H₂O₂ + KMnO4 + H₂SO4 O₂ + MnSO4 + K₂SO4+H₂O 1. How many moles of the oxidized product is formed in the reaction? 2. How many electrons does the reducing agent loss?

Q: Balance the following redox reaction in acidic aqueous solution: 2I-(aq) + Cr2O72-(aq) -> I2(s) +…

A: 2I-aq+Cr2O7-2aq→I2s+2Cr+3aq   stepI   split the equation in to half reaction…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Write the balanced REDUCTION half reaction. MnO4- + Mg → Mg2+ + Mn2+ The oxidation-reduction…

Q: Which species is oxidized and which is reduced? 1.)  Fe(s) + 2Ag^+(aq)-->Fe^2+(aq) + 2Ag(s)  2.)…

A: The species whose oxidation number increases is oxidized.  The species whose oxidation number…

Q: he following oxidation-reduction reaction.  Identify the oxidizing and reducing agents.   What are…

A: Redox reactions involve the oxidation and reduction processes in a single reaction. Oxisisng agent…

Q: Please balance using the half reaction method MnS + HCl + HNO3 è  MnCl2 +  NO +  S +  H2O HMnO4+…

A: Balancing via half balance method include- Step 1: Write the unbalanced ionic equation. Step 2:…

Q: If a redox reaction occured with the 2 redox couples provided below, which species would be the…

A:

Q: IuMITYIV VIIVIVV yuvUIVII Balance the following oxidation-reduction reaction in basic solution. What…

A: In the above reaction Ag is converting to Ag+ in Ag(CN)2- and O2 will convert to OH-  Hence the…

Q: + 1.14 V TI Pt Cr3+ (1 M) Cr2+ (1 M) T13+ (1 M) T13+ (aq) + 3e- → TI (s) Cr2+ (aq) → Cr3+ (aq) + e-…

A: An electrochemical cell possesses cathode and anode. A cathode is a metal electrode which is…

Q: 6,One of the steps in balancing redox reaction in acidic solution is adding ________________ to…

A: Redox reaction A reaction in which oxidation and reduction takes place simultaneously is called a…

Q: Consider the following reductions. Cu+(aq) +  e- ⟶⟶ Cu(s)                                     Eored…

A: Oxidizing agent:-  It is a substance that oxidizes other substances and gets reduced by itself.…

Q: In the following reaction identify : 2K  + MgCl2 ⟶⟶ 2KCl + Mg What is oxidized? What is reduced?…

A: In redox reaction oxidation and reduction takes place simultaneously in chemical reaction.

Q: What is the coefficient of Br2 if KMnO4 + KBr  +  H2SO4  → MnSO4  +  Br2  +  K2SO4  +  H2O is…

A: Given,  a. What is the coefficient of Br2 if KMnO4 + KBr  +  H2SO4  → MnSO4  +  Br2  +  K2SO4  +…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: We have to predict the balanced reduction half reaction.

Q: In the reaction below, determine the oxidation states for each element in the reactants and…

A: Oxidation states of an element helps to identify whether the element is being oxidized (by removing…

Q: 1. Using the half reactions shown below, determine the balanced net reaction, E° for the net…

A:

Q: H₂O₂ + KMnO4 + H₂SO4 O₂ + MnSO4 + K₂SO4+H₂O 1. How many moles of the oxidized product is formed in…

A:

Q: Part VI. Balance the following oxidation reduction reactions by oxidation number method. 1. NO2 + H2…

A:

Q: following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced…

A: NOTE : according to the policies, we can only answer first 3 subparts of a question at one time. you…

Q: solution containing Fe2+ requires 26 mL of  0.0265 M K2Cr2O7  in acidic solution.   Balance the…

A: When potassium dichromate oxidise iron in presence of acid, then Iron (II) is changed to iron (III)…

Q: 3. Assign oxidation states for all atoms in each of the following compounds a. H3ASO3 b. SbF6 c.…

A: Oxidation state or oxidation number is the degree of oxidation (or loss of electron) of an atom in a…

Q: Which spedies species being reduced and which is the reducing agent in the following redox reaction?…

A: Applying concept of oxidation and reduction.

Q: FeCl3 + SO2 + H20 → FeCl2 + HCI + H2SO4

A: 1) Oxidizing agent: The substance which accepts electron and oxidise other other substance and get…

Q: for each of the following elements find the best oxidizer and the best reducer: a) Sn2 + or Pb2 + b)…

A:

Q: Which species is the best reducing agent?   E° (V) S2O62-(aq)  +  4 H+(aq)  +  2 e−   ➝   2…

A: Reducing agent are those species which can reduced others and oxidised itself by losing electrons.…

Q: Given the reaction,         Fe + MnO 4 - → FeO 4 -2 + Mn +4   a)  How many moles of the…

A:

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: HURRY ASAP I WILL RATE NO NEED FOR EXPLANATION WHICH OPTIN  Which oxidizing agent do you use to…

A: Using oxidising agent responsible for alcohol to carboxylic acid.

