For the equation below at equilibrium, what is the shift in the equilibrium position upon adding ammonium thiocyanate and what is the color of resulting solution? FeCl. (aq) + NH.SCN(aq) = NH.CI (aq) + Fe(SCN)CI (aq) forward/pale yellow backward/red orange forward/red orange backward/pale yellow Which of the following will result to the formation of a deep red solution. FeCl. (aq) + NH.SCN(aq) = NH.CI (aq) + Fe(SCN)CI (aq) removal of ferric chloride removal of ammonium thiocyanate addition of ammonium thiocyanate O addition of ammonium chloride

For the equation below at equilibrium, what is the shift in the equilibrium position upon adding ammonium thiocyanate and what is the color of resulting solution? FeCl. (aq) + NH.SCN(aq) = NH.CI (aq) + Fe(SCN)CI (aq) forward/pale yellow backward/red orange forward/red orange backward/pale yellow Which of the following will result to the formation of a deep red solution. FeCl. (aq) + NH.SCN(aq) = NH.CI (aq) + Fe(SCN)CI (aq) removal of ferric chloride removal of ammonium thiocyanate addition of ammonium thiocyanate O addition of ammonium chloride

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter15: Complex Ion And Precipitation Equilibria

Section: Chapter Questions

Problem 71QAP: Consider the equilibrium curve for AgCl shown below. Which of the following statements about a...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
Consider the equilibrium curve for AgCl shown below. Which of the following statements about a solution at point A on the curve are true? (a) The solution is saturated and at equilibrium. (b) Addition of NaCl increases the concentration of Cl- in solution. (c) Addition of NaCl increases the concentration of in solution. (d) Addition of Ag+ results in the precipitation of AgCl. (e) Addition of solid NaNO3 to the solution without change in volume does not change [Ag+] or [Cl-].
A solution is formed by mixing 50.0 mL of 10.0 M NaX with 50.0 mL of 2.0 103 M CuNO3. Assume that Cu+ forms complex ions with X as follows: Cu+(aq)+X(aq)CuX(aq)K1=1.0102CuX(aq)+X(aq)CuX2(aq)K2=1.0104CuX2(aq)+X(aq)CuX32(aq)K3=1.0103 with an overall reaction Cu+(aq)+3X(aq)CuX32(aq)K=1.0109 Calculate the following concentrations at equilibrium. a. Cux32 b. CuX2 c. Cu+
How is the strength of an acid related to the position of its ionization equilibrium? Write the equations for the dissociation (ionization) of HCI, HNO3, and HClO4in water. Since all these acids are strong acids, what does this indicate about the basicity of the Cl-, NO3, and ClO4ions? Are aqueous solutions of NaCl, NaNO3, or NaClO4basic?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
. Lead(II) chloride, PbCl2(s), dissolves in water to the extent of approximately 3.6102Mat 20 °C. Calculate Kspfor PbCl2(s), and calculate its solubility in grams per liter.
Which of the systems described in Exercise 13.15 give homogeneous equilibria? Which give heterogeneous equilibria?
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.