Enter the balanced complete ionic equation for K2SO4 (aq) + Cal2(aq) → CaSO4 (s) + KI(aq) Express your answer as a chemical equation. Identify all of the phases in your answer.

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :-  ZnO(s) + ∆ → Zn(l) + O2(g)  To balance :-  Given equation

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: Why P2 is obtained by subtracting the vapor pressure of water from the barometric pressure?

A:

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: given the following phase diagram for carbon dioxide which state will be present at 5°C and 110 kPa…

A: From the given  phase diagram we have to find out the state of carbon dioxide at 5°C and 110 kPa

Q: АСTIVITY 2 - а3 Interpreting a Phase Diagram Refer to the following phase diagram of a certain…

A: We are authorized to answer the first three subparts of a question at a time. Since you have not…

Q: When potassium sulfite dissolves in water, the sulfite ion SO2−3 acts as a base. Write a balanced…

A: The equation containing identical number of species reacting as well as species produced and their…

Q: Estimate the thermal diffusivity of butter at 20 degrees Celsius

A:

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: the phase diagram of CO₂ below. 72.9 atm Supercritical fluid

A: The gas temperature cannot be liquified even high pressure can be applied.

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: H3PO4(aq)+Sr(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in…

A: We are given incomplete reactions we have to complete and balance the chemical reactions.

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

A:

Q: Question attached

A: Acid react with a base to form salt and water.

Q: A liquid and a solid of the same substance coexist in a flask as shown in the diagram below. The…

A: A question based on matter that is to be accomplished.

Q: 2. During a phase change, what properties change? Mass Volume Temperature Heat

A: There are three phases of matter. The phase of matter can be interchanged by changing the…

Q: Forces acting equally and in opposite directions do not cause motion. True OR FALSE

A: To find the statement "Forces acting equally and in opposite directions do not cause motion" is true…

Q: Define the following terms: a. salt bridges b. ionic interactions c. van der Waals forces d.…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: HCl(aq)+Ba(OH)2(aq)→  Express your answer as a chemical equation. Identify all of the phases in your…

A:

Q: Identify the predominant intermolecular forces in each of the given substances. Electrostatic…

A: Interpretation: The predominant intermolecular forces in each of the given substances is to be…

Q: The hydrogen and oxygen bonds of water are easily broken by iconic solids. Justify your answer.

A: The interaction of water is very different with polar particles than with nonpolar substances.…

Q: The liquid phase is represented by which of the following letters A) T B) x C) w D) y

A: x is the area that represent liquid phase.

Q: Determination of the Surface Tension of a Liquid by the Capillary Rise Method: A group of students…

A: Surface tension of benzene = 28.39 dyne /cm surface tension of chloroform = 19.17 dyne/cm surface…

Q: The following defined relationships describe an antiquated set of British liquid units: 1 hogshead =…

A: Given : value in hogshead = 144  The relationships given are  1) 1 hogshead = 7 firkin 2) 1 firkin =…

Q: Q2/ For a 97.5 wt% Fe-2.5 wt% C at a temperature 700 oC, determine the following: a) The Number and…

A:

Q: liquid nitrogen has a density if 875.4 kg/m^3 at its normal boiling point. what volume does a ballon…

A:

Q: Sulfur Trioxide with water  Express answer as a chemical equation. Identify all of the phases in the…

A: A chemical reaction is symbolic representation of the conversion of substances to new substances.

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: Vapor Pressure Versus Temperature Diethyl ether Water Mercury -100 0 34.6 100 200 357 400…

A:

Q: Mercury ions (Hg2 2+) can be removed from solution by precipitation with Cl-. Suppose that a…

A: Solid mercury chloride is formed from the reaction of Mercury (I) nitrate with sodium chloride.

Q: H,SO, (ag) and KOH(og) Express your answer as a chemical equation. Identify all of the phases in…

A: H2SO4 is acid while KOH is base so this is a type of neutralisation reaction . Generally these all…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Write a balanced equation for the complete combustion of table sugar (sucrose, C12 H22O11). Use…

A:

Q: prepare 2.200 g FeTiO3, assuming the reaction goes to completion. a)Write a balanced chemical…

A:

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Which of the following properties must be similar for two liquids to be miscible?…

A: In this question, we will see the property for the two miscible liquid.  You can see the answer…

Q: Describe the relative densities of the phases for most substances. density of gas phase density of…

A: The relative densities of solid, liquid and gas can be explained on the basis of packing of…

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

A:

Q: Which unit is used to measure the magnitude of apotential difference?

A: Potential difference is measured using a device called a voltmeter . Just like ammeters, some types…

Q: Ca(s)+Br2(l)⟶CaBr2(s)  Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: C3H6(g)+O2(g)→CO2(g)+H2O(g)C3H6(g)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: A combustion reaction is a reaction in which a substance reacts with oxygen to give carbon dioxide…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

A: