C341 SP2024 Week 2 Chapter 2 KEY

1. Write the skeletal structures of propanal, acetone and cyclohexanone. What is the major intermolecular force (IMF) found in them? Based on their major intermolecular force and molecular weight, what can you predict on their solubility in water?  Chemical Name Skeletal Structures Major IMF Solubility in water  Propanal         Acetone          Cyclohexanone            2. What is the purpose of Tollens’ test (Part B)? What is the evidence of a positive result? 3. What is the purpose of oxidation test (Part C)? What is the evidence of a positive result?

Which of the following aldehydes has the highest solubility in water? A) CH₃CH₂C(=O)H B) CH₃CH₂CH₂CH₂C(=O)H C) CH₃(CH₂)₅C(=O)H D) CH₃(CH₂)₁₀C(=O)H E) All of these have equal solubility.

You have a mixture of an aryl halide and a carboxylic acid that you wish to separate (both are solids). Both are soluble in diethyl ether. Explain ALL the steps you would take to obtain the two compounds in pure form from your sample.

You have a mixture of an aryl halide and a carboxylic acid that you wish to separate(both are solids). Both are soluble in diethyl ether. Explain ALL the steps you would take to obtain the two compounds in pure form from your sample.

Using the relationship between the structure and the boiling point. Obtain a table for the listed chemicals below showing how the boiling point will be different with (1) the different chemical structures, (2) with different functional groups. Boiling Point and Functionalized Compounds: Chemical: Cyclohexanol Cyclohexanone Cyclohexene Benzaldehyde Benzyl alcohol

Write the products of the reaction of diphenhydramine (a base) with the acid HCI shown below. H COCH₂CH₂NCH3 + HC1 CH3 Consider the chemical reaction from the previous question. Are the reactants or products more soluble in water? Briefly explain.

9. An organic compound, P, has the molecular formula, C3H6O. It reacts with chromic acid to form Q. Q reacts with ethanol in the presence of concentrated sulphuric acid to give a sweet-smelling liquid, R. a) Identify P, Q and R. b) Arrange in decreasing order the boiling point of compound P, Q and ethanol. Explain. c) Compare acidity of Q and propanol

Choose the best explanation for why these compounds are all less than fifteen carbons. A) Aldehydes with longer alkyl chains become increasingly nonpolar and the LDF are stronger than hydrogen bonding with ethanol. B) Ethanol molecules will hydrogen bond with the oxygen of the aldehydes. However, longer alkyl chains interrupt the ability of the aldehyde to hydrogen bond with ethanol which decreases the solubility. C) Ethanol molecules will form strong LDF interactions between the alkyl chains of the aldehydes and the alkyl groups of ethanol. The strong attractions cause the aldehydes to precipitate out of solution. D) When aldehydes chain length increases, the aldehydes have stronger intermolecular force with the small ethanol solvent molecules than the ethanol-ethanol intermolecular force.

KINDLY HELP ME WITH THIS PROBLEM MULTIPLE CHOICE THANK YOU !

Write the skeletal structures of propanal, acetone and cyclohexanone. What is the major intermolecular force (IMF) found in them? Based on their major intermolecular force and molecular weight, what can you predict on their solubility in water? Chemical Name Skeletal Structures Major IMF Solubility in water Propanal Acetone Cyclohexanone

Give correct detailed Solution with explanation needed..don't give Handwritten answer

Give detailed Solution with explanation needed

Following are IUPAC names and structural formulas for  compound  Divide each name into a prefix, an infix, and a suffix and specify the information about the structural formula that is contained in each part of the name.

3. The melting point of salicylic acid is higher than that of acetylsalicylic acid. Explain why this is with reference to their functional groups?

Explain why benzocaine precipitates during the neutralization.

Compound A and compound B (see figure below) are used in different industries. They both have six carbon atoms. Which would be soluble in water and which would be soluble in hexane?

1. The reactant (2-methyl-2-butanol) has a limited solubility in water at room temperature. 10.0 mL of 2-methyl-2-butanol will dissolve in ~ 80 mL of water. In this experiment, 10.0 mL of 2-methyl-2-butanol readily dissolved in 20 mL of 12 mol/L aqueous HCl. a. Why does this compound exhibit some solubility in water? Consider intermolecular forces and include a diagram to illustrate the relevant intermolecular forces. Why is it not completely miscible in water (in all proportions)?

what solvent acetic acid will be soluble in? Water or ether? What structural and/or molecular properties of acetic acid contributes to its solubility?

Cocaine is a widely abused, addicting drug. Cocaine is usually obtained as its hydrochloride salt (cocaine hydrochloride) but can be converted to crack (the neutral molecule) by treatment with base. Which of the two compounds here has a higher boiling point? Which is more soluble in water? How does the relative solubility explain why crack is usually smoked but cocaine hydrochloride is injected directly into the bloodstream?

Explain a procedure to separate a mixture of the following 3 compounds to 3 separate individual components. May use any organic solvents and reagents. (Part A is first mixture, Part B is second mixture)   First answer (a) then (b)

Please help me solve this problem.

explain why on addition of 1 mol of NaCl to 1 litre of water, the boiling point of water increases, while addition of 1 mol of methyl alcohol to one litre of water decreases its boiling point.

why ethyl acetate is immiscible with water?

3. Consider the following lists of solutes and solvents. Using the general guideline of "like dissolves like" and the concept of polarity, determine which solute will dissolve best in which solvent. Solvents H₂O bromomethane octane Solutes propane ethanoic acid heptan-1-ol

1. Esters can be formed by the condensation of a carboxylic acid with the hydroxyl group of an alcohol or phenol. a) Use structures to show the condensation of acetic acid (IUPAC: ethanoic acid) with the hydroxyl of cyclohexanol. b) Explain why 'condensation' is an appropriate name for this reaction. c) You'll synthesize the ester in aspirin by condensing the phenol group of salicylic acid not with acetic acid, but with acetic anhydride. Explain why the experiment calls for the use of an anhydride, rather than an acid.

how many pi bond and sigma bonds occur in lactic acid?

URIC ACID vs. CYSTINE II. Complete the table. Choose the answer from the box below.   URIC ACID CYSTINE Color     Solubility in Ammonia     Solubility in HCl     Birefringence (ability to refract light in 2 directions)     Cyanide-nitroprusside reaction       Positive Insoluble Birefringent Soluble Not Birefringent Yellow-brown Soluble Negative Soluble Colorless

What kind of solvent ingredients is usually used in the concentrations of 4-10 percent in skin care products and their function is to soften skin cells and to lessen wrinkles? A.  Ethly acetate B. Alpha hydroxyl acids C. Phenols and phenol derivatives D. Aliphatic alcohols

Select the stronger acid from   pair and explain your reasoning. For   stronger acid, write a structural formula for its conjugate base. Q.) CH3CH2OH or CH3C=(three sticks in equals)CH

I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.