compound(s) contain(s) the HIGHEST percentage of cholesteryl esters
Q: Why is PHC still relevant today?
A: 4. PHC Or Primary health care is a whole-of-society approach towards health and well-being that is…
Q: 5. Which of the following names best describes the molecule? CH2OH C=0 но- H- H- -OH ČH,OH A.…
A: We'll answer the first question since the exact one wasn't specified. Please submit a new question…
Q: 1. Select the odd one out. xylulose b. dihydroxyacetone c. glyceraldehyde d. ribulose С.
A: "Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: 3. On the DIPEPTIDE, label the following: Two central carbons, N-term, C-term, two Rgroups A…
A: Amino acids are the building blocks of proteins where several amino acids are linked together by…
Q: 3. How do each pair of the following molecules resemble/differ from each other. (a) glycogen and…
A: Monomers combine to form polymers. These all are carbohydrates. Carbohydrates are called so because…
Q: 5. Draw the structures of the TWO glycoside products formed below. CH2OH OH CH3OH, H* но НО Он
A:
Q: 1. The general chemical formula of carbohydrate is: (in 1 to 3 sentences, explain why this is your…
A: Carbohydrates are diverse in function and in their structures. They perform vivid functions and…
Q: 11. Choose the polyunsaturated triglyceride from the compounds below. A) HO, B) H,C-0-C E) HĊ-0-C C)…
A: Triglycerides are glycerol molecules esterified with three molecules of fatty acids. It is a kind of…
Q: . Compare and contrast the two major classes of monosaccharides the Aldoses and Ketoses
A: Monosaccharides are the simple sugars that provide sweetness and mainly comprise glucose and…
Q: View a butane molecule along the C2-C3 bond and provide a Newman projection of the lowest energy…
A: Newman projection, is used in alkane stereochemistry. Here, it observes the conformation of an…
Q: 2. Classify the following alkaloid according to ring system, draw the structure, then give the…
A:
Q: 5. Which of the following structure is the not stable structure of hexoses? 6 Он ОН4 HO HO. 5 HO- 2…
A: In the hexose structure or any structure when the position of OH group is in equatorial postion it…
Q: 1. For this compound to cyclize, an alcohol group must attack a carbonyl group. Which carbon is…
A: A monosaccharide often switches from the acyclic form to a cyclic through a nucleophilic addition…
Q: 3. What are simple and mixed triacylglycerols and where is each more prevalent? 4. What are trans…
A: Triacylglycerols are esters that are made up of a glycerol backbone and fatty acid molecules…
Q: 7. The only carbohydrate which is not having any chiral carbon atom is (in 1 to 3 sentences, explain…
A: Carbohydrates are essential biomolecules which are also sugar molecules. Carbohydrates, along with…
Q: 5. The main function of bile salts is:
A: Bile salts are made up of different kinds of elements called as free bile acids. Bile salts makes…
Q: What arethe structural and functional differences between starch and cellulose
A: Polysaccharides are one of the most abundant carbohydrates that are found in food. They are…
Q: 9. Identify the monosaccharides and their linkages in the following disaccharide. HOCH, но 0-CH он…
A: A carbohydrate is a biomolecule composed of carbon, hydrogen, and oxygen. Carbohydrates are…
Q: 1. Which of the following best describes glycogen? A. a fibrous protein that helps in maintaining…
A: Glycogen is an essential storage polysaccharide in animals. It is a polysaccharide of glucose,…
Q: 7. The cis-double bonds in unsaturated fatty acids put an inflexible "kink" in the carbon chain,…
A:
Q: 2. The diagram below shows the structure of a sugar. ÇH2OH C=0 Но -H- но ČH2OH a. Is the sugar an…
A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…
Q: The C-C bond angles for the ring in M2 is: 60º 109.5º 120º 180º
A: Asked : C-C bond angles for the ring in M2
Q: 2. How are the complex sugar molecules broken apart? 3. What substance are commonly called lipids?
A: When two monosaccharides are connected by glycosidic linkage, a disaccharide (also known as a double…
Q: Which one is NOT a property of glycerol? a. "backbone" in the simple lipid structure b. undergoes…
A: Disclaimer: Since you have asked multiple questions we will answer the first question for you. If…
Q: 4. What is the building block of carbohydrates? fatty acids amino acids monosaccharide cellulose
A: Carbohydrates are organic substances having carbon, hydrogen and oxygen where hydrogen and oxygen…
Q: One of the main sources of sphingosine in the body is in the cell membrane. What complication could…
A: All plasma membranes, regardless of source, contain proteins as well as lipids. The ratio of protein…
Q: What are terpenes? 2. Essential function of terpenes in plants? 3. What is the difference between…
A: The secondary metabolites in plants helps in defence and communication. The secondary metabolites…
Q: One of the triacylglycerols found in corn oil contains palmitic acid, linoleic acid, and linolenic…
A: Fatty acids are the simplest form of lipids with a long hydrocarbon chain and a carboxylic acid…
Q: 4) Which of the following molecules contains the most oxidized form of carbon? A) acetaldehyde B)…
A: The oxidation state can be defined as the total number of electrons that an atom either gains or…
Q: 2. Which of the following statements is true to the carbohydrates below: CH2OH HO- H- H- OH ОН ČH2OH…
A: Carbohydrates: Carbohydrates are sugars that provide energy for the body. It is composed of organic…
Q: 9. Which of the following is a compound lipid?|
A: Compound lipids are esters of fatty acids which consist of fatty acid, alcohol, and additional group…
Q: how monosaccharides attach to the pentasaccharide core?
