Answered: How many grams of the borate are formed…

Science

Chemistry

How many grams of the borate are formed when 15.0 grams of aluminum react with excess bromic acid?

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.46E

See similar textbooks

Related questions

Q: According to the following reaction, how many grams of hydrogen gas are required for the complete…

A: Interpretation: From the given reaction, how many grams of hydrogen gas are required for the…

Q: 8. Determine the limiting agent of the reaction if 100. g of acetylene gas and 200. g of oxygen gas…

Q: Based on the following equation, determine how many g of Magnesium Phosphate will be produced if you…

A: Limiting reagent is the substance that has been completely consumed when the chemical reaction is…

Q: 1.* 5.0 g of aluminum and 5.0 g of oxygen are reacted and yield the expected product. a. Write a…

A: Given,

Q: How many grams of O2 can be prepared from the thermal de composition of 4.27 kg of HgO? Name and…

A: Balance chemical equation: 2 HgO (s) --------> 2 Hg (l) + O2 (g) Moles of HgO = given…

Q: How many grams of magnesium oxide can be produced by reacting 0.248 g magnesium that is 97.5% pure…

A: Given mass of Magnesium = 0.248g% purity of Magnesium = 97.5%No.of molecules of oxygen = 5.36 x…

Q: 6. How much mass of hydrogen is produced when a half mole of aluminum reacts with excess…

Q: How many moles of water can be produced when 15.0 moles of octane, C3H18, are combusted? Oxygen is…

A: Since from the above reaction, 2 moles of octane is reacting to produce 18 moles of water Hence 1…

Q: What is the mass of the iron required to react with 4.5 g yellow sulfur solid to iron sulfide?

A: Given: The reaction is as follows: 8Fe(s) + S8 ----------> 8FeS The molar mass of Fe, = 55.85…

Q: What mass of HF is produced from the reaction of 0.81 g of H2 with excess F2?

A: H2 + F2 ==> 2HF ... balanced equation Since the question is asking us to find the mass of product…

Q: Aluminum sulfide reacts with water to form aluminum hydroxide and hydrogen sulfide. (a) Write a…

A: The chemical formula of Aluminium suffide=AL2S3The chemical formula of water=H2OThe chemical…

Q: (S) Indicate the calculation of how many grams of aluminum oxide (Al2O3) would be produced from the…

A: From the balanced reaction we can calculate the mass of reactant required and the product formed .

Q: If a chemist reacts of 5.55 g of Cl2 gas with 3.88 g of solid P4 and produced 5.15 g of solid PCl5.…

Q: How many grams of chlorine can be produced from reacting 5.60 g of titanium (IV) chloride with…

A: Chemical formula for Titanium (IV) chloride = TiCl4 Reaction between Titanium chloride and Oxygen…

Q: How many grams of Al2O3 will be produced if 2.57g Al reacts with excess O2

Q: Calculate the mass of water produced when 2.34 gg of butane reacts with excess oxygen.

A: First the given mass of butane is converted into moles as follows, Moles = Mass/Molar mass…

Q: Calculate the mass of water produced when 4.14 g of butane reacts with excess oxygen.

Q: A reaction of 15.2 grams of ferrous sulfate heptahydrate (278 g / mol) and 5 grams of ammonium…

A: Welcome to bartleby !

Q: How many grams of lead sulfide are used to produce 126 grams of lead oxide

A: Given, mass of lead oxide = 126 grams Molar mass of lead oxide = 223.2 g/mol

Q: What is the theoretical yield of sodium bromide formed from the reaction of 4.9 g of hydrobromic…

A: Given, The mass of hydrobromic acid (HBr) = 4.9g and the mass of sodium hydroxide (NaOH) = 4.4g The…

Q: How many moles of iron(III) oxide are formed by the complete oxidation of6.2 mol of iron?

A: Rusting of iron is a oxidation reaction of Fe metal to get iron(III) oxide. Here (III) represents…

Q: 5. When 10.0 g of aluminum reacts with excess oxygen it produces aluminum oxide. A) What is the…

Q: Write a balanced chemical equation for a reaction between sodium silicate and aluminum nitrate. If…

A: Given data is as follows: The mass of sodium silicate = 12.5 g The mass of aluminium nitrate = 13.3…

Q: 13 grams of titanium metal react with 60 grams of bromine. Calculate the mass(in grams) of…

A: Given, Mass of Titanium = 13 g Mass of Bromine = 60 g Molar mass of Titanium = 47.87 g/mol Molar…

Q: What is the percent yield when a reaction vessel that initially contains 64.0 kg CH4 and excess…

A: Reaction is : CH4(g) + H2O(g) -----> CO(g) + 3H2(g) 1kmol of CH4 produces = 3kmol of H2 gas

Q: (b) Reaction between carbon monoxide and hydrogen produced methanol as the only product. (i) Write a…

A: First we will write balanced chemical equation, then using stoichiometric calculations, find the…

Q: If 74.3 g of butane is burned in 132 kg of oxygen, a. Which is the limiting reagent? b. What is the…

Q: Aluminum sulfide reacts with water to form aluminumhydroxide and hydrogen sulfide. (a) Write the…

A: a. The balanced chemical equation of the above process is as follows : Al2S3 + 6H2O ------------>…

Q: 5. If 13.0grams of aluminum are reacted with 13.0grams of sulfur:a. What is the limiting reagent?b.…

A: Given data:

Q: What are the ratios needed to determine the mass of oxygen produced from the decomposition of 10…

Q: What mass of H2O is formed when H2 reacts with 284 g of O2?

