Examine the molecules below. Which of these molecules can not be described as an amphipathic (ampiphillic molecule?

Q: Calculate the pH of a solution containing 0.05mol/dm3 benzoic acid, C6H5COOH and 0.05mol/dm3 of…

A:

Q: Heroin, a tertiary amine, is a weak base because it contains a nitrogen atom with a lone pair of…

A: Mass of the sample mixture taken for titration = 75.000 mg  Molar mass of Heroin = 369.4176 g/mol

Q: 9. How do you know if a malenimide based reagent will conjugate to nitrogen or sulphur in an amino…

A: we can identify the malenimide based reagent as amino acids by looking at the following - amino…

Q: Under basic conditions, amine will gain H* from the solution. True False

A: Ammines are basic in nature due to the lone pair present on the nitrogen. Ammonia when reacts with…

Q: A. Identify the IMFA present bei molecules oT each compound. Compare the IMF of three molecules…

A: Boiling is dependent on the intermolecular force of attraction. The greater the intermolecular…

Q: When the compound I is replaced by compound II for anti-fungal activity, it was found that II has…

A: A multiple choice question based on biological importance of chemicals that is to be accomplished.

Q: Ka values ​​of HA and HB weak acids are 4x10-7 and 8x10-4, respectively. These acids are water and…

A:

Q: Phenylalanine is a diprotic acid with pKg = 2.20 for the carboxylic acid group and pK, = 9.31 for…

A: pKa for carboxylic acid group = 2.2 pKa for ammonium group = 9.31

Q: 5. A water-soluble unknown is found to form a solution With nat of following functional groups is…

A:

Q: Calculate the percent dissociation of trimethylacetic acid (C,H,CO,H) in a 0.15 mM aqueous solution…

A:

Q: 1.What is the lactic acid concentration (in M) of the titrated sample? 2. Determine the lactic acid…

A:

Q: LOH H Br This content is prot and 1. NaNH2 (excess) 2. CH31 3. Na, NH3 4. 03 5. DMS 1. PBr3 2. Mg 3.…

A:

Q: QUESTION 19 Briefly explain why there are + and - charges in the amino acid structures in the table…

A:

Q: Ammonia (NH3) is a weak base that under acidic conditions becomes protonated to the ammonium ion in…

A:

Q: Calculate the [H3O+][H3O+] of oranges with pH=3.50pH=3.50 .

A: We are having oranges with pH=3.50 pH = - log [H3O+]

Q: 2) A triprotic weak acid H3A has pKa1 = 2.50, pKa2 = 6.70 and pKa3 = 10.30. Calculate the pH of a…

A:

Q: spectru moleculor formula and use the formula to calculate units of ursaturation Assume that the…

A: From this we will do the calculation of the molecular formula of the compound who gives this…

Q: The structure of the molecule below shows its structure where all of the ionizable/protonatable…

A: The -COOH and -NH3+ group of a peptide is deprotonated at pH greater than the pKa value. The…

Q: H3CO I II III IV +)

A: Electrophiles are the species which can accept electron pair from other species to form a chemical…

Q: A. Consider the structures below. Write the letter that corresponds with the compound described by…

A: The matching is as follows:

Q: The p K, of aniline is 9.37. Calculate the pH of the base solution after the chemist has added 255.8…

A: The question is based on the concept of titrations.   we are titrating  a weak base aniline  with a…

Q: The pKa value of CH3COOH/CH3COO- is 4.75. At what pH value are the concentration of CH3COO- and…

A: Acid and its conjugate base forms Acidic buffer.

Q: Think about the chemical reactions in which the H⁺-ion is involved. In how many positions can this…

A: The functional group of a molecule furnishes the characteristic chemical reaction and hence the new…

Q: Write the reaction between ammonia, NH3, and hydrosulfuric acid, H2S. NH3 + + In this reaction…

A:

Q: You wish to prepare an HC2H3O2 buffer with a pH of 5.14. If the pKa of is 4.74, what ratio of…

A: Given:pH = 5.14pKa = 4.74We need to find the ratio of C2H3O2⁻/HC2H3O2

Q: Virtual Lab Question: Phosphorus in urine can be determined by treating with molybdenum (VI) and…

