roblem SetWrite the electron configuration for the following:A) Fe*3B) Cu*1C) CoCircle the ions with the 4s orbitals empty?Sc3+Ti4+Vs+Cr6+Mn7+In the coordination compound [Pt(NH3)2CI2], the oxidation number of Pt isbordination number isand its

Answered: Image /qna-images/answer/0fd628ca-fdd1-4d1d-8d17-5c861a530d71.jpg

Science

Chemistry

Write the electron configuration for the following: A) Fe*3 B) Cu*1 C) Co

Write the electron configuration for the following: A) Fe3 B) Cu1 C) Co

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter20: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 6Q: Four different octahedral chromium coordination compounds exist that all have the same oxidation...

See similar textbooks

Related questions

Q: what are the number of unpaired electrons present in Cr^2+, Fe^3+, Co^2+ ?

A: The electron configuration of Cr is 1s2 2s2 2p6 3s2 3p6 4s1 3d5. Removal of two electrons results…

Q: 2) What is one of the major hazards associated with potassium dichromate?

A: Potassium dichromate molecular formula is K2Cr2O7.

Q: Write electron configurations for each transition metal.(a) Zn (b) Cu (c) Zr (d) Fe

A: The above elements are the first row of transition metal. Its outer most orbitals are 4s and 3d. So,…

Q: Write the ground state configuration for Cu, Fe, Ti and S.

A: ANSWER IS DISCUSSED BELOW

Q: using CFT, draw the d-electron configuration of [PtCl4]2¯. Is the ion paramagnetic or diamagnetic

Q: In which compound does Cr exhibit greater metallic behavior, CrF2 or CrF6? Explain

A: The oxidation number represents the number of electrons gain or loses by an element to become…

Q: How many unpaired electrons are in molybdenum atom? 3 4 6. 2

A: Electronic configuration of Mo atom is [Kr] 4d5 5s1 So, number of unpaired electrons in a Mo atom…

Q: Assign a reason for each of the following observations:(i) The transition metals (with the exception…

Q: Which of the following ions is paramagnetic? Select one: 2+ а. Zn 2+ b. Ca 3+ O, C. Sc 2+ d. Zr

A: If electron is paired then diamagnetic. If electron is not paired then paramagnetic.

Q: Write the electron configuration for the following: A) Fer B) Cu- C) Co

A: The electronic configuration is a representation written for atoms which describe the distributions…

Q: Which of the following is the electron configuration of the iron(III) ion (Fe3+)? Select one: a.…

A: The atomic number of 'Fe' is 26 and the electronic configuration as follows --- 26Fe: 1s2 2s2 2p6…

Q: Consider the following compound that obeys the 18-electron rule. Predict the first-row transition…

A: Here we are required to find the metal present in the complex

Q: <p>Which element has the higher ionization energy, Cu or Au?

A: The elements in a modern periodic table are arranged in an increasing order of their atomic number.…

Q: Which element has the higher first ionization energy, Cu or Au?

A: The first ionization energy is the energy required to remove an electron from a neutral atom to form…

Q: Gold is the most electronegative transition metal. Explain?

A: Electronegative character is the tendency of an atom to pull the bonding pair of electrons.

Q: Write the electron configuration of the following: 1. Sc 2. Ti 3. V 4. Cr 5. Mn…

A: Hello. Since your question has multiple sub-parts, we will solve first three sub-parts for you. If…

Q: Which of these oxides is not amphoteric Mgo a O A1203 .b O Zno.cO Sno.d

A: Amphoteric oxides are those metal oxides which show basic as well as acidic behaviour. So, first we…

Q: Which of the following is considered diamagnetic? a) K b) Sc c) Cr d) Zn e) Ge

A: On the basis of magnetic properties, solids can be further classified as diamagnetic, paramagnetic,…

Q: On the basis of the 18-electron rule, identify the first-row transition metal for each of the…

A: We have to identify the first row transition element for the given metal complex on the basis of…

Q: 16 1 1111 Example 4. Why do the transition elements exhibit higher enthalpies of atomisation? ( ADA…

A: The transition elements exhibit higher enthalpy of atomisation because

Q: Draw two linkage isomers of (PtCl,(SCN)|.

