Which statement is incorrect about CO ligands? a. A CO ligand can accept electrons into its * MO; this weakens the C-O bond b. In the IR spectrum of Fe(CO)5, absorptions assigned to the CO stretching modes are at higher wavenumber than that of free c. CO ligands can adopt terminal, p2 and u3 bonding modes; the amount of back donation depends on the bonding mode d. Fluxional behaviour is common in metal carbonyl compounds, and can be investigated by 13C NMR spectroscopy

Which statement is incorrect about CO ligands? a. A CO ligand can accept electrons into its * MO; this weakens the C-O bond b. In the IR spectrum of Fe(CO)5, absorptions assigned to the CO stretching modes are at higher wavenumber than that of free c. CO ligands can adopt terminal, p2 and u3 bonding modes; the amount of back donation depends on the bonding mode d. Fluxional behaviour is common in metal carbonyl compounds, and can be investigated by 13C NMR spectroscopy

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 70AP

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Strong-field ligands (such as CN-) stabilise the M2* oxidation state. Reflect on the reason.
The SCN – ligand is an ambidentate ligand. When it is S-bound, it has the name thiocyanate, and the M–S–C bond angle is bent. When it is N-bound, it has the name isothiocyanate, and the M–N–C bond angle is ~180 ̊. (a) Draw Lewis dot structures for M–NCS and M–SCN that explain the observed geometries. (b) Predict the structures of the metal-ligand bonding when SCN– reacts with Fe 2+ to form the bright red Fe(SCN)2+ ion. (c) Predict the method of bonding when Cr3+ reacts with the SCN – ligand
Given the colors observed for VO43- (orthovanadate ion), CrO42- (chromate ion), and MnO4- (permanganate ion), what can you say about how the energy separation between the ligand orbitals and the empty d orbitals changes as a function of the oxidation state of the transition metal at the center of the tetrahedral anion?
a. Briefly describe the chelate effect b. Give the structure of a ligand that will exhibit the chelate effect when bound to a metal ion.
How does Ligand Field Theory explain the interaction between the ligand with the central metal leading to increase or decrease of Δo ? Use the concepts of π-donor and π-acceptor ligands.
Draw a simplified MO diagram of the ML5O complex considering only metal d- orbitals, oxygen 2p orbitals and L lone pairs.
Which ligand below gives the LEAST stability to Pd2+ in forming a square planar complex
what about this answer ? Is this also correct? Isn't it contradict? " However, the back-donation from the metal center to CO's empty 2π* orbital is less extensive than with NO. This is because CO's 2π* orbital is higher in energy compared to NO's 2π* orbital. In summary, both NO and CO are pi-acceptor ligands due to their empty 2π* orbitals. However, NO is expected to be a stronger pi-acceptor ligand than CO because of the presence of the unpaired electron in its 2π* orbital and the lower energy of this orbital. The stronger pi-acceptor ability of NO can lead to a more stable metal-ligand bond, as well as greater electron density redistribution between the metal center and the ligand." I'm so confused NO is weaker or stronger pi-acceptor ligands
Carbon monoxide is a good ligand and is toxic. Why is the isoelectronic N2molecule not toxic?
(c) In the given complex of [Fe(CO)] having CO ligand, carbon and oxygen both having lone pair of electrons, but carbon lone pair take part in bonding with the central Fe atom rather than oxygen. Explain why in details? (ii) The bond distance and angle in SO2Cl2 and S2Cl2 and how many lone pairs are in ICL4-??
Make a prediction about each structures' splitting energy relative to an octahedral complex with all water ligands. Provide some theoretical basis for these claims (see the protocol for Part 2 and textbook chapter 22 to deepen understanding of these concepts). the structure is K3[Fe(C2O4)3]· 2 H2O