pent-1-en-3-ol is classified as a primary alcohol a secondary alcohol a tertiary alcohol a phenol O an enol

Q: OH CH2 `CH3 CH3

A: The reaction taking place is given as,

Q: Draw structural formulas for the alcohol formed by hydroboration-oxidation of each alkene.

A: Hydroboration-oxidation reaction is nothing but an alkene treated with borane in tetrahydrofuran…

Q: 13. The alcohol above would be classified as a(n) O phenol O alkoxy alcohol O primary alcohol O…

A:

Q: The reaction of a ketone with an alcohol in acidic conditions will result in:     an alkane     an…

A: When ketones react with alcohols in the acidic conditions they result in the formation of acetals.

Q: All of the following alcohols can be classified as secondary alcohols EXCEPT: 2-methyl…

A:

Q: HO 7. OH The above is an example of a a. primary alcohol b. secondary alcohol c. tertiary alcohol…

A:

Q: What is the classification of the following structure? OA. Primary Alcohol OB Secondary Alcohol OC.…

A:

Q: An example of a primary alcohol is shown by the structure CH3CH2CH(OH)CH3- A. true B. false

A: A C atom which is attached to one other C atom is called a primary C. A C atom which is attached to…

Q: of the product. Name the reactant and the product. a) CHy-C-C- OH b) CHy-CH-CH-CHy c)

A: Note - Since you have asked multiple question, we will solve the first question for you. If you want…

Q: Classify each alcohol as 1 °, 2 °, or 3 °

A: If the 'C' atom attached to the -OH group is further attached to only one alkyl (R) group, then it…

Q: Draw structures corresponding to the following IUPAC names: (a) 2-Methylhexan-2-ol…

A: (a) 2-Methylhexan-2-ol    (b) Hexane-1,5-diol   (c) 2-Ethylbut-2-en-1-ol   (d) Cyclohex-3-en-1-ol…

Q: Is this a primary, secondary, or tertiary alcohol? H3C H3C H3C OH

A:

Q: CH3 - CH2 - CH2 - O - CH2 - CH3 The molecule can be classified as a. an aldehyde b. an alkane c.…

A: Given compound is: CH3 - CH2 - CH2 - O - CH2 - CH3

Q: What is the IUPAC name of the following alkyl halide? H;CI I) trans-p-bromotoluene II)…

A: IUPAC nomenclature describes the structure of the compounds in a unique way.Every compound has given…

Q: What is the common name of the following alkyl substituent? H. H3C. .CH3 A) butyl B) sec-butyl C)…

A:

Q: Identify the functional group: -C-C-C- alcohol O ketone O aldehyde O ether

A: Since you have been posted multiple question so i have solved first one for you. If you want to be…

Q: 2 Identify the alcohols in Problem 8.1 as primary, secondary, or tertiary. 3 Draw structures…

A:

Q: Draw the structure corresponding to the following IUPAC names: a) (Z)-2-ethyl-2-buten-1-ol  b)…

A:

Q: All of the following alcohols can be classified as secondary alcohols EXCEPT: O 2-methyl-3-pentanol…

A: Which one of the following not having secondary alcohol ?

Q: . What is the systematic name for a compound with the following structure? CH2-Br CH-CH-CH-CHь (A)…

A: Given:

Q: Draw structures corresponding to the following IUPAC names:      (a) 3-Methylbutanal…

A:

Q: Draw Alcohol Reactant (CH3)2CHCH2CI DMSO

A: Alcohols on reaction with a base (sodium hydride, NaH) deprotonate the alcohol compounds to the…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: What is the IUPAC name for the following compound? cyclohexyl ethyl ether ethyl cyclohexyl ether…

A:

Q: Phenol + Br2/H2O

A:

Q: What is the classification of the following structure? O A. Primary Alcohol OB. Secondary Alcohol…

A: What is the classification of given structure

Q: CI-CH2-O-CH3 O.

A: The IUPAC full form is International Union of Pure and Applied Chemistry. The IUPAC is used to name…

Q: 9) Which of the following is a tertiary alcohol? a. CH₂-CH-OH b. CH₂ CH₂-CH-OH C. d. CH₂ CH₂-C-OH…

A:

Q: ol lphenol ylphenol pyl benzene nypropane

A: As we know,   Propene with H3PO4 formed isopropyl carbocation as an electrophile. Then Friedel craft…

Q: Draw structures for the following alcohols. a. butane-1,2-diol 2,4-dimethylcyclopentanol C. b.…

A: To determine structure:  (1)identify the carbon chain e.g 2,3-diethyloctan1ol here octane is main…

Q: The correct IUPAC name is OH 2-methyl-3-butyn-1-ol 4-methyl-2-pentyn-5-ol 3-methyl-2-butyn-4-ol…

A: Applying rule of IUPAC nomenclature. Select long carbon chain and give the proper naming of suffix…

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH;-ĊH-CH,-COOH…

A: a) b)

Q: Name the following alcohol. O2-Bromo-4-ethylcyclopentanol 4-Ethyl-2-bromocyclopentanol…

A: Name of the alcohol is given below.

Q: Which alkyl halide has the highest boiling point?  A. CH3Br B. CH3F C. CH3Cl D. CH3l

A: Which alkyl halide has the highest boiling point?

Q: s this a primary, secondary, or tertiary alcohol? ОН H3C CH O Primary Secondary O Tertiary

A:

Q: What is the classification of the following structure? CH3 H3C-CH2-CH2-CH-OH OA. Primary Alcohol O…

A: The name of the given compound is as follows - 2-Pentanol

Q: What is the classification of the following structure? HO. Br OA Primary Alcohol O B. Secondary…

A: The given compound contains one benzene ring with -OH and -Br group at 1 and 4 position of ring.

Q: 62. Which is a tertiary alcohol? CH3 H3CH,C-0-H он но HO II II IV а. I b. II с. II d. IV е. V

A:

Q: Which of the following have the correct IUPAC names? cyclopentyloxycyclohexane cyclopropyl isopropyl…

A: Give

Q: Alcohols undergo dehydration reactions in the presence of an acid catalyst. Which of the following…

A:

Q: What is the major product formed when 2-butanol is dehydrated? O Trans-2-butene O 1-butene O…

A: Given, 2-butanol

Q: 15) 1-Methylcyclopentanol is classified as A) a primary alcohol B) a secondary alcohol C) a tertiary…

A:

Q: Which of the following is a secondary alcohol? CH но. CHa он CH3 H3C OH H3C. CH3 H3C

A:

Q: alcohol

A:

Q: Use the following reagent table for the reaction of: cyclohexanol + H2 SO4 → cyclohexene

A: For the given reaction, we have to find mmol of reactants used and determine percentage yield of…

Q: Classify the following alcohols as primary, secondary, or tertiary. 3-ethyl-1-pentanol…

A: Please find below the structures of the given compounds.

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: Write the IUPAC names for these alcohols. a. но но ČH3 b. OH ČH3 C. H3C. HO Br d. H. Br HO

A: Given compounds are : Write the IUPAC names of the given compounds = ?

Q: The reaction of a certain alcohol with HBr yields a mixture of alkyl bromides. Consider the…

A: Reaction of alcohol with HBr proceeds through the carbocation intermediate. The carbocation formed…

Q: When a primary alcohol is oxidized twice you get a Oa carboxylic acid O an alkane OA ketone an…

A: