Answered: What is the percent yield of a reaction…

What is the percent yield of a reaction that produced 15.7 g of AICI3, that has theoretical yield of 41.77 g. * A. 2.66 % B.266. 05 % O A C. 37. 59 % D. 3.759 % D. B.

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 14CR

See similar textbooks

Related questions

Q: JC-39) Tunneling of Protons and Electrons Given the same particle energy and barrier height and…

A: The solution of the given question is-

Q: An increase in the H* concentration by a factor of 1000 implies which of the following? A) The pH…

A: Hydrogen ion concentration is an important parameter of an aqueous solution. The concentration of…

Q: Upon successful bromination of an alkene, what is the molecular weight increase of the compound?

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: If no reaction occurs leave all boxes blank and click on "Submit". Write a net ionic equation for…

A: Given, aqueous solutions of sodium hydroxide (NaOH) reacts with perchloric acid (HClO4).

Q: OCH,CH2CH3

A: Given compounds are : (a). (b). Write the IUPAC name of the following compounds. Also, don't…

Q: A certain coal has the following ultimate analysis C=70%, N2=4%, H2=2.5%, O2=3.5%, S2=7%, Ash=5%,…

Q: 17. 0.60 mol of Br2 and 0.60 mol of Cl2 are placed in a 1.00 L flask and allowed to reach…

Q: As temperature increases for an exothermic reaction, the equilibrium constant ____. a. decreases…

Q: Match the following samples of hydrocarcon (Column A) to its appropriate physical property and…

Q: Calculate the selubility df CuSCN in OilH Nq SzQ; = 2.3x 167

A: Given: Concentration of Na2S2O3 = 0.1 M

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. KCN 2. H3O*

A: In conjugated ketone, electrophilic nature of carbon in carbonyl is decrease due to resonance.

Q: Write the half-reactions and balance the redox equations 1. Cr(s) + Ag+ → Cr+3 + Ag(s) 2. NO3 +…

A: GIVEN:-

Q: How many moles of gas is in the above 20.00 L container contains a gas at 50.00 oC and 1.000 atm.…

A: Ideal gas equation is given by, PV = nRT P = Pressure V = Volume n = no.of moles R =…

Q: Solid urea, (NH2)2CO, burns to give CO2, N2, and liquid H2O. Its heat of combustion is -632.2…

A: Answer: When 1 mole of a substance is burned completely in presence of oxygen then energy released…

Q: How can we make acetone? Give the reaction

A: Acetone

Q: Draw the major product of the aldol addition reaction. Ignore inorganic byproducts. H 1. NaOH 2.…

A: In Aldol reaction first of all base abstract acidic hydrogen and form enolate ion. Then enolate ion…

Q: example for organic elimination reaction show: a. the overall reaction (reactants --> products)…

Q: I still do not understand , mathematically, why this is the system we should use and how it is…

A: The pKa can be taken in the range of pH ± 1

Q: How do you call binary systems where the concentration of teh components are the same?

A: Given: A binary system where the concentration of the components are the same.

Q: 2- The dominant species of SO2 in the aerosol at pH 9 is SO, 3. given -2 K1 = 1.72 x 10? -8 K2 =…

A: In aerosol, SO2 exists as: H2SO3.

Q: но но но он HN. Cerebroside Sphingosine O Ganglioside Ceramide

A: Cerebrosides are neutral glycosphingolipids that contain a monosaccharide, normally glucose or…

Q: When a 18.3 mL sample of a 0.460 M aqueous hydrocyanic acid solution is titrated with a 0.330 M…

A: we need to calculate the pH for the above titration

Q: Whicj of the following statements are true? which are false? Why is each true or false? a. If a…

A: We are authorised to solve only first three subparts of a question. Please post rest of the subparts…

Q: The Ka for oxalic acid dissolution is 5.7 x10-2, reaction shown as H2CrO4 H++HCrO4- where the…

Q: What is the pH of a 0.2 M HCl aqueous solution? HCl(aq)+H2O(l)⇌H3O+(aq)+Cl−(aq) Ka=2×10^6

A: HCl is a strong acid can dissociate completely due to the high Ka value. As Ka (dissociation…

Q: Balance the following reaction: H2O + CO2 = C12H22O11 + O2

A: The reaction given is, => H2O + CO2 → C12H22O11 + O2

Q: 13) Determine the pOH of a 0.188 M NH3 solution at 25°C. The Kb of NH3 is 1.76 x 10-5. A) 5.480 B)…

A: In multiple questions we solve only first question according to the Bartleby guidelines. Write…

Q: C17H29COOH linolenic acid non-saponifiable w-3 fatty acid All are correct

Q: Determine the product formed when butanal (CH3CH2CH2CHO) is treated with each reagent. If no…

Q: Define the following terms: Molecular ion Fragment ion Abundance/Relative Intensity Mass to charge…

Q: HO HOʻ II II IV

Q: How many α and β particles are emitted when U 238/92 decays to Po 218/ 84?

