Express the equilibrium constant for the following reaction:2 CH2CI2 (g) + Cl2 (9) =2 CHCI3 + H2 (g)[CHCI3}[H2][CHCI,}[Cl,][CHCI2][CI2]k =[CHCI3][H2][CHCI3][H2]k =[CHCI,][Cl2][CHCI,[Cl,][CHCI3]°[H2][CHCI3]?{H2]Ok=[CHCI,j!/?{Cl,]

The equilibrium constant is defined as the ratio of the concentration of products to that of…

Express the equilibrium constant for the following reaction: 2 CH2Cl2 (g) + Cl2 (9) =2 CHC13 + H2 (g) [CHCI3[H2] k = [CHCI,}IC1;] [CHCI2JICI2] k = [CHCI3][H2] [CHCI3[H2] [CHCI,[Cl2] Ok= [CHCI,°[CI2] [CHCI;J°[H2] [CHCI3]/2[H2] k = [CHCI,1!/?{Cl;]

Express the equilibrium constant for the following reaction: 2 CH2Cl2 (g) + Cl2 (9) =2 CHC13 + H2 (g) [CHCI3[H2] k = [CHCI,}IC1;] [CHCI2JICI2] k = [CHCI3][H2] [CHCI3[H2] [CHCI,[Cl2] Ok= [CHCI,°[CI2] [CHCI;J°[H2] [CHCI3]/2[H2] k = [CHCI,1!/?{Cl;]

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.CCP

See similar textbooks

Related questions

Q: For the reaction PCl5(g)⇌ PCl3(g) + Cl2(g), the equilibrium constantKc = 1.1 x 10-2 at 400 K. What…

A: In-order to get the desired equation, first the given equation has to be reversed.

Q: Express the equilibrium constant for the following reaction. N2(g) +3 H2(g) = 2 NH3(g) N2][H2]1/3 K…

A: Given N2(g) + 3H2(g) →2(NH3)(g) we need to find equilibrium constant K

Q: Calculate the value of the equilibrium constant, Kc , for the reaction Q(g)+X(g)↽−−⇀2 M(g)+N(g)…

Q: The equilibrium constant for a reaction can be determined by using something called a van't Hoff…

A: The general equation of straight line is, y= mx + c where, m is the slope and c is y-intercept of…

Q: Write the equilibriu heterogeneous equilibria. a. P4(s) + 6F2(g) = 4PF3(g) b. Xe(g) + 2F2(g)…

A: equilibrium constant

Q: Calcium hydroxide is a base that does not dissolve very well in water. When saturated, a calcium…

A: given: molar mass = 74 g/mol moles = 1.3 / 74 = 0.01756 moles CaOH2 ----> Ca2+ + 2OH- Ksp =…

Q: Consider the following reaction: 2SO3(g) =2SO2(g) + O2(g) If 0.313 moles of SO3(g), 0.562 moles of…

A: The given equilibrium reaction is as follows: 2SO3g ⇌ 2SO2g + O2g The volume of the container is =…

Q: Determine the equilibrium constant for the following reaction at 25°C. 2 NH3(g) → N2H4(g) + H2(g)…

A: Given : We have to calculate the equilibrium constant.

Q: Estimate the temperature at which the equilibrium constant for CuSO4 ⋅ 5 H2O(s) → CuSO4(s) + 5…

A: The equilibrium Constant for the reaction (K) = 1.

Q: Barium iodate is a white, granular inorganic compound that is stable on a temperature that is…

A: Molar mass of BaCl2.2H2O = 244.26g/mol Molar mas of NaIO3 = 197.89 g/mol Molar mass of Ba(IO3)2 =…

Q: In k vs. 1/T (K) 0.0005 d,001 0.0015 -2 -4 y = -30189x + 27.399 R² = 1 -6 -8 -10 -12

Q: A reaction mixture that consisted of 0.20 mol N2(g) and 0.20 mol H2(g) was introduced into a reactor…

A: Calculation of concentration:

Q: The equilibrium constant for the reaction N2(g) + O2(g) an elevated temperature. A reaction vessel…

A: Reaction: N2 (g) + O2 (g) ⇌ 2 NO (g) The equilibrium constant (K) for the reaction = 1.7×10-1…

Q: Calcium hydroxide is a base that does not dissolve very well in water. When saturated, a calcium…

A: The solubility reaction is given as => Ca(OH)2 (s) ---------> Ca2+ (aq) + 2 OH- (aq) Given :…

Q: Determine the value of the equilibrium constant, Kgoal , for the reaction N2 (g) + O2(g) + H2 (g)…

Q: At 1500°C the equilibrium constant for the reaction CO(g) + 2H2(g) <--> CH3OH(g) has the…

A: According to the equation, Free energy can be calculated as,

Q: Calculate the equilibrium constant (Kc) for the following reaction: CH3COOH(aq) + OH aq) CH3CO0 (aq)…

Q: Write the expression for the equilibrium constant, Kc , for the following system: CaCO3(s) ⇄⇄…

A: Calcium carbonate is the salt of calcium which is the main component for the synthesis of pearls,…

Q: Consider the reaction of hydrogen gas reacts with iodine vapor to give hydrogen iodide with K = 54…

Q: Glauber’s salt, also called Mang Xiao, is a hydrate of sodium sulfate. It is used for medicinal…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: Using the information in the table below, calculate the value of the equilibrium constant (K) for…

A: Given,

Q: find the value of Ksp for Ca(OH)2 at 25°C.

A: Ionic compounds can be either soluble, or sparingly insoluble in water. Ca(OH)2 is a sparingly…

Q: Express the equilibrium constant for the following reaction: 2 CH2CI2 (g) + Cl2 (g) =2 CHCI3 + H2…

Q: 10.) Write the correct equilibrium constant expression (Kc or Kp as indicated) for the following…

A: a) Kc = [H2O]3 / [H2]3 b)Kp = 2P[PBr]* 5P[F2] / 2P[BrF5]

Q: The equilibrium constant for the reaction N2(g) + O2(g) 5 2 NO(g) is 1.69 × 10−3 at 2300 K. A…

A: Given; N₂(g) + O₂(g) ⇌ 2 No(g) K= 1.69 × 10-3 (Equilibrium constant) mass of oxygen 2.09.…

Q: 0.250 mol of CO(g) sealed with 0.250 mol of H2O(g) in a 125 mL volume forms CO2(g) and H2(g) at 900…

Q: The following reactions have the indicated equilibrium constants at 100C: 2 NOBr(g) ⇌ 2NO(g)+Br2…

A: Given,

Q: The conventional equilibrium constant expression (Kc) for the system as described by the below…

A: We have to predict the Equilibrium constant expression for the given reaction .

Q: The equiliorim constant Kc is 10.5 @350 K. 2 CH2 Clz (g)a CHy(G)+ CCl4 ) Calculate equililarium Con…

A: The chemical reaction taking place is: 2CH2Cl2g ⇔ CH4g + CCl4g The given information is: Kc = 10.5…

Q: Bromine monochloride is synthesized using the reaction:Br2(g) + Cl2(g) <-----> 2 BrCl (g)Kp =…

Q: The equilibrium constant for the reaction N2(g) + O2(g) an elevated temperature. A reaction vessel…

A: Given reaction: N2 (g) + O2 (g) ⇌ 2NO (g) The equilibrium constant = 1.7×10-1 The partial pressure…

Q: Express the equilibrium constant for the following reaction: 2 CH2CI2 (g) + Cl2 (g) =2 CHCI3 + H2…

Q: Q2 // For the reaction bellow, find the mole fractions of all spices. If KP=0.3 A 2B + C

A: Given in following question a reaction A=2B+C calculate mole fraction of each species and also give…

Q: For items 10-12. The decomposition of NH,Cl (s) at a given temperature of 548 K, the Kp = 0.01072.…

Q: If 500.0 mLmL of 0.10 mol L−1 Ca2+mol L−1 Ca2+ is mixed with 500.0 mLmL of 0.10 mol L−1 SO42−mol L−1…

A: In a solution, when the amount of salt added it more than the solubility amount of the salt, the…

Q: Consider the following reactions and their respective equilibrium constants: NO (g) + ½ Brz (g) NOBI…

