The dctahedral compleX 1on [Mn(H20)6has moreunpaired spins than the octahedral complex ion[Mn(en)3]2. How many unpaired electrons arepresent in each species? Compare the Ao values forthese complexes.Complex ion# Unpaired electronsRelative A,|Mn(H,O)l**[Mn(en)3]2+CH2-CH2H2NNH2Ethylenediamineen

CFT explains the bonding interaction of central transition metal and ligand. This theory assumes…

Answered: Complex ion # Unpaired electrons…

Science

Chemistry

Complex ion # Unpaired electrons Relative A, [Mn(H,O),1²* [Mn(en)3]2*

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 31P

See similar textbooks

Related questions

Q: Name the following complex ions: [Cr(NH3);(H,O);]Cl3 Na[Fe(CI),] [Co(en)3](NO3)3

Q: Given the coordination compound: [MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the ligands of the…

Q: The following is a series of complex compounds whose central atom is a transition metal ion that has…

Q: Match the crystal field diagrams given below with the following complex ions. [Cr(NH3);Cl]²+…

Q: The complex [Mn(NH3)6]2+ contains five unpaired electrons. Sketch the energy-level diagram for the d…

A: The given complex is [Mn(NH3)6]2+.

Q: /hich of the following complex ions absorbs light of the shortest wavelength? A) [Crl6]3- B)…

Q: 4. Which of the following coordination ions is low spin? CA) [Fe(H,O).J* (B) [Co(H;O)]" (c) [FeF«]*…

A: By using the spectrochemical series , we can see the strong field and weak field ligand . On the…

Q: 5.16 Classify the following complex ions as inert or labile: (a) [Ru(NH3)5py]3+ (b) [Cr(acac)3] (c)…

A: The metal ion having d electron 0,1,2,7,8,9 electron are labile. The metal ion having d electron…

Q: Which of the following are high spin octahedral complex ions? (: [Cr(H2O)6]2* O (Mn(ox)3]4-…

A: When six ligands approach the metal ion, they arrange themselves in a geometry known as octahedral.…

Q: Suppose that the complex ion [Co(NH3)2(OH2)2Cl2]+ is synthesized with the two ammine ligands cis to…

Q: Which of the following complex ions is paramagnetic? A) [ZnCl.] B) [Fe(H2O)s]2- (H2O is weak field…

A: ANS. Option B) [Fe(H2O)6]+2

Q: Name the following complex ions. formula Mn Br [Co (CN),] [Cr(CO₂)₂] name X S ?

A: Name the given complexes ---

Q: 1.A chemist is studying the complex ions formed by group 6B transition metals. When the unknown 6B…

Q: *The drug Nipride, Naz[Fe(CN)5NO], is an inorganic complex which is used as a source of NO to lower…

Q: The compound PtCl>(en)2 is octahedral%; therefore we know that: A. The compound can have cis and…

A: Octahedral molecule means ,en is didentate ,and Cl is precipetated when Ag+ is added to form AgCl.…

Q: Which of the following ions could exist as either a low-spin or a high-sp octahedral complex…

Q: Explain TWO (2) reasons the transition metals have a unique tendency to form complexes with neutral…

A: Let us explain the tenancy of transition metals to form comolexes.

Q: 2+ -N. Ru 'N CI .N. 2 The above tris(bipyridly)ruthenium complex has a metal center (Ru*2) that has…

A: The complex compounds are surrounded by the non-metal species (atoms or group of atoms). These…

Q: For the complex Na3[Rh(NO2)3(CN)3], what is the number of unpaired electrons in the central metal…

Q: a) Draw the structure and the systematic name of the following d-metal complexes: (0) [Mn(CO),H₂]…

A: As per the rules only the first three subparts of the first question can be answered

Q: Name each complex ion or coordination compound- [Cu(en)2],+ b. [Mn(CO)3(NO2)3],…

A: A complex is a substance in which a metal atom or ion is associated with a group of neutral…

Q: Which of the following is not an example of a d° transition metal complex? Select one: a. VO2+ b.…

Q: How many unpaired electrons do you expect each complex ion to have? a. (Cr(CN),J b. (MnF (Ru(en),2+…

Q: Consider the two complexes i) [Cr(OH2)4Cl2]•H2O and ii) [Cr(OH2)sCl]Cl a) Name the two complexes. b)…

A: The primary valance is the oxidation number of central atom while , secondary valence is the…

Q: Which of the following complex ions is paramagnetic? A) [ZnCl4]? B) [Fe(H2O)6]²* (H2O is weak field…

A: FeCH2O62+ Fe2+=3d6 E of Fe2+=(2g4 eg2) (paramagnetic)

Q: In the di-cationic complex (+2) shown below, how many electrons around the metal center can be…

A: For these type of questions, we must know about the valence electrons of metal and electrons…

Q: A coordination chemist would call this complex: a. high spin & d4 Ob. high spin & dº C. low spin &…

A: A complex is said to be low spin if there is possibility of pairing of electrons present in…

Q: Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?

