Choose the MOST appropriate comment about the stability of the Mn complex NH2 Hạ HN, The Mn complex is unstable because the complex is a paramagnetic complex The Mn complex is unstable because the spin multiplicity is only 3. O The Mn complex is unstable because the CFSE value is 0.00 Ao. The Mn complex is unstable because the spin only magnetic moment is 2.83 Bohr.

Choose the MOST appropriate comment about the stability of the Mn complex NH2 Hạ HN, The Mn complex is unstable because the complex is a paramagnetic complex The Mn complex is unstable because the spin multiplicity is only 3. O The Mn complex is unstable because the CFSE value is 0.00 Ao. The Mn complex is unstable because the spin only magnetic moment is 2.83 Bohr.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section20.7: Crystal-field Theory: Color And Magnetism In Coordination Compounds

Problem 20.10PSP

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?