A: Rearranging this equation 2 and equation 3, N2O4 (g) →2NO (g)+O2…

Q: A mixture of 0.5800 M CO and 0.4910 M Cl, is enclosed in a vessel and heated to 1000 K. CO(g) + Cl,…

A: Given, CO(g) + Cl2(g) ⇌COCl2(g) Equilibrium constant (Kc) = 255.0 Initial concentration of CO =…

Q: Which of the systems described below give homogeneous equilibria? (Select all that apply.) a. CO2(g)…

A: A homogeneous equilibrium is one in which all of the reactants and products are present in a single…

Q: For the reaction 2HI(g)⇌H2(g)+I2(g) the equilibrium constant Kc=1.8×10−2 at 700 K. A. What is…

Q: Consider the equilibrium system described by the chemical reaction below, which has a value of Kc…

Q: A. Determine the value of the equilibrium constant, Kgoal for the reaction…

A: Since you have asked multiple question, we will solve the first question for you as per our…

Q: A 2 dm3 flask maintained at 700 K contains 0.1 mol of CO(g) and a catalyst for the reaction CO(g) +…

A: Recall the given equation, CO g + 2 H2 g → CH3OH g2 dm3 flask contains 0.1 mole of CO…

Q: A mixture consiting of 1.000 mol H2O(g) and 1.000 mol CO(g) is placed ina reaction vessel of volume…

A: Initial concentration of CO and H2O and also the concentration of CO2 at equilibrium can be…

Q: The conventional equilibrium constant expression (Kc) for the system as described by the equation…

A: Which one of the following is correct

Q: Glauber’s salt, also called Mang Xiao, is a hydrate of sodium sulfate. It is used for medicinal…

A: Since you have posted multiple questions, we will solve first question for you. Please repost other…

Q: 6.5 g of thallium (I) chloride, TICI, is added to 750 mL of water at room temperature to determine…

A: Given: Mass of TlCl remaining after evaporation = 1.20 g. Volume of solution evaporated = 400 mL =…

Q: Calculate A,G° at 25 °C for the formation of 1.00 mol of C3H;OH(g) from C3 H6 (g) and H20(g). Use…

A: From thermodynamics relation , we have : ∆G = ∆G° + RT ln(Q) As at equilibrium , ∆G = 0 and Q = K ,…

Q: Express the equilibrium constant for the following reaction. 2 CH 2C12 (g) +H2 (g) 2 CH 3C1(g) +C12…

A: Equilibrium constant is the product of the concentration of the products raised to the coefficients…

Q: For items 10-12. The decomposition of NH4Cl (s) at a given temperature of 548 K, the Kp = 0.01072.…

A: Answer: In this question solid Ammonium chloride as been put into a vessel and its thermal…

Q: The solubility product constant, Ksp, at 25°C for AgI(s) in water has the value 8.3 × 10–17.…

Question

Express the equilibrium constant for the following reaction:
2 CH2CI2 (g) + Cl2 (9) =2 CHCI3 + H2 (g)
[CHCI3}[H2]
[CHCI,}[Cl,]
[CHCI2][CI2]
k =
[CHCI3][H2]
[CHCI3][H2]
k =
[CHCI,][Cl2]
[CHCI,[Cl,]
[CHCI3]°[H2]
[CHCI3]?{H2]
Ok=
[CHCI,j!/?{Cl,]

