O-1628 kJ-890.5kJO-755.9kJ() -1765.9 kJ Calculate AH for the reactionNH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (g), from thefollowing data.N2 (g) + O2 (g) → 2 NO (g)ΔΗ- 180.5 kJ/ molN2 (g) + 3 H2 (g) → 2 NH3 (g)/molAH =- 91. 8 kJ2 H2 (g) + O2 (g) → 2 H20 (g)AHΔΗ-- 483. 6 kJ/ mol

Answered: Image /qna-images/answer/37ac6821-bb76-42d9-9a04-746bcba470e4.jpg

Calculate AH for the reaction NH3 (g) + 5 02 (g) → 4 NO (g) + 6 H20 (g). from the following data. N2 (g) + O2 (g) → 2 NO (g) / mol ΔΗ – 180. 5 kJ | N2 (g) + 3 H2 (g) → 2 NH3 (g) / mol ΔΗ- - 91. 8 kJ 2 H2 (g) + O2 (g) → 2 H2O (g) / mol ΔΗ- 483. 6 kJ

Calculate AH for the reaction NH3 (g) + 5 02 (g) → 4 NO (g) + 6 H20 (g). from the following data. N2 (g) + O2 (g) → 2 NO (g) / mol ΔΗ – 180. 5 kJ | N2 (g) + 3 H2 (g) → 2 NH3 (g) / mol ΔΗ- - 91. 8 kJ 2 H2 (g) + O2 (g) → 2 H2O (g) / mol ΔΗ- 483. 6 kJ

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section: Chapter Questions

Problem 97QRT

See similar textbooks

Related questions

Q: Construct a diagram depicting ΔrxnH° of the above reaction and the standard enthalpies of formation…

Q: Given the standard enthalpy changes for the following two reactions: (1) Hg(1) + Cl½(g)–→HgCl½(s)…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: → Z(g) + Y(g) + 30.0 kJ + 25 kJ → P(g)

A: Given:- X(g) + W(g) ----> Z(g) + Y(g) ∆H = - 30kJ. (1) Z(g) +Y(g) --------> P(g) ∆H = 25kJ.…

Q: The calibration of a calorimeter is done by using 13.00mL of 0.104M NaOH and 11.29mL of 0.125M HCl…

Q: The standard heat of the reaction, C2H4(g) + 2Cl2 (g) --> C2HCl3(l) + H2(g) + HCl(g) is ∆Hr° =…

A: The change in the internal energy of a system is the sum of the heat transferred and the work done.…

Q: When NaOH is neutralized by HCl as shown: NaOH (aq) + HCl (aq) H2O (l) + NaCl (aq) ΔH = - 56.13…

A: The balanced reaction taking place is given as, => NaOH (aq) + HCl (aq) ---------> NaCl (aq)…

Q: Calculate the value of AH° for the reaction N₂(g) + O₂(g) → 2NO(g). 4NH3 (g) +50₂ (g) → 4 NO (g) +…

A: For such type of questions, we have to deduce the required equation by using the given chemical…

Q: Use Hess' Law to calculate the enthalpy change (in kJ) for the reaction: NO(3) + O(g) → NO2(3) from…

A: Enthalpy change is a state function and depends on initial and final states of the system. It is…

Q: base. Standard school laboratory equipment and a supply of standardized 1.00 mol/L HCl and…

A: (a) What equipment would be needed? Titration --> burete, beaker, acid//base (b) What…

Q: When 25.0 mL of 0.25 mol/L LiOH and 25.0 mL of 0.25 mol/L HCl are mixed together, the temperature…

A: Specific heat formula The equation that is used to calculate the amount of energy, in Joules (J),…

Q: From the following enthalpy changes, calculate the value of AH° for the reaction N21e) + O21g) > 2…

A: If any coefficient is multiplied to the reaction, then that coefficient should also be multiplied…

Q: Using the following reactions: 2 H 2 (g) + O 2 (g) --> 2 H 2O (g) ∆H = –484 kJ x 2…

Q: 11-12. The same quantity of energy is added to 25.0 g pieces of gold (molar heat capacity = 25.41…

A: Given data,Mass of Au=25gMass of Mg=25gMass of…

Q: 1. The enthalpy of neutralization of a newly discovered compound, J(OH)3, was determined using a…

A: We have to predict the heat capacity of calorimeter , chemical reaction, limiting reactant and…

Q: Given the following reactions Fe2O3 (s) + 3CO (s) - 2Fe (s) + 3CO2 (g) AH = -28.0 kJ 3Fe (s) + 4CO2…

Q: Calculate AH for the following balanced reaction in kJ: 3NO2 (9) + H20 (1) → 2HNO, (aq) + NO (g)…

A: Given balanced reaction, 3 NO2(g) + H2O(l) → 2 HNO3(aq) + NO(g)

Q: Calculate the enthalpy of reaction for the following reaction: NaOH(s) + HCI(g) ----> NaCI(s) +…

A: Given Enthalpy of Formation of NaCl(s) = - 411 KJ/ mole Enthalpy of formation of H2O(g) =…

Q: A calorimetry experiment determined that the combustion of 1.01 g of H2(g) reacting with excess…

A: We can solve ∆H by the following formula ∆Hrxn = -Qrxn

Q: Given the following reactions, calculate AH for Mn + O2 MnO2 3 MnO2 + 4 AI 3 Mn + 2 Al2O3 AH = -…

A: ΔH for the given reaction can be obtained using Hess's law. Hess's law states that the overall…

Q: Consider the following reactions: (1) N2(g) + O2(g) → 2NO(g) AH = +180.7 kJ (2) 2NO(g)+ O2(g)…

A: Dear student I have given answer to your question in the image format.

Q: The enthalpy of the reaction, ΔH°rxn, in which sulfur dioxide is oxidized to sulfur trioxide 2SO2…

A: Data required enthalpy of formation of so3 = -395.77 KJ/mol enthalpy of formation of so2 = -296.84…

Q: From the following enthalpies of reaction H2(g) + F2(g) – 2HF(g) AH = -537 kJ C(s) + 2 F2(g) →…

Q: Using the following equation for the combustion of octane, calculate the heat of reaction for 400.0…

A: The number of moles of octane is: n = Given massMolar massn=400 g114.33 g/moln=3.499 mol.

Q: 7) The enthalpy of the following reaction at 1.00 atm and 298.15K is -56.9kJmol-1 H* (aq) + OH (aq)…

A: In order to find the enthalpy of the hydrolysis per mole of the ATP we first write down the given…

Q: Using the following reactions: NO (g) + 0.5 O 2 (g) --> NO 2 (g) ∆H = 50 kJ x N 2O 4…

A: Determine the enthalpy change of the given reaction.

Q: SO 3 (9) 2. Calculate the AH for the reaction Se + ž O29) (), rxn using these two reactions: AH =…

A: Hess's law Hess's law states that the overall enthalpy change of chemical process is independent of…

Q: Calculate AH for the reaction NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H,O (g), from the following data. N2…

Q: SO3 (9) Calculate the AHO for the reaction S 2(g) rxn using these two reactions: AH = -296.8 kJ Se +…

A: A reaction can be determined by the addition or subtraction of elementary reaction. Elementary…

Q: Consider the following reaction: 3C(s) + 3H2(g)→ C3H6(g); AG° = 60.0 kJ and AS° =-256.7 J/K at 298 K…

A: The balanced reaction taking place is given as, => 3 C (s) + 3 H2 (g) -----> C3H6 (g)…

Q: Consider the combustion of liquid methanol, CH3OH1l2:CH3OH1l2 + 32O21g2¡ CO21g2 + 2 H2O1l2ΔH =…

A: Since your question has multiple sub-parts, we will answer the first three sub-parts for you. If you…

Q: The enthalpy of neutralization of a newly discovered compound, J(OH)3, was determined using a…

A: #(a): The balanced equation for the reaction between HCl(aq) and NaOH(aq) is: HCl(aq) + NaOH(aq)…

Q: Find the standard molar enthalpy for the reaction C(s) + ½ O2(g) → CO(g) C(s) + O2(g) → CO2(g) ∆Ho =…

A: Given in the question : C(s) + O2(g) → CO2(g) ; ∆Ho = -394 kJ CO2(g) → CO(g) + ½ O2(g) ; ∆Ho = +283…

