At a certain temperature, the equilibrium constant, Ke, is 0.00572 for the reaction Cl, (g) = 2 Cl(g) A. If 2.77 g Cl, is placed in a 2.50 L flask at this temperature, what are the equilibrium concentrations of Cl, and Cl? [CI,] = M [CI] = M B. Following the establishment of equilibrium in part A, the volume of the flask is suddenly increased to 5.00 L while the temperature is held constant. What are the new equilibrium concentrations of Cl, and Cl? [CI,] = M [CI] = M C. Following the establishment of equilibrium in part A, the volume of the flask is instead suddenly decreased to 1.00 L while the temperature is held constant. What are the new equilibrium concentrations of CI, and Cl? [Cl,] = M [CI] = M

At a certain temperature, the equilibrium constant, Ke, is 0.00572 for the reaction Cl, (g) = 2 Cl(g) A. If 2.77 g Cl, is placed in a 2.50 L flask at this temperature, what are the equilibrium concentrations of Cl, and Cl? [CI,] = M [CI] = M B. Following the establishment of equilibrium in part A, the volume of the flask is suddenly increased to 5.00 L while the temperature is held constant. What are the new equilibrium concentrations of Cl, and Cl? [CI,] = M [CI] = M C. Following the establishment of equilibrium in part A, the volume of the flask is instead suddenly decreased to 1.00 L while the temperature is held constant. What are the new equilibrium concentrations of CI, and Cl? [Cl,] = M [CI] = M

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 14.40QE

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Consider the equilibrium N2(g)+O2(g)2NO(g) At 2300 K the equilibrium constant Kc = 1.7 103. If 0.15 mol NO(g) is placed into an empty, sealed 10.0-L flask and heated to 2300 K, calculate the equilibrium concentrations of all three substances at this temperature.
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
The equilibrium constant, Kc, for the reaction N2O4(g) 2 NO2(g) at 25 C is 5.9 103. Suppose 15.6 g of N2O4 placed in a 5.000-L flask at 25 C. Calculate the following; (a) the amount of NO2 (mol) present at equilibrium; (b) the percentage of the original N2O4 that is dissociated.