How marry grams of Br, are needed to form 65.7 g of AIBr3?2 Al(s) + 3 Br) 2 AIBrz(s)Step 1: Show the strategy for solving this problem.grams AIBr3-grams Br2Answer Bankmoles Bragrams Almoles AIBr3grams AIBramoles Algrams Br,Step 2: Show the conversions required to solve this problem and calculate the grams of Brg.65.7 g AIBrz Xg BraAnswer Bank26.98 g AlI mole Al2 moles Al159.80 g Br21 mole Brz3 moles Bra266.68 g AIBrI mole AlIBr32 moles AIBr3grams of Br:g Br2 How many grams of Cl, are needed to form 83.4 g of AICI3?2 Al(s) + 3Clg) 2 AlCiz(s)Step 1: Show the strategy for solving this problem.grams AICI2grams C,Answer Bankgrams AICI,grams Almoles Clmales Algrams Cl,moles AICI3Step 2: Show the conversirequired to solve this problem and calculate the grams of Cl283.4 g AICI; x= g Cl,Answer Bank26.98 g AlI mole Al2 moles Al70.90 g Cl21 mole Cl3 moles Cla133.33 g AICI3I mole AICI32 moles AICIgrams of Clg Cl2

Since you asked multiple questions so as per Q&A guidelines of portal I solve first question…

Answered: How many grams of Br, are needed to…

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU4: Toxins: Stoichiometry, Solution Chemistry, And Acids And Bases

SectionU4.25: Mole Tunnel: Stoichiometry

Problem 3E

See similar textbooks

Similar questions

Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?
For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain quantity of each reactant is given and you are usually asked to calculate the mass of product formed. If 10.0 g of Y2 is reacted with 10.0 g of XY, outline two methods you could use to determine which reactant is limiting (runs out first) and thus determines the mass of product formed.
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Consider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.

Recommended textbooks for you

Living By Chemistry: First Edition Textbook

Chemistry

ISBN:

9781559539418

Author:

Angelica Stacy

Publisher:

MAC HIGHER

Introductory Chemistry: A Foundation

Chemistry

ISBN:

9781337399425

Author:

Steven S. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: Matter and Change

Chemistry

ISBN:

9780078746376

Author:

Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:

Glencoe/McGraw-Hill School Pub Co

Living By Chemistry: First Edition Textbook

Chemistry

ISBN:

9781559539418

Author:

Angelica Stacy

Publisher:

MAC HIGHER

Introductory Chemistry: A Foundation

Chemistry

ISBN:

9781337399425

Author:

Steven S. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: Matter and Change

Chemistry

ISBN:

9780078746376

Author:

Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:

Glencoe/McGraw-Hill School Pub Co

Chemistry: Principles and Reactions

Chemistry

ISBN:

9781305079373

Author:

William L. Masterton, Cecile N. Hurley

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS

How many grams of Br, are needed to form 65.7 g of AIBr3? 2 Al(s) + 3 Br) 2 AIBr3(a)