Q: What volume of 0.0300 M KMNO4 is required to react in acid solution with 5.00 mL of H2O2 that has a…

A: Given,  The volume of 0.0300 M KMNO4 is: required to react in acid solution with 5.00 mL of H2O2…

Q: Which species in each pair is a better oxidizing agent under standard state conditions. Explain your…

A: Better oxidizing agent means it should have greater +ve value or less -ve value of reduction…

Q: Based on the reactions below, which is the stongest reducing agent? +1.22 V MnO2(s) + 4H+(aq) + 2e-…

A: Reducing agent is the species which reduces others species and oxidises itself. Oxidising agent is…

Q: How to determine the factor of reducing agent and oxidizing agent: a. Fe b. HNO3 c. KMNO4 + LICI +…

A:

Q: 1. Write balanced equations for the following oxidation and reduction reactions: 15211 (d) Mn2+ to…

A:

Q: Would you use an oxidizing agent or reducing agent in order for the following reactions to occur? a.…

A: Oxidizing Agent:- A species which oxidizes other species is called Oxidizing Agent. Reducing Agent:-…

Q: How much anhydrous stannous chloride (189.61 g/mol) is needed to completely reduce 1.050 g iron  ore…

A: The question is based on the concept of quantity estimation . we have to calculate how much stannous…

Q: Fe3*(aq) + e¯ → MnO4°(aq) + 8 H*(aq) + 5e¯ → Zn2*(aq) + 2e¯ → Zn(s) Br2(t)+ 2e¯ –→ Fe2*( aq) E° =…

A: Here, Reduction potentials are given. More the reduction potential means easy to reduce. Reducing…

Q: Fill in the blanks for the balanced half reactions below in acidic solution: S2O82- + NO ⟶ SO42- +…

A: Divide the skeleton equation into half-reactions. S2O82- ⟶ SO42- NO ⟶NO3- Balance the atoms other…

Q: Match the chemical formula with its associated oxidation number of sulfur (S).…

A:

Q: Circle the oxidizing agents and underline the reducing agents in the following reactions. a. 2C +…

A: We have to tell about the oxidising agent and reducing agent in given reactions.

Q: presented by Macmillan Learning The quantity of antimony in a sample can be determined by an…

A: Sb3+ reacts with bromate in 1:3 mole ratio i.e. 3 mol bromate ion reacts with 1 mol Sb3+.

Q: Consider the following unbalanced reaction: MnO4-(aq) + C2O42-(aq) → MnO2(s) + CO32-(aq) 1.Enter…

A: 1. Let the oxidation state of Mn in MnO4- be x Thus, x + 4(-2) = -1 So, x = +7 Hence, the oxidation…

Q: If a redox reaction occured with the 2 redox couples provided below, which species would be the…

A: We have two reduction reaction , we have to identify species acting as oxidising agent.

Q: Explain why the following reaction is a REDOXreaction.  H2O2  → MnO2 +  H2O ii.List the species…

A:

Q: Balance the reaction below using the change in oxidation number method. Show complete solutions…

A: In the oxidation number method, the oxidation number are assigned to the atoms and depending upon…

Q: List each species that is being oxidized and reduced and the reducing and oxidizing agents in the…

A: Redox reactions are the combination of reduction and oxidation reactions. The type of reaction in…

Q: Number 1

A: A reduction reaction involves gain of electron/s. Due to gaining of electron/s, the oxidation number…

Q: Which is more reducing, a solution with 20 mM sufide (HS-; assume S0 as product of sulfide…

A: Reducing agents are those species that undergo oxidation, while the oxidizing agent is those species…

Q: Formaldehyde (CH2O) reacts with potassium permanganate (KMnO4) under neutral conditions to form…

A: The detailed solution of your question given below-- Since, we know that the Oxidising agent is…

Q: Which of the following is the strongest oxidizing agent?   MnO4– + 4H+ + 3e– → MnO2 + 2H2O   ε° =…

A: Oxidising agent is the species which gains electrons in the reaction. The strongest oxidising agent…

Q: Balance the reactions below using the change in oxidation number method.  Sn2+ + VO43- + H+ → Sn4+…

A: The chemical reactions in which gain of electron(reduction) and loss of electron (oxidation) occur…

Q: Identify the atoms that are oxidized and reduced, the change in oxidation state for each, and the…

A: