At 25°C, the equilibrium constant, Ke for the following reaction is 1.35. 2NOB (g) = 2NO (g) + Brz (g) Determine the reaction quotient of the system if 0.44 mole of NOBR, 0.22 mole NO and 1.20 mole Brz were put into an evacuated 1.00 liter container. А. 3.33 В. 3.22 С. 1.67 D. 0.30

At 25°C, the equilibrium constant, Ke for the following reaction is 1.35. 2NOB (g) = 2NO (g) + Brz (g) Determine the reaction quotient of the system if 0.44 mole of NOBR, 0.22 mole NO and 1.20 mole Brz were put into an evacuated 1.00 liter container. А. 3.33 В. 3.22 С. 1.67 D. 0.30

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 50P

See similar textbooks

Related questions

Q: Ammonia and oxygen react to form nitrogen and water, like this: 4NH; (g)+30,(g) 2N,(g)+6H20(g)…

A: Le Chateliers Principle If a system at equilibrium is subjected to change in one or more variables…

Q: Consider the following reaction where K. = 6.30 at 723 K. 2NH3(g)N2(g) + 3H2(g) A reaction mixture…

A: Given: The reaction is as follows, 2NH3(g) ⇋ N2(g) + 3H2(g) Kc = 6.30Moles of NH3 = 6.21×10-4…

Q: Consider the following reaction at 25°C with the ΔG°' = +1800 J/mol for the forward reaction. The…

Q: Given the following reaction CO(g) + 2H₂(g) ⇌ CH₃OH(g) You have a reaction flask that contains a…

A: The given reaction is as follows,

Q: Given the following reaction CO(g) + 2H₂(g) ⇌ CH₃OH(g) You have a reaction flask that contains a…

A: Reaction quotient, Q is the ratio of concentrations of Products decided by concentrations of…

Q: Pure phosgene gas (COCl2), 3.00 x 10^-2 mol, was placed in a 1.50 L container. It was heated to 800…

A: Initial pressure of COCl2 can be calculated using ideal gas equation:

Q: Consider this reaction in a closed container. 2NO(g) + 0,(g) – 2NO,(g) An equilibrium mixture is…

A: The direction of a reaction after disturbing the equilibrium of the reaction is predicted by using…

Q: Ammonia was produced by reacting nitrogen and hydrogen gases at 350°C according to the reaction…

Q: In an experiment, 0.40 M NOBr, 0.83 M NO and 0.995 M Br2 are placed in a 3.00 L reaction vessel at a…

Q: Consider the reversible reaction at 2000°C, 2NO(g) 0₂(g) + N₂(g) Kc = 100.0 If the system initially…

Q: Hydrogen sulfide and oxygen react to form sulfur dioxide and water, like this: 2H,s(2)+30,(2) –…

A: Given reaction is 2H2S(g) + 3O2(g) --> 2SO2(g) + 2H2O(g)

Q: Unless otherwise stated, you may assume T = 25. °C in all of the following problems. For problems…

A: According to Le-chatelier's principle when any changes are made on an equilibrium then it shifts in…

Q: An equilibrium is established for the reaction 2 CO(g) + MoO₂(s) ⇌ 2 CO₂(g) + Mo(s). A system which…

Q: The initial concentrations or pressures of reactants and products are given for each of the…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: Hydrogen sulfide and oxygen react to form sulfur dioxide and water, like this: 2H,S(2)+30,(3) →…

Q: Consider the equilibrium system described by the chemical reaction below. Calculate the value of Qc…

A: Given -> Weight of C = 11.1 gm Weight of H2O = 2.45 gm Weight of CO = 15.3 gm Weight of H2 = 7.55…

Q: Nitric acid and nitrogen monoxide react to form nitrogen dioxide and water, like this: 2…

A: Given: mass of HNO3 = 14.7 g mass of NO = 21.2 g mass of NO2 = 21.4 g mass of H2O =129.9 g Volume of…

Q: Nitrogen monoxide and water react to form ammonia and oxygen, like this: 4 NO(g)+6H2O(g) → 4…

A: Answer: This question is based on Le-chatelier's principle according to which, on changing any…

Q: What is the numerical value of the equilibrium constant at 25°C for the reaction below? 2 SO₂ (g) +…

Q: 2) Consider the reaction: Br2(g) + Cl2(g) 2BRCI(g) KR = 1.11 x 10-4 at 150 K A reaction mixture…

