7. Consider the following mechanism and reaction coordinate diagram. Step 1: A(g) + B(g) → AB(g) 60 Step 2: AB(g) + A(g) → ABA(g) 50- 40 Step 3: ABA(g) → A2(g) + B(g) 30 Write the overall reaction. (2 pts) 20 а. 10 Reachon Coordinare b. Calculate each valu (5 pts) Activation energy (step 1): Activation energy (step 2): Activation energy (step 3): Activation energy (overall): Enthalpy change (AH): C. Identify any intermediates. (2 pts) d. Identify any catalysts. (2 pts) e. Use the mechanism to identify the rate law for the overall reaction. You may assume that the faster reactions are at equilibrium. (9 pts) PotentiaL Eneray OTma)

Q: We want to prepare a buffered solution having a pH of 4.97 using concentrated (23.6 M) formic acid (...

A:

Q: Concentrated aqueous ammonia contains 1.06 mol dissolved in 2.44 mol H2O. What is the mole fraction ...

A: Given, Moles of ammonia (nNH3) = 1.06 mol Moles of water (nH2O) = 2.44 mol Mole fraction Ammonia (XN...

Q: A dilute solution of hydrochloric acid with a mass of 606.46 g and containing 0.37376 mol of HCl was...

A:

Q: 6. 2 kg of H2NCOONH4(s) is sealed in a 50-L vessel. H2NCOONH4(s) = 2NH3(g) + C02(g) Kc = 0.215 a. Ca...

A: Given:  Mass of H2NCOONH4 = 2 kg = 2000 gm  Kc = 0.215  Volume = 50 L 

Q: Fisher Ball-and-stick Haworth Chair/ Envelope Conformation [2] Complete name Projection structure re...

A: Ans. [1]α-D-mannopyranose: Ball-and-stick structure [2] Chair/envelope conformation: [3] D-psicose...

Q: = N2 H2(g) N2(g) NH3(g) + Initial Change Final

A: The chemical equation represents the nature of the participating components. The reactants occupy th...

Q: What is the coefficient of H20 when the following equation is properly balanced with the smallest se...

A: Balance chemical reaction means the number of atoms in reactants and product must be equal.

Q: ΔHvap X 67,700 ΔHf Y(g) 15,700 ΔHsub X 35,100 ΔHvap Z 71,700 ΔHf X(g) 14,100 ΔHsub Z 40,0...

A:

Q: HO

A:

Q: Shown is an IR spectrum of Xylene, determine what couild be wrong with the spectra?

A: The solution of the question is given below: 

Q: The rate of a chemical reaction a. is always increased with increasing temperatures. b. is directly ...

A:

Q: + 42 He

A:

Q: the amount o

A: Since you have asked multiparts, we will solve the first three subparts for you. If you want any spe...

Q: Calculate the mass of chlorine in grams that can be produced by the electrolysis of 50.0 kg of sodiu...

A: The electrolysis of sodium chloride takes place as follows: 2NaCl(aq) + 2H2O(l) → 2NaOH(aq)+ Cl2(g)+...

Q: State whether true or false and briefly explain a. Student A would like to compute for the total he...

A: The given statement is false.  It needs  Hfusion  plus some extra heat. 

Q: Which of the following statements is false? A) Racemic mixtures are optically inactive. B) Enantiome...

A:

Q: The structure is an ethanolamine plasmalogen. Test for unsaturation were done. What are the results ...

A: When a molecule has carbon and hydrogen without any other specific atoms is termed as a hydrocarbon....

Q: Experiment name: Heat of Combustion of benzoic acid and Naphthalene in Bomb Calorimetry Q1:Introduct...

A: Please find the below attachments.

Q: do the potassium ions touch the aluminum ions in the potassium alum unit cell? show calculations (po...

A:

Q: Consider the following reaction where Ke 0.159 at 723 K. N2(0) + 3H2(g) 2NH(9) A reaction mixture wa...

A: Equilibrium constant ( Kc ) can only be measured when the system attained equilibrium, whereas React...

Q: yield of water formed from the reaction of 1.72 g of hexane and 11.4 g of oxygen gas? ur answer has ...

A: Mass of hexane = 1.72 g Mass of oxygen= 11.4 g

Q: of AS° for H aO in

A: Since you have asked multiple questions, we will solve the first question for you. If you want any s...

Q: You have 500mM stock of Tris base. What volume of this stock solution should be added to water to pr...

A: Solution is given below in next step       

Q: 1. Why is it important to maintain equivalent proportions of reagents in this reaction?