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization: 2VCl4V2Cl8 When 6.6834 g VCl4. is dissolved in 100.0 g carbon tetrachloride, the freezing point is lowered by 5.97C. Calculate the value of the equilibrium constant for the dimerization of VCl4 at this temperature. (The density of the equilibrium mixture is 1.696 g/cm3, and Kf = 29.8C kg/mol for CCl4.)
Express the equilibrium constant for this reaction: 2 NH3(g) <=> N2(g) + 3 H2(g) K = [NH3]2 / ([NH3]2 x [N2]) K = ([NH3]2 x [N2]) / [H2]3 K = ([N2] x [H2]3) / [NH3]2
Calculate the equilibrium constant for the reaction CH4(g)+ NH3(g)⇌HCN(g) + 3H2(g) given: N2(g) + 3H2(g)⇌2NH3(g) K1= 1.01 C(g)+ 2H2(g) ⇌CH4(g) K2= 2.05 H2(g)+ 2C(g)+ N2(g)⇌2HCN(g) K3= 4.07
Given the equilibrium constant valuesN2(g)+1/2O2(g)⇌N2O(g) KC=2.7×10−18 N2O4(g)⇌2NO2(g) KC=4.6×10−3 1/2N2(g)+O2(g)⇌NO2(g) KC=4.1×10−9 Determine a value of KC for the reaction: 2N2O(g)+3O2(g)⇌2N2O4(g)
A reaction mixture that consisted of 0.20 mol N2(g) and 0.20 mol H2(g) was introduced into a reactor of volume 25.0 L and heated. At equilibrium, 5.0% of the nitrogen gas had reacted. What is the value of the equilibrium constant KC for the reaction N2(g) + 3H2(g) ⇋ 2 NH3(g) at this temperature?
Write the equilibrium constant expression (Kc) for the reaction below 2P2O5(g) + 10Cl2(g) ⇌ 4PCl5(aq) + 5O2(g)
What is the equilibrium constant for 2 C2H4(g) + 2 H2O(g) ⇌ 2 C2H6(g) + O2(g), Is it Heterogenous or Homogenous?
1.1The Ksp of Ca3 (PO4 ) 2 is 1.3 × 10−26 . Estimate the solubility of this salt in units of g. L −1 . You must show any reaction equation(s) that you may think are necessary. 1.2 If a sample of solid Ca3(PO4)2 is stirred into exactly one litre of a 0.550M solution of Na3PO4, how will the solubility of the salt compare with the answer that you have obtained in question 1.1? Explain you answer in a short sentence.
A. Determine the value of the equilibrium constant, Kgoal for the reaction CO2(g)⇌C(s)+O2(g)CO2(g)⇌C(s)+O2(g), Kgoal=? by making use of the following information: 1. 2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g)2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g), K1 = K1 = 5.40×10−165.40×10−16 2. 2H2(g)+O2(g)⇌2H2O(l)2H2(g)+O2(g)⇌2H2O(l), K2 = K2 = 1.06×10101.06×1010 3. CH3COOH(l)⇌2C(s)+2H2(g)+O2(g)CH3COOH(l)⇌2C(s)+2H2(g)+O2(g), K3 = K3 = 2.68×10−92.68×10−9 Express your answer numerically. B. Determine the equilibrium constant, Kgoal for the reaction 4PCl5(g)⇌P4(s)+10Cl2(g), Kgoal=?4PCl5(g)⇌P4(s)+10Cl2(g), Kgoal=? by making use of the following information: P4(s)+6Cl2(g)⇌4PCl3(g), K1=2.00×1019P4(s)+6Cl2(g)⇌4PCl3(g), K1=2.00×1019 PCl5(g)⇌PCl3(g)+Cl2(g), K2=1.13×10−2PCl5(g)⇌PCl3(g)+Cl2(g), K2=1.13×10−2 Express your answer numerically.
Calculate the KC for the reaction N2 (g) + 3H2 (g) ⇌ 2NH3 (g) at 773.15 K if the KP = 1.5 x 10 - 5 at this temperature.
Write the expression for Kc for the following reactions. Ineach case indicate whether the reaction is homogeneousor heterogeneous.(a) 3 NO(g) ⇌ N2O(g) + NO2(g)(b) CH4(g) + 2 H2S(g) ⇌ CS2(g) + 4 H2(g)(c) Ni(CO)4(g) ⇌ Ni(s)+ 4 CO(g)(d) HF(aq) ⇌ H+(aq) + F-(aq)(e) 2 Ag(s) + Zn2+(aq) ⇌ 2 Ag+(aq) + Zn(s)(f) H2O(l) ⇌ H+(aq) + OH-(aq)(g) 2 H2O(l) ⇌ 2 H+(aq) + 2 OH-(aq)
Write the equilibrium constant for the reaction CH4(g) + 3 Cl2(g) ⇋ CHCl3(l) + 3 HCl(g), with the gases treated as perfect.