A: Monosaccharides are simple sugar having usually carbon range from 3 to 7 carbons. Monosaccharides…
Q: 6. Which of the following is common among lipids? 1.In glycogenesis, the glucose is added at the a.…
A: Glycogenesis is the process of synthesis of glycogen, it takes place in the cytosol and requires…
Q: III. Convert the ff. cyclic sugar structures in Fischer formula into their corresponding Haworth…
A: Carbohydrates: Is a biomolecule having ketone and aldehyde groups also known as aldoses and ketoses…
Q: 2. Which of the following molecules contain beta glycosidic linkage? A. Amylose B. Glycogen C.…
A: Cellulose is a structural polysaccharide in plants. It is made up of glucose monomers.
Q: 3. What are the effects of the following solvents when mixed with lipids? What type of hydrolysis is…
A: The lipids are the chemical substances or macromolecules that are usually insoluble in water but…
Q: 2. Which of the following is an aldotriose? (in 1 to 3 sentences, explain why this is your answer).…
A: Sugars are referred to as saccharides and are the generic term that refer to carbohydrates.…
Q: 3. Structurally compare and contrast the compound responsible for the odor and flavor of pear…
A: A parent molecule is generally the denotation for a compound consisting of an unbranched chain of…
Q: 1. To investigate the physical properties and uses of some common aldehydes and ketones. 2. To…
A: Carbohydrates are composed of carbon, oxygen, and hydrogen which are connected by the…
Q: 6. What functional groups are present in the following molecul HạN. OH NH. A) amine and carboxylic…
A: There are several functional groups that can be found in a molecule. Some examples of functional…
Q: 4. This question is about the effect of geometric isomerism on the melting and boiling points of…
A: Cis-1,2- dichloroethene - Polar (i) Same groups(Cl) are present on the same side : So, net dipole…
Q: 4. Draw the boat conformation of no. 3. 5. Draw the chair conformation of no. 3. 6. How many…
A: A boat and a chair form (different three dimensional structural conformations) of the carbohydrates…
Q: 18. Which of the following characteristics are found in the class of C20 carboxylic acids called…
A: Prostaglandins, thromboxane, as well as leukotrienes, are known to be derived from the essential…
Q: 1. What are the differences between terpenes and terpenoids? 2. Classify the following terpenes,…
A: The plants synthesize a variety of organic molecules. They are of two types, primary and secondary…
Q: 1) A specific fat/oil has on over 50% of its triglyceride sites oleic acid, 28% palmitic acid, and…
A: Since you have posted multiple questions, we will answer the first one for you. If you want a…
Q: 9. Describe how synthesis of fatty acids is a spontaneous reaction based on coupling to favorable…
A: Hello. Since you have posted multiple questions, we will solve the first question for you. If you…
Q: 1. What is the chemical formula for palmitic acid and oleic acid? Which one is a saturated fat and…
A: # According to our guidelines we can answer only the 1st question. So, please upload the questions…
Q: draw an isomer of the triglyceride in sunflower seed oil. Show the reaction and write out the…
A: Hydrogenation is the process of chemical modification that is performed by addition of hydrogen to…
Q: 7. As shown below glycerol and two fatty acid molecules formed diglyceride by но, .CH3 Ô CH3 O two…
A: Chemical bonds are attractions between two chemical species. There are different types of bonds.…
5.Which compound(s) contain(s) the HIGHEST percentage of cholesteryl esters?
Trending now
This is a popular solution!
Step by step
Solved in 2 steps
- 1.One of the main sources of sphingosine in the body is in the cell membrane. What complication could arise from the biological synthesis of ceramide?1. Where does chloramphenicol bind?A monosaccharide designated as an aldehyde sugar contains (a) a terminal carboxyl group (b) an internal carboxyl group (c) a terminal carbonyl group (d) an internal carbonyl group (e) a terminal carboxyl group and an internal carbonyl group
- 2. The C-C bond angles for the ring in M2 is: 60º 109.5º 120º 180º1. Classify each pair of structures as enantiomer, diastereomers or neither enantiomers or diastereomers. 2. Draw the structures.3. One of the triacylglycerols found in corn oil contains palmitic acid, linoleic acid, and linolenic acid. During the production of spreadable margarine, all of the double bonds in this triacylglycerol are converted from cis to trans isomers. Linoleic acid: CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHLinolenic acid: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH Palmitic acid: CH3(CH2)14COOH a. Identify the unsaturated fatty acid(s) listed above and provide the associated omega designation. b. Draw an accurate representation of the structure of the triacylglycerol present in spreadable margarine. Circle all ester bonds in the structure you have drawn.
- 2. a. What ingredient(s) necessary to white chocolate does this product have? b. Why is this product labeled as “white chocolate style” instead of being simply labeled as “White chocolate”?1. which IR stretches and bends indicate what type of functional group we have (alcohol, carboxylic acid, ester), 2. how you can then use IR to monitor the change from the starting materials to the products. 3. indicate and discussion the absorptions that are relevant to alcohol OH and C-O, carboxylic acid OH, carboxylic acid C=O, ester C=O, and C-O). the picture below is an ir spectra of ethanol1. What are the three major classes of carbohydrates? Describe each in one sentence