For the following reaction, 6.76 grams of chlorine gas are mixed with excess bromine. The reaction ylelds 20.0 grams of bromine monochloride . bromine (g) + chlorine ( g) bromine monochloride (g) What is the theoretical yleld of bromine monochloride ? grams What is the percent yield for this reaction ?

For the following reaction, 6.76 grams of chlorine gas are mixed with excess bromine. The reaction ylelds 20.0 grams of bromine monochloride . bromine (g) + chlorine ( g) bromine monochloride (g) What is the theoretical yleld of bromine monochloride ? grams What is the percent yield for this reaction ?

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 56A

See similar textbooks

Similar questions

In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.