Answered: What is the equation to calculate a…

Science

Chemistry

What is the equation to calculate a change in temperature? How will you determine what is the final temperature?

Chemistry In Focus

7th Edition

ISBN:9781337399692

Author:Tro, Nivaldo J.

Publisher:Tro, Nivaldo J.

Chapter11: The Air Around Us

Section: Chapter Questions

Problem 48E: A 2.8 L balloon is warmed over a toaster, and its temperature rises from 25Cto45C. What is its final...

See similar textbooks

Related questions

Q: Using the specific heat capacities of CO2 and air determine which sample (air or CO2) shows the…

A: Specific heat capacity is the amount of heat absorbed by 1 g of substance to raise its temperature…

Q: C, what will be the final temperature?

Q: 1. State the difference between heat and temperature. How are they measured?

A: Note: According to the rules we can answer only first question. Pls repost others. Given: Heat and…

Q: 1. Calculate the amount of heat in joules needed to completely boil 35 grams of water at 100°C.…

A: Amount of heat required by the water at 100 oC to boil or convert into steam = mass of water x…

Q: A knowm amount of heat is transferred to a sample of aluminum and the aluminum raises its…

A: Heat transferred can be calculated using the following equation,

Q: A 100.0 g sample of water at 90 oC is added to a 500.0 g sample of water at 10 oC. The final…

A: It is given that a 100 g sample of water initially at a temperature of 90°C is added to 500 g of…

Q: Please answer the following question: A sealed metal canister at 749 torr pressure is heated from…

A: Here, we have to find the final pressure in atm when a sealed metal canister at 749 torr pressure is…

Q: I am a bit confused. Isnt the formula to find the change in temperature the Final Temperature minus…

A: q = heat energy q = heat energy is the total amount of energy. This is an amount and has no…

Q: If the initial temperature of 120. g of ethanol is 20. °C, what will be the fi nal temperature after…

A: Given : Heat energy added = 950 cal mass of ethanol = 120 g Initial temperature (T1) = 20°C

Q: Is freezing an exothermic process or endothermic process? Explain how you are experimentally…

A: Freezing is an exothermic process.

Q: What are the factors affecting the Kinetic Energy (joules)? Why?

A: The energy possesed by body dueto its motion is known as kinetic energy.

Q: 25. Explain the difference between heat and temperature.

A: Heat and temperature both are thermodynamic properties of system. Heat is form of energy.…

Q: Define the term Temperature?

A: Solution : Temperature is a physical change that is used to measure the hotness or coldness…

Q: Consider the following graph of the kinetic energy distribution among molecules at temperature-…

Q: the initial temperature of the zinc?

Q: A 100.0 g sample of water at 90 oC is added to a 100.0 g sample of water at 10 oC. The final…

A: The final temperature after mixing is given by. Tf=mhchTh+mcccTcmhch+mccc where m is the mass, T is…

Q: 24. List three common units for measuring temperature.

A: Temperature is the measure of the heat present in the substance. We use the definite units to…

Q: Calculate the number of joules in a Btu.

A: Given :- 1 Btu (British thermal unit) To find :- value in joules

Q: A student modeled the exothermic synthesis reaction that occurs when solid iron and liquid sulfur…

A: The given reaction is exothermic in nature, i.e., it releases heat overall.

Q: Define kinetic energy and explain what factors, or variables, cause kinetic energy to change

A: Kinetic energy of a system is the energy which is possessed due to it's motion.Kinetic energy is…

Q: What effect does the initial temperature of the water have on the change in temperature of the water…

A: While hot metal was added into the water. The hot metals lose its temperature (energy) into the…

Q: Question 11 of 15 > Two substances at different temperatures are brought together and allowed to…

Q: After release os sensible heat, the temperature of a substance ____. Explain? a. May increase or…

A: Sensible heat is defined as the heat which is either added or removed from the system such that…

Q: Find the amount of heat energy needed to raise the temperature

Q: What was the mass of a carbon sample, in grams, if 940J was needed to raise the temperature of the…

A: Heat can be calculated by following formula Q = m c (ΔT) Where Q is the heat energy M is the mass…

Q: thermometer A sample of glass, which has a specific heat capacity of 0.670 J·g contains 200.0 g of…

Q: A sample of brass, which has a specific heat contains 200.0 g of water. The brass sample the…

A: Loss of Heat of the Metal brass = Gain of Heat by the Water -Qbrass = Q water Q = mC∆T -mC ∆T for…

Q: s its final temperature if

Q: You are given a metal and asked to identify it by determining its specific heat. You place the metal…

Q: How much heat is needed to heat up 36 kg of hydrogen gas from 12.0C to 48.0C?

