Gaseous ethane (CH,CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). Suppose 6.9 g of ethane is mixed with 48.2 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. 圖 dl

Gaseous ethane (CH,CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). Suppose 6.9 g of ethane is mixed with 48.2 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. 圖 dl

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 20CR: Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous...

See similar textbooks

Similar questions

The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
A dark brown binary compound contains oxygen and ametal. It is 13.38% oxygen by mass. Heating it moderatelydrives off some of the oxygen and gives a red binary compoundthat is 9.334% oxygen by mass. Strong heatingdrives off more oxygen and gives still another binary compound,which is only 7.168% oxygen by mass. (a) Compute the mass of oxygen that is combined with1.000 g of the metal in each of these three oxides. (b) Assume that the empirical formula of the first compoundis MO2 (where M representsthe metal). Givethe empirical formulas of the second and thirdcompounds. (c) Name the metal.
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
A sample of an oxide of vanadium weighing 4.589 g was heated with hydrogen gas to form water and another oxide of vanadium weighing 3.782 g. The second oxide was treated further with hydrogen until only 2.573 g of vanadium metal remained. (a) What are the simplest formulas of the two oxides? (b) What is the total mass of water formed in the successive reactions?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Given that the molar mass of carbon tetrachloride, CCl4 , is 153 g, calculate the mass in grams of 1 molecule of CCl4 .
Nitrogen reacts with hydrogen to form ammonia. Represent each nitrogen atom by a square and each hydrogen atom with a circle. Starting with five molecules of both hydrogen and nitrogen, show pictorially what you have after the reaction is complete.