Q: Calculate AH for the reaction NH3 (g) + CH4 (g) → HCN (g) + 3 H2 (g), from the following data. N2…

Q: The standard enthalpy change for the following reaction is 538kJ at 298K: Ni(OH)2 (s) → Ni(s) +…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: A student mixed 50 ml of 1.0 M HCl and 50 ml of 1.0 M NaOH in a coffee cup calorimeter and…

A: The molar enthalpy for the second trial will be -54 KJ/mol

Q: For a chemical reaction, if AG°298 -169.8 kJ and AH°298 = -17.3 kJ, what is AS° (in kJ/K) for the…

Q: 9. Calculate AH for the reaction 4NH3 (g) + 502 (g) → 4NO (g) + 6H20 (g), from the following data.…

Q: Given the following reactions Fe203 (s) + 3CO (s) → 2Fe (s) + 3CO2 (g) AH=-28.0 kJ 3Fe (s) + 4CO2(s)…

A: If the reaction is multiplied by any coefficient then the enthalpy of that reaction will also be…

Q: Enter your answer in the provided box. Calculate AH,xn for 2NOCI(g) → N2g)+ O2(g) + Cl½(g) given the…

Q: Consider the molar enthalpy change for this neutralization reaction:…

Q: 1. When 25.0 mL of 0.25 mol/L LiOH and 25.0 mL of 0.25 mol/L HCl are mixed together, the temperature…

A: Given that, Volume of 0.25mol/L LiOH = 25.0ml Volume of 0.25mol/L HCl = 25.0ml A general…

Q: Calculate AH for the process: N2(g) + 202(g) → 2NO2(g) from the following information: N28) +O2(g) →…

Q: Liquid hydrogen peroxide, an oxidizing agent in many rocket fuel mixtures, releases oxygen gas on…

A: The molecular weight of hydrogen peroxide is 34 gm/mol. from the above reaction we see that 2 mol…

Q: Determine the enthalpy of the reaction: 3Fe,O3 (s) + CO (g)→ CO2 (g) + 2Fe;O4 (s), given the…

Q: Given the following reactions Reactions Enthalpies of Reaction 1 Na(s) + Cl2(8) → Na(g) + Cl(g) AH =…

Q: Given the standard enthalpy changes for the following two reactions: (1) 2Ni(s) + 02(g)→2NIO(s) AH°…

A: We have to find the standard enthalpy changes for the given reaction.

Q: Calculate AH for the reaction: NO (g) + O (g) → NO2 (g) AH = ? From given the following information:…

Q: Consider the following reaction: 3C(s) + 3H2(g) → C3H6(g); AG° = 60.0 kJ and AS° =-256.7 J/K at 298…

Q: Her) is a commonly used acid for adding bromine to organic compounds. As bromine makes for an easily…

A: The enthalpies of the reactions are given . We have to calculate enthalpy for the synthesis of HBr…

Q: Given the following combustion reaction and its molar enthalpy of reaction: 2NO(g) + O2(g) 2NO2(g)…

A: Given reaction: 2NO(g) + O2(g) → NO2(g) ΔHo = -112 KJ

Question

100%

O-1628 kJ
-890.5kJ
O
-755.9kJ
() -1765.9 kJ

Calculate AH for the reaction
NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (g), from the
following data.
N2 (g) + O2 (g) → 2 NO (g)
ΔΗ
- 180.5 kJ
/ mol
N2 (g) + 3 H2 (g) → 2 NH3 (g)
/mol
AH =
- 91. 8 kJ
2 H2 (g) + O2 (g) → 2 H20 (g)
AH
ΔΗ-
- 483. 6 kJ
/ mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Adding 5.44 g of NH4NO3(s) to 150.0 g of water in a coffee-cup calorimeter (with stirring to dissolve the salt) resulted in a decrease in temperature from 18.6 C to 16.2 C. Calculate the enthalpy change for dissolving NH4NO3(s) in water, in kJ/mol. Assume the solution (whose mass is 155.4 g) has a specific heat capacity of 4.2 J/g K. (Cold packs take advantage of the fact that dissolving ammonium nitrate in water is an endothermic process.)
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-rans
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
A 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?