Which statement is incorrect about CO ligand? Select one: O a. CO ligands can adopt terminal, u2 and u, bonding modes, the amount of back donation depends on bonding mode. O b. A CO ligand can accept electrons into its n* MO; this weakens the C-O bond O c. In the IR spectrum of Fe(CO), absorptions assigned to the CO stretching modes are at higher wavenumber than that of free CO. O d. None of the above

Which statement is incorrect about CO ligand? Select one: O a. CO ligands can adopt terminal, u2 and u, bonding modes, the amount of back donation depends on bonding mode. O b. A CO ligand can accept electrons into its n* MO; this weakens the C-O bond O c. In the IR spectrum of Fe(CO), absorptions assigned to the CO stretching modes are at higher wavenumber than that of free CO. O d. None of the above

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 108IP: a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the...

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
What are each ligand: Cl- , CN- , and NCl3 classified as? a. pi donor b. pi acceptor c. sigma only
The SCN – ligand is an ambidentate ligand. When it is S-bound, it has the name thiocyanate, and the M–S–C bond angle is bent. When it is N-bound, it has the name isothiocyanate, and the M–N–C bond angle is ~180 ̊. (a) Draw Lewis dot structures for M–NCS and M–SCN that explain the observed geometries. (b) Predict the structures of the metal-ligand bonding when SCN– reacts with Fe 2+ to form the bright red Fe(SCN)2+ ion. (c) Predict the method of bonding when Cr3+ reacts with the SCN – ligand
Inorganic Chemistry (i) Define spectrochemical series (ii) Explain the difference between weak-field and strong-field ligands
Which of the following is most likely to bond to Ni2+ as a ligand? Explain. CH3-CH2-CH3 CH3-SiH2-CH3 CH3-O-CH3 |
Cyanide (I) and hydride (II) ions are ligands with high trans-directing powers. Which theoretical model can better explain the trans effect of these ligands? A. I- π bond, II- Ϭ bondB. I- Ϭ bond, II- π bondC. I- polarization, II- Ϭ bondD. I- π bond, II- polarization
How does Ligand Field Theory explain the interaction between the ligand with the central metal leading to increase or decrease of Δo ? Use the concepts of π-donor and π-acceptor ligands.
Why is [Co(NH3)5NCS]Cl2 N-bonded but K3[Co(CN)5SCN] is S-bonded. Consider the amount of space occupied by both S- and N-bonded forms of the thiocyanate ligand as part of your answer.
Given the colors observed for VO43- (orthovanadate ion), CrO42- (chromate ion), and MnO4- (permanganate ion), what can you say about how the energy separation between the ligand orbitals and the empty d orbitals changes as a function of the oxidation state of the transition metal at the center of the tetrahedral anion?
These ligands are pi acceptor or pi donor?
(c) In the given complex of [Fe(CO)] having CO ligand, carbon and oxygen both having lone pair of electrons, but carbon lone pair take part in bonding with the central Fe atom rather than oxygen. Explain why in details? (ii) The bond distance and angle in SO2Cl2 and S2Cl2 and how many lone pairs are in ICL4-??