Gaseous ethane (CH;CH3) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 31.9 g of water is produced from the reaction of 21.65 g of ethane and 138.7 g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

Gaseous ethane (CH;CH3) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 31.9 g of water is produced from the reaction of 21.65 g of ethane and 138.7 g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter7: Chemical Reactions: An Introduction

Section: Chapter Questions

Problem 47A

See similar textbooks

Similar questions

When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
The element magnesium reacts with the element oxygen to form a white solid compound, magnesium oxide. When a sample of magnesium that weighs 24.30 g reacts with oxygen, it is found that the magnesium oxide produced weighs exactly 40.30 g. (a) Calculate the mass of oxygen in the magnesium oxide. (b) Calculate the mass of magnesium oxide that could be produced from 40.0 g magnesium.
Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. If 4.48g of water is produced from the reaction of 4.31gof hexane and 21.4g of oxygen gas, calculate the percent yield of water.Be sure your answer has the correct number of significant digits in it