In the following reaction identify : 2K  + MgCl2 ⟶⟶ 2KCl + Mg What is oxidized? What is reduced? What is oxidizing agent? What is reducing agent? Determine oxidation state for Mg and Cl in MgCl2? Detemine oxidation stae for K and Cl in KCl?

Q: oxidation state of carbon in C5O2?

A:

Q: How many mg/m3 is a 6% concentration of CO2.  MW = C= 12  +  O+O = 16+16  at NTP

A: 6% means 6 gm solvent  in 100 ml solution

Q: he following oxidation-reduction reaction.  Identify the oxidizing and reducing agents.   What are…

A: Redox reactions involve the oxidation and reduction processes in a single reaction. Oxisisng agent…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A:

Q: Given the chemical equation:  4KO2 (s) + 2CO2 (g) > 2K2CO3 (s) + 3O2 (g) Indicate the oxidation…

A:

Q: 5.What

A: 1) Oxidation number of Rb = +1  2) Oxidation number of O = -2  3) Oxidation number of Tc = Findout…

Q: Identify the oxidizing agent and the reducing agent in the following reaction: Cr2O3(s) + Al(s) >…

A:

Q: MnO4- + 2CHCl3 → 3Cl2 + 2CO2 + Mn2+ which is reduced and which is oxidized?

A: The species which loses electrons (or increase in oxidation state) in a chemical reaction is termed…

Q: 23. What is the charge (oxidation state) of the cation in Hg20 (mercurous oxide)? 24. What is the…

A: Mercurous oxide has formula Hg2O and it is an inorganic oxide containing zero overall charge.…

Q: Assign an oxidation state to each atom in each compound. a) CH4 b) CH2CI2 c) CuCI2 d) HI

A: a) Since C is more electronegative than H  Hence the electron of each H will be near C Hence C will…

Q: What is the enthalpy when 65.0 g of Cu2O is oxidized to CuO? 2 Cu2O(s) + O2(g) --> 4 CuO dH = -288…

A:

Q: 1. Which two species will be able to oxidize Pb(s)?    Co³⁺ and Ce³⁺    Ca and Cr    Cd²⁺ and Cl₂…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 16.7 mL of 0.15 N KMnO4 solution was added to completely oxidize the sodium oxalate in a 0.50 g…

A: Given that -  Volume of KMnO4 solution = 16.7 mL  Normality of KMnO4 Solution = 0.15 N  Mass of…

Q: H₂O₂ + KMnO4 + H₂SO4 O₂ + MnSO4 + K₂SO4+H₂O 1. How many moles of the oxidized product is formed in…

A:

Q: The chemical equation for a reaction between KMnO4 and HCl is shown. 2KMnO4 + 16HCl → 2MnCl2 + 5Cl2…

A: 2KMnO4 + 16HCl → 2MnCl2 + 5Cl2 + 2KCl + 8H2O Reducing Agent is an element or compound that loses an…

Q: Identify whether the process is oxidation or reduction. Indicate the number of eled gained per mole…

A: Identify the reaction is ocmxidation or reduction and indicate how many electron gain per mole of…

Q: Identify the atoms that are oxidized and reduced, the change in oxidation state for each, and the…

A: Interpretation -  To Identify the atoms that are oxidized and reduced, the change in oxidation state…

Q: 1. You are studying the reaction N2(g) + 3H2(g) → 2NH3(g) What is AG° for this reaction? When the…

A: The reaction Gibbs free energy value can be explained as the type of the energy which is linked with…

Q: Based on the equation below, which is correct? 2 C2H2(g)  +  5 O2(g)  →  4 CO2(g)  +  2 H2O(g)…

A: The electronegativity trend of oxygen carbon and hydrogen is  O>C>H In C2H2, hydrogen…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A:

Q: Predict the Product and balance the following reaction, including physical state.…

A: Fe(C2H3O2)2(aq)+Li2S(aq)=Fes(aq)+2HC2H3O2

Q: Adding an oxidation state to each element in each reaction and use the change in oxidation state to…

A:

Q: Question attached

A: Given: The first balanced reaction is, 2ClFg+O2g→Cl2Og+OF2g        ∆H°=167.5 kJ......(1) The second…

Q: Given the reaction,         Fe + MnO 4 - → FeO 4 -2 + Mn +4   a)  How many moles of the…