A: KP is called the equilibrium constant at constant pressure The formula to express the KP is…

Q: The equilibrium constant Kp is 6.0 x 1015 at 298 K for the reaction: 2H2S (g) + SO2 (g) 5 3S (s) +…

Q: Sulfur dioxide and oxygen react to form sulfur trioxide, like this: 250,(g)+0, (g) → 250;(2) Suppose…

A: A reversible chemical reaction can move in either forward or backward direction. The stage of a…

Q: Given the following reaction CO(g) + 2H2(g) = CH3OH(g) You have a reaction flask that contains a…

A: The reaction quotient (Q) is defined as the ratio of concentrations of products to the…

Q: Consider the reaction: Br2(g) + Cl2(g) 2 BrCI(g) K, = 1.11 x 10at 150 K A reaction mixture initially…

A: Given: Initial partial pressure of Br2 (PBr2) = 755 torr Initial partial pressure of Cl2 (PCl2) =…

Q: The equilibrium constant, Kp, is 79.9 at 2500 K for the following reaction: XY2(g) + XZ2(g) = 2…

A: ICE table of Reaction XY2 (g) + XZ2 (g) →2 XYZ (g) Initial 0…

Q: Hydrogen sulfide and oxygen react to form sulfur dioxide and water, like this: 2H,S (g)+ 30,(g) →…

A: Since all the reactants and products are in gaseous state, all of them contribute to the equilibrium…

Q: The decomposition of phosphene (COCI,) gas into carbon monoxide (CO) and chlorine (Cl2) gases is…

A: Equilibrium constant ( Kp ) is the ratio of partial pressures of products to partial pressures of…

Q: A chemicai engineer is studying the following reaction: 2 H,S(g)+302(9)→ 2 SO2(g)+2H,O(g) At the…

A: ·Reaction equation : 2H2Sg + 3O2g → 2SO2g + 2H2Og·The equilibrium constant 'Kp' for…

Q: The initial concentrations or pressures of reactants and products are given for each of the…

A: Reaction quotient (Qc) is defined as the ratio of concentration of products and the concentration of…

Q: Consider the reaction: H2(g) + Br2(g) --> 2HBr(g) ΔH˚ = -103.8 kJ/mol In a particular experiment,…

Q: 1.) Kc for the reaction of tin (ii) ions with iron (iii) ions Sn2+ (aq) +2FE3+ (aq) Snt+ (aq) +2FE2*…

A: Given: The reaction is as follows, Sn2+(aq) + 2Fe3+(aq) ⇋ Sn4+(aq) + 2Fe2+(aq) Kc = 1.0×1010…

Q: For the reaction system: N2(g) + 3H2(g) - 2NH3(g) K= 1.2 at a certain temperature. If the initial…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: b) In another experiment, the following equilibrium was established: 2 NO(g) + Cl₂(g) = 2 NOCI(g)…

A: Given an equilibrium reaction and initial moles of reactants is follows;2NO(g)+Cl2(g)⇌2NOCl(g)at…

Q: Consider this equilibrium reaction at 400 K. Br2(g)+Cl2(g)↽−−⇀2BrCl(g)?c=7.0 If the composition…

A: Equilibrium constant is a constant which represent the ratio of concentration of product to the…

Q: At 25°C, for the reaction Br. (g) + 2Br (g) We have AG = 161.67 kJ/mol, and AH = 192.81 kJ/mol a.…

A: Given: The reaction: Br2 (g) ↔ 2Br (g) ∆G∘ = 161.67 kJ/mol∆H∘ = 192.82 kJ/mol

Q: NH, 5)= /2 NzCot 312 Hq(g). +3 Hzg)= 2 N,G)

A: Before reversing the reaction the reaction has to be multiplied by 2 to get the desired equation. On…

Q: For the reaction: Fe2O3(s) + 3CO(g )  2Fe(s) + 3CO2(g ); the following values of K are known: T =…

A: Solution: Fe2O3(s) + 3CO(g ) -> 2Fe(s) + 3CO2(g Kp = P3CO2/P3CO -i) Now, relation between…

Q: Nitric acid and nitrogen monoxide react to form nitrogen dioxide and water, like this: 2…

Q: Consider the reaction: Xe(g) + 2 F2(g) ⇌ XeF4(g). A reaction mixture initially contains 1.702×103…

A: Given data,Initial pressure of Xe=1702torrInitial pressure of F2=3245torrEquilibrium pressure of…

Q: The combination reaction of sulfur dioxide and chlorine gas is given as : SO2(g)+ Cl2(g).…

A: Reaction quotient is given by the ratio of products and reactants.