A: Linkage isomers are those isomers which have same formula but different connectivity from metal to…

Q: Draw the structures and label the type for all the isomers of each ion. a. (Cr(CO),(NH,),+ b.…

A: Isomers are having the same number of atoms of each element but different arrangements of atoms in…

Q: Why the reactivities of either Co(III) or Cr(III) are very low?

A: When the ligand field stabilization energy of the metal ion is low then the metal ion is less…

Q: Cr(CO)6 is stable while Cr(NH3)6 is not.

A: In [Cr (NH3)6]+3, unpaired electrons are present so paramagnetic. In [Co (NH3)6] +3, all electrons…

Q: Which of the following species is diamagnetic (not paramagnetic): K, Cr, Co, Ca, Fe3+…

Q: Which of the following species has a transition metal ion with dº electronic configuration? O…

Q: Question 1 Calculate the overall charge of the Cobalt(II) complex [COBr2(C2O4)2), and then write the…

Q: II) can occur in the complex ion [PtCl4]2¯. a. Using CFT, draw the d-electron configuration for…

Q: In which one of the following species does the transition metal ion have d electronic configuration?…

Q: Why do transition metals often react chemically as if they have a valence of 2?

A: the explanation is as follows:

Q: Which of the following transition metals would be expected to have the smallest atomic radius? A)…

A: We know that, As we move from left to right in 4d series, then size decreases to 4d5 tgen after…

Q: <p>When a transition metal atom forms an ion, which electrons are lost first?

A: Transition metal atom forms ions lost by its valence electrons.

Q: För each of the following ions, draw diagrams (on a piece of paper), like the one to the right…

Q: Write electron configurations for each of the following . a. Ti, Ti2+ Ti4+ b. Re,Re2+, Re3+ c. Ir,…

A: a. The atomic number for Ti is 22

Q: Three bottles of aqueous solutions are discovered in an abandoned lab. The solutions are green,…

A: Given are the complex ions and for complex ion colour is due d-d transition which depends on the…

Q: Write the electron configurations for each of the following elements and its ions:(a) Ti(b) Ti2+(c)…

A: (a) The atomic number of Ti is 22, so the number of electrons in Ti is 22. Hence, the electronic…

Q: Use condensed electron configurations to write an equation for the formation of each transition…

Q: Which of the following is the electron configuration of the iron(II) ion (Fe3+)? Select one: a.…

A: By calculating total electrons in Fe+3 we can determine electronic configuration.

Q: Explain the following observations: (i) Transition elements generally form coloured compounds. (ii)…

A: Elements which have partially or incompletely filled d-orbitals in their ground or stable oxidation…

Q: Which one of the following elements has higher fourth ionization energy? Sc (Z = 21) or Ti (Z =…

Q: On the basis of the 18-electron rule, identify the first-row transition metal for each of the…

Q: Predict the number of unpaired electrons in the [CrCl 6] 4– ion. 0 3 5 None of…

A: The compound given is [CrCl6]4-.

Q: Solid Mg2B205 contains the "pyroborate" anion. Draw the structure for this ion. What are other…

A: Please find the attachment.

Q: Make the structure based on the Blomstrand-Jorgensen theory and calculate the effective atomic…

A: Blomstrand proposed that ammonia molecule could link together as CH2 chains in hydrocarbons, and…

Q: Which transition metal atom is present in biologically important molecule, Siderophores.

A: Siderophores = These are the organic molecules which are produced by micro-organisms bacteria and…

Q: specific metal has an atomic weight of 180 g/mol and g/cm3. It has a BCC structure. Find the atomic…

Q: Write down the set of quantum numbers that describe the 4th and 11th electrons of Mg atom. 2. A. В.…

Q: Which of the following transition metals has a vacant f orbital? Cd V W Zr

A: Which of the following transition metals has a vacant f orbital?

Question

roblem Set
Write the electron configuration for the following:
A) Fe*3
B) Cu*1
C) Co
Circle the ions with the 4s orbitals empty?
Sc3+
Ti4+
Vs+
Cr6+
Mn7+
In the coordination compound [Pt(NH3)2CI2], the oxidation number of Pt is
bordination number is
and its

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?