A: The specific heat capacity for a given chemical substance or a solution refers to the amount of the…

Q: Water changes from a liquid to a gas when heated to its boiling point because:Immersion Reader A)…

Q: Show a graph and explain the relationship of temperature and calorimeter constant.

A: Show a graph and explain the relationship of temperature and calorimeter constant.

Q: A calorimeter is an insulated device in which a chemical reaction is contained. By measuring the…

A: Formula used q = mwaterCwaterdT + CxdT where q= heat dT = change in temperature , C = heat…

Q: Determine the final temperature after 25.0 kJ of energy is added to 500.0 g of water initially at…

A: Given information: Initial Temperature = 21.5 °C Energy = 25.0 kJ Mass of water = 500.0 g Cp for…

Q: What has been linked to periods of increased global temperatures?

A: A question based on environmental pollution that is to be accomplished.

Q: Which of the statements is correct about constant-volume bomb calorimeter? a. No heat enters or…

Q: find the initial temperature of water, (e), (k), (l)

A: We have to predict the initial temperature of calorimeter , heat absorbed by Calorimeter and water.…

Q: From a thermochemical point of view, explain why a carbon dioxide fire extinguisher or water should…

A: Standard enthalpy of formation of MgO = -601.7 kJ/mol Standard enthalpy of formation of Mg(OH)2 =…

Q: A sample of gas under a pressure of 622 mm Hg has a temperature of of 233 K. The pressure is…

Q: During a Calorimeter experiment, you needed to dry the hot metal sample prior to putting it in the…

A: Colorimeter is an apparatus used to measure enthalpy change of a reaction or specific heat capacity…

Q: Q1: Three identical flasks contain three different gases at standard temperature and pressure. Flask…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: A sample of solid silicon is heated with an electrical coil. If 162 Joules of energy are added to a…

Q: Determine the mass of a sample of water in a coffee cup calorimeter if the final temperature is 65.7…

A: Given Initial temperature = 22.3 °C Final temperature = 65.7 °C heat added, Q = 27.6 kJ To…

Q: What will be the final temperature of the water and the bomb calorimeter in this experiment?

Q: Water has a high specific capacity; this means that it takes a lot of energy to change the…

A: Specific heat capacity is defined as the amount of heat required to increase the temperature of 1 g…

Q: In terms of generator gas, or wood gas. How much energy (Joules) can be yielded from 1 kilogram of…

A: Since the calorific value of wood gas is approximately = 20 KJ/Kg

Q: The temperature of a Bunsen burner flame is about

Q: Use the References to access important values if needed for this question. A sample of gaseous…

A: Solution : The amount of heat required to increase the specific amount of substance is given by…

Question

What is the equation to calculate a change in temperature?

How will you determine what is the final temperature?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Suppose heat flows into a vessel containing a gas. As the heat flows into the gas, what happens to the gas molecules? What happens to the internal energy of the gas?
Use the figure below to answer Question 4. Hydrogen and nitrogen react as shown to formammonia (NH3) . What is true of this reaction? A. Three ammonia molecules are formed, with zeromolecules remaining. B. Two ammonia molecules are formed, with twohydrogen molecules remaining. C. Six ammonia molecules are formed, with zeromolecules remaining. D. Two ammonia molecules are formed, with twonitrogen molecules remaining.
A 2.8 L balloon is warmed over a toaster, and its temperature rises from 25Cto45C. What is its final volume?
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
What quantity of heat energy would have to be applied to a 25.1 -g block of iron in order to raise the temperature of the iron sample by 17.5 °C? (See Table 10.1.)