Q: An equilibrium is established for the reaction 2 CO(g) + MoO₂(s) ⇌ 2 CO₂(g) + Mo(s). A system which…

A: The given data contains, partial pressure of CO = 1.67 atm. partial pressure of CO2 = 0.342 atm.

Q: 3- Pure sodium metal spontaneously combusts upon contact with room temperature water. What is true…

Q: The reaction SO2 (g) + NO2 (g) = NO (g) +SO3 (g) has an equilibrium constant (KJ of 0.690 at 450°C.…

Q: and hydrogen react to form ammonia, like this: N₂(g) + 3H₂(g) 2NH3(g) Suppose a mixture of N₂, H₂…

Q: 4. Calculate the reaction quotient of this reaction: 2S03(g) O2(g) 2SO2(g) Given: Kc = 0.230 (SO3] =…

A: Given Reaction:- 2SO3(g) <-----> 2SO2(g) + O2(g)

Q: Consider the reaction 2NO(g)+Br2(g)⇌2NOBr(g),Kp=28.4, at 298 KK In a reaction mixture at…

A: The equilibrium constant of a chemical reaction is the value of its reaction quotient at chemical…

Q: Ammonia and oxygen react to form nitrogen and water, like this: 4NH, (g)+30, (g) → 2N, (g)+6H,0(g)…

A: The equilibrium reaction given is, 4NH3(g) + 3O2(g) ----> 2N2(g) + 6H2O(g)

Q: Consider the equilibrium system described by the chemical reaction below. The decomposition of NOBr…

A: Given: Initial concentration of NOBr = 0.20 M Equilibrium constant Kc = 3.07 × 10⁻⁴ Temperature =…

Q: Kp is equal to 25.00 at some temperature for the reaction: H2(g) + I2(g) ⇌ 2 HI(g). Clair and Pat…

Q: For which one of the following reactions would a change in volume have no effect upon the position…

A: Equilibrium reaction are those reaction in which the rate of forward and backward reaction are equal…

Question

At 25°C, the equilibrium constant, Ke for the following reaction is 1.35.
2NOB (g) = 2NO (g) + Br2 (g)
Determine the reaction quotient of the system if 0.44 mole of NOBR, 0.22 mole NO and 1.20
mole Brz were put into an evacuated 1.00 liter container.
А. 3.33
В. 3.22
C. 1.67
D. 0.30

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Final answer

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the reactionN2O4(g)2NO2(g),Kp=0.25 at a certain temperature. If 0.040 atm of N2O4 is reacted initially, calculate the equilibrium partial pressures of NO2(g) and N2O4(g).
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions (a) N2(g)+3H2(g)2NH3(g) (b) 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (C) N2O2(g)2NO2(g) (d) CO2(g)+H2CO(g)+H2O(g) (e) NH4CI(s)NH3(g)+HCI(g) (f) 2Pb( NO3)2(s)2PbO(s)+4NO2(g)+O2(g) (g) 2H2(g)+O2(g)2H2O(g) (h) S8(g)8S(g)
The standard equilibrium constant is 2.1109for this reaction at 25 C Zn2+(aq)+4NH3(aq)Zn(NH3)42+(aq) (a) Calculate rG at this temperature. (b) If standard-state concentrations of the reactants andproducts are combined, in which direction will the reaction proceed? (c) Calculate rG when [Zn(NH3)42+] = 0.010 M, [Zn2+] =0.0010 M, and [NH3] = 3.5104M.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Distinguish between the terms equilibrium constant and reaction quotient. When Q = K, what does this say about a reaction? When Q K, what does this say about a reaction? When Q K. what does this say about a reaction?
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
. Gaseous phosphorus pentachloride decomposes according to the reaction PCl5(g)PCl3(g)+Cl2(g)The equilibrium system was analyzed at a particular temperature, and the concentrations of the substances present were determined to be [PCl5]=1.1102M,[PCl3]=0.325M. and [Cl2]=3.9103M. Calculate the value of K for the reaction.