A:

Q: _____ 2.  Which of the following represents an electrolyte solution?    0 M acetone, C3H6O 0 M nit...

A: Electrolytes are those which break in to ions when dissolved in water.

Q: Oe. laci QUESTION 4 In the synthesis of cholesterol, which of the following is NOT a precursor? a. c...

A: Precursor can be defined as the  compound that participates in reaction that produces another compou...

Q: Diaminopimelic acid (DAP) is an amino acid found in some cell walls of bacteria. A bond-line structu...

A: Stereoisomers for DAP:- 

Q: A scientist wants to prepare 500 ml of 500 mM formate buffer pH 3.00. The pKa for formic acid, нсоон...

A:

Q: Explain the reason cooks are advised to put salt in water that is to be boiled. Explain the reason s...

A: The detailed solution of the given question is done below.  Part 1) COOKS ARE ADVISED TO PUT SALT IN...

Q: b) If that heat came from cooling a 1.361 kg lump of iron, what was the initial temperature of the i...

A:

Q: What is the relationship between the following two compounds?

A: Given compounds are representing stereochemistry of each center. and on the basis of stereochemistry...

Q: HO 1. TsCl, py В 2. LIET3BH, THF "CH3

A:

Q: 5. From the 'H nmr spectrum of dibenzalacetone (Fig. 1) can you deduce what geometric isomer(s) is (...

A:

Q: acids

A:

Q: A solution of Tryptophan has an absorbance at 280 nm of 0.54 in a 0.5 cm length cuvette. Given the a...

A:

Q: 3. A šólútióň iš made by dissolving5.02 g ofT KNO3 in 95.0 g of water. Calculate the following a. Mo...

A: Given Data's are : Mass of KNO3 (Solute) = 5.02 g Mass of H2O (Solvent) = 95.0 g calculation of  a. ...

Q: Calculate the Amax (in EtOH) of the following compound: HO,

A:

Q: Draw the stereoisomers for the compound CICH2CH2CHBrCH2C(OH)=CHC(CH3)3. Label the chiral centre with...

A: Given:-     We know that total stereoisomers is given as  = 2n  where n = number of stereocenter.  ...

Q: Using specific heat capacity to find temperatuie A chemical reaction takes place inside a flask subm...

A: Given,  Mass, m = 6.90 kg = 6900 g  Initial temperature, Ti = 33.1 °C Heat capacity, Cp of water = 4...

Q: Correct the following names. MnO manganese(I) oxide Ca(ClO3)2 calcium dichlorate NH4Cl nitrogen trih...

A:

Q: for the fischer projection, how do we number the configurations? for this one, I didn't know if it w...

A:

Q: Cera Jorge, Teddy, Sundus esp 3.90 209 1.00 Chemical Sht ppm) Ge Jorge Teddy Sunds p SPECTRUM TH

A: Peak at 2ppm: shows Hc (attached to electronegative group). Peak at ~5.4ppm: shows Hb acheched to es...

Q: Hello, sorry I think I was a bit bland with the question. In the periodic descriptions attached belo...

A: A question based on periodic properties that is to be accomplished.

Q: ОН 1. TBSCI а. imidazole, CH2Cl2 A DMF, -18 °C to rt 2. NalO4, CH2Cl2 80% НО OH large excess

A: We have to give the product of the given reaction. We know that the TBSCl is used to protect the pri...

Q: What will the concentration of PCI5 be when equilibrium is reestablished after addition of 1.31 g Cl...

A:

Q: In order to form Ba(103)2, 500 mL of 0.5000 M Ba(NO3)2 was mixed with 500 mL of 0.0500 M NalO3. Ksp=...

A:     500 mL of 0.5000 M Ba(NO3)2 are mixed with 500 mL of 0.0500 M NaIO3 . We have to find out millim...

Q: Draw the Lewis structures of the following compounds: A. CC22F2 В. О2 C. PF3 D. SO3-2 Ε. ΗNO3

A: Lewis structure of a molecule can be defined as the representation of valence shell electrons of ato...

Q: addition of HBr

A:

Q: A Calculate the freezing point of A, in °C, from this data: AH: (KJ/mole) S (J/mole K) A(s) A) Ag) -...

A: Concept: Enthalpy of the reaction (∆Hrxn) : enthalpy of any reaction is difference between the entha...

Q: Selected bond dissociation enthalpies are given in this table. is made by addition polymerization of...

A: We can calculate bond order by using DOU(degree of unsaturation) DOU= C +1 -H+X-N2  For C2H4Cl2.  2+...