Q: How many unpaired electrons are in the following complex ions? a) Ru(NH3)62+ (low spin case) _____…

Q: Predict which complex is colorless: [Cr(en)3]2+, [Fe(CN)6]3−, [Zn(CN)4]2−, [Ni(CN)2Br2]2−?

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: 45. Which complex has the weakest carbon-oxygen bond due to backbonding? (A) [Ti(CO), (B) CrCO) (C)…

A: Which complex has the weakest carbon - oxygen bond due to back bonding ?

Q: What is the coordination number on the transition metal in the following compound? [Mn(H2O)6](NO3),

A: We have an coordination compound , we have to predict the coordination number of the metal in the…

Q: 4. (a) Transition metals form complexes by combining with ligands. What is (i) A transition metal?…

A: (i) A transition metal In the periodic table, the elements are classified into four blocks namely,…

Q: 4) Which of the following complex ions absorbs light of the shortest wavelength? A) [Crl6]3- B)…

A: The wavelength of complexes can be explained on the basis of the strength of ligands. The stronger…

Q: How many unpaired electrons are in the high-spin octahedral complex [Fe(NH3)6]3+?

Q: In the lab, we found that [Co(en)3]3+ isomers are optically active. Would other [M(en)3]n+ complexes…

A: [Co(en)3]3+ : optically active. [M(en)3]3+ : optically active or not.

Q: Predict which complex has more unpaired electrons and whether the complexes will be paramagnetic or…

Q: Consider the coordination compound Na4[Fe(ONO)2(ox)2] A. Indicate the oxidation state, coordination…

Q: The octahedral complex ion [MnCl1* has more unpaired spins than the octahedral complex ion…

A: For [MnCl6]4- The oxidation state for Mn is +2. Cl is a very weak field ligand so it will form a…

Q: 3. a. The [Co(H₂O)6]³+ complex is high spin. Fill the below molecular diagram with the correct…

A: [Co (H2 O) 6] 3+ is a complex. We can determine the number of d-electrons of the metal cam be…

Q: Which of the following octahedral complex ions will havethe fewest number of unpaired electrons?(a)…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Name the following complex ions. formula [Ti(OH)] [Fe(CO₂),] name 0

A: The answer is given below:

Q: How many unpaired electrons are in the following complex ions? a. Ru(NH3)62+ (low-spin case) b.…

A: According crystal field theory, when transition metals are bonded to any ligand, their d orbitals…

Q: (b) Which copper complex ion is colourless? O A [CuCl] I B [CuClj²- O C [Cu(H,O),J** 2+ O D…

A: Cu+ ion has a d10 configuration and all eg orbitals are filled. There is no transition between the…

Q: 6. Fill in table. Metal High Spin or Low Spin # of unpaired # d Complex elect. electrons Rh(NH;),+…

A: To solve this problem one should know high spin and low spin complexes he must be aware of the…

Q: Which of the following complex ions is Paramagnetic (has unpaired electrons)? Explain. a) weak…

A: Weak field complex has low CFSE value of ligands. Therefore inner orbitals electrons are not paired.…

Q: Given the coordination compound: [MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the charge of the central…

Q: There are A.______ unpaired d electrons present in the [Mo(NH3)4Cl2]2+ complex, which is a low spin…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

100%

The dctahedral compleX 1on [Mn(H20)6
has more
unpaired spins than the octahedral complex ion
[Mn(en)3]2. How many unpaired electrons are
present in each species? Compare the Ao values for
these complexes.
Complex ion
# Unpaired electrons
Relative A,
|Mn(H,O)l**
[Mn(en)3]2+
CH2-CH2
H2N
NH2
Ethylenediamine
en

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Draw the Crystal field diagrams for [Fe(NO2)6]4- and [FeF6]3-. State whether each complex is high spin or low spin, paramagnetic or diamagnetic, and compare ?oct to P for each complex.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?