For the following chemical equilibrium: Zn2*(aq) + 4NH3(aq)Zn(NH3)42*(aq), the equilibrium constant (Kf) was experimentallydetermined to be 2.9 x 10°. If the initial concelèrations of Zn(NO3)2(aq)and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is theequilibrium concentration of Zn2*(aq)?O 7.8 x 10 12 MO 4.7 x 10-11 MO 1.5 x 10-8 MO 2.5 x 109 MO 2.9 x 10° M

Based on the question we have given data as follows -

For the following chemical equilibrium: Zn2*(aq) + 4NH3(aq) Zn(NH3)42*(aq), the equilibrium constant (Kf) was experimentally determined to be 2.9 x 10°. If the initial concelerations of Zn(NO3)2(aq) and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is the equilibrium concentration of Zn2*(aq)? O 7.8 x 10 12 M O 4.7 x 10-11M O 1.5 x 10-8 M O 2.5 x 109 M O 2.9 x 10° M

For the following chemical equilibrium: Zn2(aq) + 4NH3(aq) Zn(NH3)42(aq), the equilibrium constant (Kf) was experimentally determined to be 2.9 x 10°. If the initial concelerations of Zn(NO3)2(aq) and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is the equilibrium concentration of Zn2*(aq)? O 7.8 x 10 12 M O 4.7 x 10-11M O 1.5 x 10-8 M O 2.5 x 109 M O 2.9 x 10° M

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter17: Equilibrium

Section: Chapter Questions

Problem 105AP

See similar textbooks

Similar questions

In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
At a certain temperature, the reaction Xe(g)+2F2(g)XeF4(g)gives a 50.0% yield of XeF4, starting with Xe(Pxe=0.20atm) and F2(PF2=0.40atm). Calculate K at this temperature. What must the initial pressure of F2 be to convert 75.0% of the xenon to XeF4?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?
The initial concentrations or pressures of reactants and products are given for each of the following systems. Calculate the reaction quotient and determine the direction] in which each system will proceed to leach equilibrium. (a) 2NH3(g)N2(g)+3H2(g) Kc=17;[NH3]=0.20M,[N2]=1.00M,[H2]=1.00M (b) 2NH3(g)N2(g)+3H2(g) Kp=6.8104 initial pressures NH3=3.0atm,N2=2.0atm,H2=1.0atm (c) 2SO3(g)2SO2(g)+O2(g) Kc=0.230;[SO3]=0.00M,[SO2]=1.00M,[O2]=1.00M (d) 2SO3(g)2SO2(g)+O2(g) Kp=16.5 initial pressures SO3=1.00atm,SO2=1.00atm,O2=1.00atm (e) 2NO(g)+CI2(g)2NOCI(g) Kc=4.6104;[NO]=1.00M,[CI2]=1.00M,[NOCI]=0M (f) N2(g)+O2(g)2NO(g) Kp=0.050 initial pressures NO=1.00atm,N2=O2=5atm
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
. Gaseous phosphorus pentachloride decomposes according to the reaction PCl5(g)PCl3(g)+Cl2(g)The equilibrium system was analyzed at a particular temperature, and the concentrations of the substances present were determined to be [PCl5]=1.1102M,[PCl3]=0.325M. and [Cl2]=3.9103M. Calculate the value of K for the reaction.