq)+e−→Ag(s)…

A: Given that E°(V) Ag+(aq)+e−→Ag(s) +0.80…

Q: The standard reduction potential for the reduction ofRuO4-(aq) to RuO42-(aq) is +0.59 V. Which of…

A: Given: The standard reduction potential for the reduction of RuO4-(aq) to RuO42-(aq) is +0.59 V

Q: Determine K for each of the following reactions Determine AGa for each of the following reactions…

Q: Will oxygen, O2, oxidize iron(II) ion in solution under standard conditions? Cathode (Reduction)…

Q: Half-Reaction Standard Reduction Potential, E°(V) Ag+(aq)+e−→Ag(s) +0.80 Pb2+(aq)+2e−→Pb(s) −0.13…

Q: Calculate AG° for the following cell reaction: TI(s) | TI* (aq) || Ni²+ (ag) | Ni(s) From AG°,…

Q: Using values from the table of standard reduction potentials, calculate the cell potential (in V) of…

A: An electrochemical cell is a cell which is used to concert chemical energy to electrical energy Two…

Q: 11. Consider the following reaction and its AG-AGo at 25.00 °C. 2Ag(aq)+Cu(s) 2Ag(s)+Cu*(aq) AG…

A: Given reaction is : 2Ag+ (aq) + Cu (s) ------------> 2Ag (s) + Cu2+ (aq) , ΔG0 = -88660 J/mole…

Q: Consider the following reaction and its AG" at 25.00 °C. Mg(s) + Ni" (aq) – Mg²* (aq) + Ni(s) AG =…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: Consider the reaction below: 2 Ag(aq) + +Fe(s) → 2 Ag(s) + Fe^2+(aq) ΔG° = −241.0kJmol a.…

Q: Use the standard reduction potentials shown here to answer the questions. A copper, Cu(s), electrode…

A: Given that standard hydrogen electrode acts as cathode and hence copper electrode will act as anode…

Q: A constant current of 0.912 A is passed through an electrolytic cell containing molten MgCl2 for…

A: Given values:I = 0.912 ATime = 18.5 h It is known that 1 h = 3600 sec.Therefore, 18.5 h = 18.5×3600…

Q: Consider the following reaction and its AG° at 25.00 ° 2 Ag*(aq) + Cu(s) → 2 Ag(s) + Cu²+(aq) AG° =…

A: Given that: temperature, T = 25 oC ∆G°= -88.66 kJ/mol To find: standard cell potential, Eocell?…

Q: Calculate the standard cell potential, ?∘cellEcell°, for the reaction shown. Use these standard…

Q: A standard hydrogen electrode has a half-cell reduction potential of zero at 25 C. Calculate the…

A: Answer:- This question is answered by using the simple concept of electrochemistry which involves…

Q: Consider the following reaction and its AG° at 25.00 °C. 2 Ag*(aq)+Cu(s) → 2 Ag(s) + Cu2+(aq) AG° =…

A: ∆G = -88.66 KJ/mol = -88660 J/mol Temperature (T) = 25°C = 25+273 = 298 K R = 8.314 J/mol.K Keq =…

Q: (a) The potential for the following electrochemical cell at 25"C is 0.34 V. Pe(s}l}2 (8, 1 atm)|…

Q: A galvanic cell is given by the following cell diagram: Zn (s) | Zn? + (aq) (4.0-10-3 M) | Ag +1…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

Using the standard reduction potential, Calculate the standard emf for each of the following
reactions:
2A13* (aq) + 3Cas) ---> 2A1S) + 3Ca" (aq)
(in (V) 3 decimal places,

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
The equation G = nF also can be applied to half-reactions. Use standard reduction potentials to estimate Gf for Fe2+ (aq) and Fe3+ (aq). Gf for e= 0.)
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
A metallurgist wants to gold-plate an object with a surface area of 17.21 in2. The gold plating must be 0.00200 in. thick (assume uniform thickness). (a) How many grams of gold (d=10.5g/cm3) are required? (b) How many minutes will it take to plate the object from a solution of AuCN using a current of 7.00 A? Assume 100% efficiency.
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)