A: Given: U23892 decays to 84Po218 α particle means 2He4 β particle means -1eo

Q: Balance

Q: DETERMINE EACH ITEM IF TRUE OR FALSE 1. The circle in a benzene ring represents the electrons that…

Q: Na A) The curved arrow(s) are going the wrong direction. B) The arrow is going from a site of high…

A: Lewis base is base which can abstract protan from the acid or abstract acidic hydrogen.

Q: Use the following atomic masses (in g/mol): K = 39.1; Mn = 54.94; O = 16; H = 1; P = 30.97; C =…

Q: 225 Ac 9.9 d 221Fr de days 4.8 m h hours meminutes Sseconds ms milliseconds usmicroseconds X1 32 ms…

Q: Calculate the mass of Nal that would be necessary to yield the same conductivity as the NaCl…

A: Given , mass of NaCl = 0.1 g mass of NaI =0.1 g

Q: kPa

Q: Which of the follovving hydrocarbons is INSOLUBLE in water?

Q: 5. Convert 450 Kakin to Cobslur and then to Fahrenhait (most wven settings are in Fahrenhait) by…

A: Given the ingredients and procedure to prepare banana bread. We need to find number of bananas…

Q: The percent yield in the preparation of iodoform from iodine crystals is 40.20%. Using the procedure…

Q: Use the following atomic masses (in g/mol): K = 39.1; Mn = 54.94; O = 16; H = 1; P = 30.97; C =…

A: Given acid-base reaction is H2SO4 + 2 NaOH --> Na2SO4 + 2 H2O At equivalents point Na…

Q: Use the following atomic masses (in g/mol): K = 39.1; Mn = 54.94; O = 16; H = 1; P = 30.97; C =…

A: Given : We have to calculate the mass of ZnO.

Q: Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in…

A: The reaction given is,

Q: State the Physical Properties of Ascorbic Acid

A: Ascorbic acid is also known as vitamin C. It is a covalent Molecule with Molecular formula of C6H8O6…

Q: Since the Coomassie Brilliant Blue G-250 is a highly (basic, acidic) dye, it cannot be used for…

A: The structure of Coomassie brilliant blue G-250 is:

Q: 18:3cA9,12,15 O cis-9,12-octadecadienoic, linoleic acid all cis-9,12,15-octadecatrienoic,…

A: In this question, we have to identify the given compound name.

Q: In the iodine clock experiment, if you increase the volume of vitamin C used, would the reaction…

A: If the volume of vitamin C is increased, the reaction for the conversion of I2 (colored) to I-…

Q: Add curved arrow(s) to draw step 2 of the mechanism. Modify the given drawing of the product as…

A: In an organic reaction mechanism, a curved arrow represents the transfer of electrons. In an organic…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

Choose the letter of the correct answer.

What is the percent yield of a reaction that produced 15.7 g of AICI3, that
has theoretical yield of 41.77 g. *
A. 2.66 %
B.266.05 %
A
B.
C. 37. 59 %
D. 3.759 %
O D.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
How many molecules of C2H4Cl2 can be prepared from 15C2H4 molecules and 8Cl2 molecules?
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
Antacids Magnesium hydroxide is an ingredient in some antacids. Antacids react with excess hydrochloric acid in the stomach to relieve indigestion. Mg(OH)2+HClMgCl2+H2O a. Balance the reaction of Mg(OH)2 with HCI. b. Write the mole ratio that would be used to determine the number of moles of MgCl2 produced when HCI reacts with Mg(OH)2 .
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
A sample of 0.53 g of carbon dioxide was obtained by heating 1.31 g of calcium carbonate. What is the percent yield for this reaction? CaCO3(s)CaO(s)+CO2(s)
Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain this compound, calcium carbide is reacted with nitrogen at high temperatures. CaC2(s)+N2(g)CaNCN(s)+C(s) What mass of CaNCN can be produced if 7.50 mol of CaC2 reacts With 5.00 molOf N2 ?
Outline the steps needed to determine the limiting reactant when 30.0 g of propane, C3H8, is burned with 75.0 g of oxygen. Determine the limiting reactant.