Write an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.

Write an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter7: Alkynes

Section: Chapter Questions

Problem 7.10P: Complete each acid-base reaction and predict whether the position of equilibrium lies toward the...

See similar textbooks

Similar questions

Write out a chemical equation (draw bond-line structure) for the reaction between p-bromoaniline with hydrochloric acid. Show the mechanism using curved arrows AND identify the acid and base in the reactants.
Put the following compounds in order from weakest acid to strongest acid. Explain (pKa values are not enough and trends should be considered).
Compare and explain the acidity of phenol, ethanol, acetic acid. (Using pKa, structures of conjugate base)
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Rank the following compounds in order of increasing acidity (1 = least acidic, 3 = most acidic) and in the space provided use resonance (of the conjugate base) to explain why the compound you have labelled “3” is the most acidic.
Using pKa Values to Determine Relative Acidity and Basicity Rank the following compounds in order of increasing acidity, and then rank their conjugate bases in order of increasing basicity.
Why does a substance become more soluble in a solvent with increasing temperature? Solvents are ordered by decreasing value of theirdielectric constant. In the table, which is the most polar solvent and which is the least polar? How can acetylsalicylic acid be obtained from salicylic acid?
If compound A has a ka of 3.0 x 10-11 , compound B has a ka of 1.1 x 10-10 and compound C has a ka of 1.8 x 10-5, which compound is the weakest acid?
Draw the three possible resonance structures for an acid bromide, RCOBr. Then decide if RCOBr is more or less stabilized by resonance than a carboxylic acid (RCOOH).
Which is a stronger acid and has the most stable conjugate base? Estimate the pKA values for both compounds.
The Ka of acetic acid (CH3CO2H) is 1.8x10-5 and the Kb of methylamine (CH3NH2) is 4.4x10-4. Complete the following equilibrium reaction (acid-base reaction) equation and predict the side of the equilibrium that is favored. Explain. Show all your work.
Is p-methylphenol more acidic than phenol? Why or why not?