A: Solution Absorbance 1.00 ppm P 0.205 2.00 ppm P 0.41 3.00 ppm P 0.615 4.00 ppm P 0.82…

Q: Which of the following has the greatest buffer capacity? Underline your answer. a. 0.40M CH3COONa…

A: Buffer is mixture of either mixture of weak acid and its conjugate base or either weak base and its…

Q: for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc

A:

Q: Which of the following is/are TRUE in the experiment about SUDAN-1? 1. The preparation of…

A: Answer : I, II, IV  True statements : I. The preparation of phenyldiazonium ion was carried out at…

Q: The pH of a 0.112 M ethylamine is 11.80. Find by showing your computations the pKb for ethylamine.

A: Given that,  pH of 0.112 M ethylamine solution = 11.80 Since, pH + pOH  = 14             pOH  = 14 -…

Q: We call a molecule that binds up excess hydrogen ions in a solution a(n) ________. a. acid b.…

A: A base is the chemical species which takes up proton (H+). An acid is the chemical species which…

Q: Calculate the percent dissociation of trimethylacetic acid (C4H,CO₂H) in in a 0.26 mM aqueous…

A:

Q: The pKa of Cl3CCO2H is 0.64. What is the pH of a 0.580 M solution? What percentage of the Cl3CCO2H…

A:

Q: Calculale at tte e9uiualen a Dont o hen 1s tetrated hy 2S. OmL Or 8. 2.S.0mL loomat {thrकएd lo0m HCI

A: The balanced reaction and moles of ammonia in initial solution can be given as follows:

Q: Safari File Edit View History Bookmarks Window Help 4)) 51% O Sun 10:43 AM…

A:

Q: Griven some molecute given their vapor pressure of a number of tequids. in which who have the…

A: Strength of intermolecular forces depends on vapor pressure .

Q: A. Consider the structures below. Write the letter that corresponds with the compound described by…

A:

Q: 28. A new compound is synthesized and found to be a monoprotic acid with a molar mass of 248 g/mole.…

A: 28. Given : No. of moles = 0.0050 moles Volume = 0.500 L pH = 2.94   We have to calculate pKa of the…

Q: D. H,O, H* 9. Н, Pt 10 cold dilute neutral KMNO4 H3C CH3 11 1. mCPBA 2. Н,О, Н" 12 13 mCPBA

A: Alkene double bond shows addition Reaction due to presence of pi electron density

Q: 1. Explain the differences between M9SO4 (s), M9SO4 (aq), and MgSO4 • 7 H2O (s)-

A: It is often encountered as the heptahydrate sulfate mineral epsomite MgSO4·7H2O, commonly called…

Q: What is the role of Glycerin in the assay of Boric Acid? I. The reagent prevents the formation of…

A:

Q: solubility in: compounds H2O Et20 5% NaOH 5% NaHCO3 5% HC1 Conc. H2SO4 comments 1. CH3CO2H; acetic…

A: Hello. Since your question has multiple subparts, the first three subparts shall only be solved in…

Q: 21. Which pai r will likely not show fac/mer isomerism? 1. Potassium trichlorotrifluoroplatinate(IV)…

A:

Q: How should the pH of a 0.2 M solution of KC2H3O2 compare to that of a 0.2 M solution of NaC2H3O2?…

A: As we know NaOH is strong base than KOh

Q: Compare compounds I and Il and choose which statement below fits best. 'N. vs. column I compound II…

A:

Q: What is the Ka expression for this reaction? HC2H3O2(aq) + H2O(1) H30*(aq) + C2H3O2°(aq)

A: The equilibrium constant for the given expression is known as the acid dissociation constant (Ka).

Q: Which of the following three selectrions would be most likely to be conductive under the given…

A: Material can be classified as conductor, semiconductor and insulator. Conductor are those which can…

Q: d) Write an expression which shows how the acid dissociation constant, Ka, of ethanoic acid…

A:

Q: A sample of Al2(SO4); weighing 7.52-g was dissolved in enough water and diluted to 250.0-mL.…

A: Given: Mass of sample = 7.52 g. The sample is diluted to 250 mL. Volume of diluted sample used =…