Answered: In the following equation, write a…

In the following equation, write a conversion factor (mole ratio) that can be used for converting between moles of H2 and moles of NH3: 2N2 + 3H2 → 2NH3 moles of moles of

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 4A

See similar textbooks

Related questions

Q: Solid sodium nitrate can be decomposed to solid sodium nitrite and oxygen gas. If the percentage…

Q: Plants convert carbon dioxide and water to glucose (C6H12O6)(C6H12O6) and oxygen in the process of…

A: The balanced chemical reaction is: 6CO2 + 6 H2O -------->…

Q: The illustration to the left represents a mixture of oxygen ( red ) and fluorine ( green )…

Q: According to the following reaction, how many moles of bromine trifluoride are necessary to form…

Q: What does it mean when the percent yield is about the same amount as the theoretical yield?

A: Percentage yield : Percentage yield is the ratio of actual yield to the theoretical yield ie.…

Q: Now that you have moles of CaO, determine how many grams of product he should have found in the end…

A: Given: Moles of CaO = 0.05 moles To find: The mass of CaO

Q: Consider the following unbalanced equation: ___ Al4C3 + ___ H2O…

A: The balanced equation is Al4C3 + 12 H2O ------> 4 Al(OH)3 + 3 CH4 From the balanced equation…

Q: For the Balanced chemical equation: SiH4 + 2 O2 SiO2 + 2 H2O 0.0283 moles of SiH4 will yield…

A: Interpretation - To determine the moles of H2O when for a given balance reaction SiH4 + 2O2 →SiO2…

Q: Gold metal reacts with a combination of nitric acid and hydrochloric acid according to this…

Q: Butane, C4H10C4H10, reacts with oxygen, O2O2, to form water, H2OH2O, and carbon dioxide, CO2CO2, as…

A: The molar mass of butane (C4H10) can be calculated by adding the mass of the atoms present in its…

Q: Attached is an example of mole ratio's from my chemistry class. Could you explain the break down of…

A: We have the reaction 2H2 + O2 ---> 2H2O Here we can see that we need 2 H2 molecules to react with…

Q: For the following reaction, 0.284 moles of zinc oxide are mixed with 0.586 moles of water. What…

A: Moles of ZnO : 0.284 moles Moles of H2O : 0.586 moles

Q: For the following reaction, 0.173 moles of nitrogen gas are mixed with 0.453 moles of hydrogen gas.…

A: Given,

Q: Determine the number of grams of carbon dioxide produced when 1 gallon of octane reacts with excess…

A: So, 1 gallon of octane will produce 9939.69 grams of CO2 gas.

Q: For the following reaction, 0.271 moles of nitrogen gas are mixed with 0.565 moles of hydrogen gas.…

A: To find limitng reagent mole-mole analysis is applied on balanced chemical reaction.

Q: Consider the following balanced equation.…

A: Consider the given balanced equation as followed: 2N2H4g+N2O4g→3N2g+4H2Og From the balanced…

Q: Consider the decomposition of red calx of mercury (HgO) into its elements as follows: 2 HgO --> 2 Hg…

A: This question is related to stoichiometry which determines the quantitative relationship between the…

Q: Solid chromium reacts with oxygen gas to produce chromium (III) oxide. Write the balanced chemical…

A: Here solid chromium, Cr(s) react with oxygen gas,O2(g) to produce chromium(III) oxide, Cr2O3(s)

Q: How many moles of NH3 are present in this equation?

A: The given reaction is; 2NH3 + 3CuO → 3Cu + 3H2O + N2 Here, copper, water, and nitrogen are formed as…

Q: Butane, C4H10C4H10, reacts with oxygen, O2O2, to form water, H2OH2O, and carbon dioxide, CO2CO2, as…

Q: When nitrogen monoxide reacts with hydrogen, nitrogen and water are produced. The balanced equation…

A: The balanced equation of the reaction is given as,The mole ratio between reactant NO and H2 is…

Q: Describe one reason the percent yield of a reaction would be less than 100% and one reason it would…

A: For a reaction % yield = Actual yield/theoretical yield X 100

Q: 2. C,H,,0; + 6CO,– 6H,0 + 60, a) CH,0̟ to 0, b) o, to Co, c) H,0 to CO,

A: C6H12O6 + 6CO2 -----> 6H2O + 6O2 1mole 6mole 6mole 6mole

Q: Butane, C4H10C4H10, reacts with oxygen, O2O2, to form water, H2OH2O, and carbon dioxide, CO2CO2, as…

A: We have to calculate the mass of water produced. Mass of butane needed.

Q: What are the two conversion factors (mole ratios) that can be used for converting between moles of…

A: 6Li(s) + N2(g) ------> 2Li3N(s) 6 moles of Li reacting with 1 mole of N2 produces 2 moles of…

Q: Using the formula CO2(g)+4H2(g)→CH4(g)+2H2O(g) How many moles of methane are produced when 71.1…

A: Given, 71.1mol CO2

Q: Butane, C4H10C4H10, reacts with oxygen, O2O2, to form water, H2OH2O, and carbon dioxide, CO2CO2, as…

A: Given, Mass of butane = 9.81g

Q: Differentiate actual yield and theoretical yield? and what are the significance in stoichiometry?

A: % Yield= Actual yieldTheoretical yield×100

Q: If 2.25 mol of HCl is reacted with excess Gallium, according to the following equation, : 2Ga + 6HCl…

A: The balanced reaction taking place is given as, => 2 Ga + 6 HCl -------> 2 GaCl3 + 3 H2

Q: The percent yield is calculated by dividing the actual yield by the theoretical yield times 100.…

A: Welcome to bartleby !

Q: For the following reaction, 0.398 moles of phosphorus (P4) are mixed with 0.512 moles of chlorine…

A: Dear student , since you have posted multiple questions we are allowed to solve only first question…

Q: chemical stoichiometry, determine the number of moles of carbonic acid that can be produced from 3…

A: According to the reaction, 1 mole of NaHCO3 is reaction with 1 mole of HCl. Therefore, 3 moles of…

Q: Phosphorus pentachloride can be produced by reacting phosphorus trichloride and chlorine gas. What…

A: Given, % yield of the reaction = 84.8 % Observed yield of phosphorus pentachloride (PCl5) = 127 g…

Q: I am having trouble with conversion factors. Can anyone tell me how to set these up? Atoms to Moles…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: Consider the reaction represented by the (unbalanced) equation: N2(g) + H2(g)→NH3(g) Determine the…

A: Balanced chemical equation- N2(g) +3H2(g)→2NH3(g)

Q: Begin your calculation by determining which reactant is limiting, Mg or HCl, based on the amounts…

A: The reactant that is completely consumed during a chemical reaction is the limiting reactant in that…

Q: Nitrogen dioxide is produced by combustion in an automobile engine. For the following reaction,…

A: A limiting reagent is the reactant that is consumed completely during reaction. To find the limiting…

Q: How many moles of H₂O can be formed from 1.11 × 10²³ molecules of NH₃ from the following equation? 4…

A: We will use stoichiometry of the reaction

Q: Consider the following equation: 6CO2 + 6H2O → C6H12O6 +

A: Equation based calculation is called stoichiometry Given reaction is 6 CO2 + 6 H2O → C6H12O6 + 6…

Q: The following are true about limiting reactant except: A It limits the quantity of product being…

A: Given: to identify the incorrect statement about the limiting reactant.

Q: A compound containing only carbon, hydrogen, and oxygen is analyzed using combustion analysis. When…

Q: which is the limiting reactant between 0.0784 moles of CuSO4 and 0.0268 moles of Fe

A: First determine the reaction between CuSO4 and Fe. Fes + CuSO4aq →FeSO4aq + Cus

Q: The following chemical reaction has helped to shape the Earth's crust: 3 SiO2(s) + 2 Fe3O4(s) →3…

Q: Given the balanced equation Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O, provide the proper mole ratio for…

A: The balanced chemical equation is given below.

Q: Pentane (C5H12) undergoes complete combustion in the presence of excess oxygen gas as shown in the…

A: The number of moles of carbon dioxide formed is given below

Q: How many grams of NaCl should be produced if you start with 1.0 g of sodium bicarbonate. This…

A: Moles is defined as Mass of compoud divided by it's molar Mass. Molar mass of NaHCO3 = 84.007g/mol…

Q: Using the balanced chemical equation, determine how many moles of NaClNaCl will be produced, if…

Q: For a theoretical yield of 5 g and percent yield of 53.7015%, calculate the actual yield for a…

A: Given :- Theoretical yield = 5 g Percent yield = 53.7015% To calculate :- Actual yield (in g)

Q: 2NO(g) + 0,g) - 2NO, (3) In one experiment, 0.861 mol of NO is mixed with 0.500 mol of O,. Determine…

A: Given :- 2NO(g) + O2(g) -----> 2NO2(g) Number of moles of NO = 0.861 mol Number of moles of…

Q: Converting between quantities To convert from a given quantity of one reactant or product to the…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

In the following equation, write a conversion factor (mole ratio) that can be used for converting between moles of H2 and moles of
NH3:
2N2 + 3H2 → 2NH3
moles of
moles of

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?
Outline the steps needed to determine the limiting reactant when 0.50 mol of Cr and 0.75 mol of H3PO4 react according to the following chemical equation. 2Cr+2H3PO42CrPO4+3H2 Determine the limiting reactant.
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)
For each of the following unbalanced equations, indicate how many moles of the first product are produced if 0.625 mole of the second product forms. State clearly the mole ratio used for each conversion. msp;KO2(s)+H2O(l)KOH(s) msp;SeO2(g)+H2Se(g)H2O(g) msp;CH3CH2OH(l)+O2(g)CH3CHO(aq)+H2O(l) msp;Fe2O3(s)+Al(s)Fe(l)+Al2O(s)