A:

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: was dissolved and the manganese present was converted to MnO4– (aq). Water was then added to give a…

A:

Q: 1. What is the oxidation number of S in each of the following substances? • H₂S SO3 H₂SO4 • SO₂ • ●…

A: Since you have asked multiple type questions, we will solve only first  questions for you. If you…

Q: assign oxidation states to each element in the following reaction. specifically identify which…

A:

Q: Potassium manganate, K2MnO4, is a green-colored crystal that serves as an intermediate in the…

A:

Q: In the following reaction determine the change, if any, in the oxidation number of sulfur and…

A: Rules for assigning oxidation number: • Oxidation number of atoms in pure element or Atoms in free…

Q: What is oxidized and what is reduced in the following reaction? 2Al(s) + 3Br2(g) → 2AlBr3(s)   Al…

A: From oxidation number we can easily determine the oxidation and reduction

Q: Identify the species being oxidized and reduced in the following reaction: Cr* + Sn4+- 3++Sn2+ O…

A: Oxidation process involves the loss of electrons Reduction process involves the gain of electrons

Q: Identify the atoms that are oxidized and reduced, the change in oxidation state for each, and the…

A: The oxidation states of each of the elements and compounds are as follows:- Cu →0  Since all pure…

Q: H₂O₂ + KMnO4 + H₂SO4 O₂ + MnSO4 + K₂SO4+H₂O 1. How many moles of the oxidized product is formed in…

A: An oxidizing agent is the reactant that get reduced in the reaction. It will gain electrons and…

Q: In the oxidation-reduction reaction Sna+ + 2 Fez+ →2 Fez+ + Sn2* O a. Fe3+ is reduced and Sn2+ is…

A:

Q: Which is more reducing, a solution with 20 mM sufide (HS-; assume S0 as product of sulfide…

A: A reducing agent is the species defined as the substance which oxidizes itself while reduces others.…

Q: For the following redox reaction, determine the substance that is being oxidized and the substance…

A:

Q: The following reaction may be classified as an oxidation-reduction reaction.  Which of the species…

A: An oxidation-reduction reaction is any chemical reaction in which the oxidation number of a…

Q: Given the following reaction: MnO4 (aq) + H₂C₂O4(aq) → Mn2 (aq) + CO₂(g) What is the oxidation state…

A: Given  Find the oxidation state of ech (c) in H2C2O4

Q: Identify the strongest oxidizing agent (oxidant) Cl2 (E•red = +1.35827 V) Zn (E °red -0.7618 V) Br2…

A:

Q: Explain why the following reaction is a REDOXreaction.  H2O2  → MnO2 +  H2O ii.List the species…

A:

Q: What are the oxidation states of Cu and Zn in the following reaction? What is oxidized and what is…

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: The chemical equation for a reaction between KMnO4 and HCl is shown. 2KMnO4 + 16HCl → 2MnCl2 + 5Cl2…

A: The redox reaction is given as:2 KMnO4 + 16 HCl → 2 MnCl2 + 5 Cl2 + 2 KCl + 8 H2OOxidation number of…

Q: What is oxidized in this redox reaction? KClO3 (s) → KCl (s) + O2 (g) What is the coefficient of O2…

A:

Q: Identify the reducing and oxidizing agents and determine the species that is oxidized and the…

A: Oxidising agent :Agents that oxidises others and reduced itself . Reducing agent: agents that…

Q: Which is more reducing, a solution with 20 mM sufide (HS-; assume S0 as product of sulfide…

A: Reducing agents are those species that undergo oxidation, while the oxidizing agent is those species…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: Dear student ,         since you have posted multiple questions we are allowed to solve only first…

Q: Which of the following is an oxidation-reduction reaction?   N2 + O2 → 2NO KOH + HNO3 → H2O + KNO3…

A: Which of the following is an oxidation-reduction reaction?

Q: Identify the atoms that are oxidized and reduced, the change in oxidation state for each, and the…

A:

Q: How many moles of O2 are needed to oxidize 4.51 moles of CUFES2 in the reaction 2CuFeS2 + 5O2 —-> 2…

A: The balanced Chemical equation given in the question is - 2CuFeS2 + 5O2 —-> 2Cu + 2FeO+4SO2…