Q: How many grams of aluminum sulfide are formed if 22.00g of aluminum reacts with sulfur in a…

A: Mass of Al = 22 g Mass of Al2S3 = ?

Q: How many g of H2O can be formed from 8.50 g CH4?

A: Given :- mass of CH4 = 8.50 g To calculate :- mass of H2O formed (in grams)

Q: How many grams of alum can be obtained from 25.0 g of aluminum when the reaction proceeds with 100%…

A: mass of alum is calculated by mole mole relationship (mole concept)

Q: How many moles of CSHSNH+ would be left in the beaker after the reaction goes to completion?

Q: Determine the mass of oxygen used produced when 0.64 grams of octane (C8H18)undergoing a combustion…

A: Given, Reaction for combustion of octane: 2C8H18(l) + 25O2(g)➝ 16CO2(g) + 18H2O(g) Mass of octane…

Q: 1 mole of PCI3 is isolated from the reaction of solid elemental phosphorus, P(s), with excess…

A: P (s) + Cl2 (excess) ------> PCl3 % yield = 25% 1 mole of PCl3 is isolated

Q: Metallic aluminum reacts with MnO2 at elevated temperatures to form manganese metal and aluminum…

A: The reaction between MnO2 and Al –metal is shown as: Here, MnO2 and Al react in 3:4 ratio. Given…

Q: . How many grams of hydrogen are produced when 4.9 moles of aluminum reacts with excess hydrochloric…

Q: What is the percent yield when a reaction vessel that initially contains 67.5 kg CH4 and excess…

Q: If 9.36 moles of sodium are required for a reaction, how many grams should be weighed out?

A: The term mole is generally utilized for the measurement of any specific substance's quantity that is…

Q: How many grams of hydrogen reacted with nitrogen to produce 60.3 grams of ammonia?

A: Given: Mass of ammonia (NH3) = 60.3 g and we know that the molar masses of ammonia and hydrogen gas…

Q: If 0.35g of Al reacts with excess diatomic oxygen, how many grams of the product Al2O2 are formed

A: Given, Mass of Al = 0.35 g Moles of Al can be calculated as :

Q: What is the maximum mass (in g) of ammonia that can be produced from a mixture of 1.17 ✕ 103 g N2…

A: Welcome to bartleby !

Q: what is the theoritical yield of dinitrogen pentoxide in grams if 13.2g of nitrogen reacts with…

A: Amount of nitrogen = 13.2 g Theoretical yield of dinitrogen pentoxide (N2O5) = ?

Q: 1.14 g H2 is allowed to react with 10.2 g N2 producing 1.08 g NH3 What is the percent yield for this…

Q: 2. How many grams of hydrogen are produced when 4.9 moles of aluminum reacts with excess…

Q: Calcium hydride reacts with water to form calcium hydroxideand hydrogen gas. (a) Write a balanced…

A: a. Calcium hydride reacts with water to form calcium hydroxide and hydrogen gas. The balanced…

Q: Calculate the theoretical yield: How many grams of asprin (acetylsalicylic acid) should we form in…

A: Theortical yield of asprin can be calculated with the help of nole concept. Mass form = No. Of moles…

Q: How many grams of Cl2 must be reacted with sufficient P4 in order to produce 137 g of PCI3?

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

How many grams of the borate are formed when 15.0 grams of aluminum react with
excess bromic acid?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

4.43 Magnesium nitride forms in a side reaction when magnesium metal burns in air. This reaction may also be carried out in pure nitrogen. 3Mg(s)+N2(g)Mg3N2(s) If 18.4 g of Mg3N2forms from the reaction of 20.0 g of magnesium with excess nitrogen, what is the percentage yield?
Uranium can be isolated from its ores by dissolving it as UO2( NO3)2, then separating it as solid UO2(C2O4)3H2O. Addition of 0.4031 g of sodium oxalate, Na2C2O4, to a solution containing 1.481 g of uranyl nitrate, UO2( NO3)2, yields 1.073 g of solid UO2(C2O4)3H2O. Na2C2O4+UO2( NO3)2+3H2OUO2(C2O4)3H2O+2NaNO3 Determine the limiting reactant and the percent yield of this reaction.
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
4.20 Assuming a charcoal briquette is composed entirely of carbon, what mass of oxygen is needed to completely burn a 37.3-g briquette?
4.21 Ammonium nitrate, NH4NO3, will decompose explosively to form N2, O2, and H2O, a fact that has been exploited in terrorist bombings. What mass of nitrogen is formed by the decomposition of 2.6 kg of ammonium nitrate?
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
What is the theoretical yield for a reaction, and how does this quantity depend on the limiting reactant?
What is the limiting reactant in a reaction that produces sodium chloride from 8 g of sodium and 8 g of diatomic chlorine?
When elemental copper is placed in a solution of silver nitrate, the following oxidationreduction reaction takes place. Forming elemental silver: :math>Cu(s)+2AgNO3(aq)Cu(NO3)2(aq)+2Ag(s) at mass of copper is required to remove all the silver from a silver nitrate solution containing 1.95 mg of silver nitrate?
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
4.30 Copper reacts with nitric acid via the following equation: 3Cu(s)+8HNO3(aq)3Cu( NO3)2(aq)+2NO(g)+4H2O(l) What mass of NO(g) can be formed when 10.0 g of Cu reacts with 115 g of HNO3?