Matching Type C. v a monodentate ligand A. EBT D. v a bidentate ligand B. silver diammine E. v a hexadentate C. ammonia A. v a chelating indicator D. oxalate v a polydentate E. ethylenediaminetetraacetic acid B. v a metal ligand complex ion

Matching Type C. v a monodentate ligand A. EBT D. v a bidentate ligand B. silver diammine E. v a hexadentate C. ammonia A. v a chelating indicator D. oxalate v a polydentate E. ethylenediaminetetraacetic acid B. v a metal ligand complex ion

Appl Of Ms Excel In Analytical Chemistry

2nd Edition

ISBN:9781285686691

Author:Crouch

Publisher:Crouch

Chapter9: Complexometric And Precipitation Titrations

Section: Chapter Questions

Problem 7P

See similar textbooks

Related questions

Q: ow did Werner first explain bonding in complexes Tetraaminecarbonatocobalt(III) nitrate and…

A: Werner's theory states that-1. Metals possess two types of valences called primary / ionizable and…

Q: Which statement is incorrect about CO ligand? Select one: O a. CO ligands can adopt terminal, u2 and…

A: The incorrect statement among the given options has to be given,

Q: Matching Type a…

Q: his is the lab with my data sheet and please answer all of them. Thank you and please answer all of…

A: The equilibrium is a state at which two spontaneous reactions takes place at same rate in opposing…

Q: Which of the following colorful octahedral complex ion solutions should have the longest Amax ? More…

A: In a complex upon absorbing the light the compound shows the colour . Depending on their CF…

Q: (a) Explain the hybridization and structure of the following complexes [Cu(NH3)4]SO4 Zn₂[Fe(CN)6]…

A: Given,

Q: 17

A: 18 electron Rule : Just as organic chemists have their octet rule for organic compounds, so do…

Q: Describe why each shift occurred using proper terminology

A: We have the following equilibrium: Fe3++SCN-=[FeSCN]2+ When the equilibrium shifts towards left side…

Q: Polydentate ligands almost always form ring like structures with the central metal ion. If crowding…

A: EDTA4- is a hexadentate ligand with 4 -CH2-COO- and 2 N atoms of -N-CH2CH2N- as the 6 electron pair…

Q: Explain the difference between double salt and metal complexes with examples?

Q: CI Ph2(Et)P-Pt-P(Et)Ph2 EtP-Pt-PEt3 MegP-Pt-CI ČI 242 pm ČI 229 pm CI 237 pm Q.3 For the first…

A: Electronic effect: It influence the structure of molecule, reactivity of molecule, or properties of…

Q: Which type of ligand would have the sharpest titration curve with a metal M? (A Hexadentate B…

A: The type of ligand that would have sharpest titration curve with a metal M is:

Q: (c) Please illustrate the orbital overlap that describes "back-bonding" transition metal M–CO…

A: Metal carbonyls are complexes, that involves CO as the ligand. They have both σ and π character.

Q: OUEST. 2. There has been three bands (264 nm, 408 nm and 575 nm) observed in the UV-Vis spectrum of…

A: Crystal field stabilization energy(CFSE ): Depending on the particular ligand field geometry and…

Q: Na2[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

Q: Explain the three factors that can act in the substitution reactions of octahedral complexes:…

A: metals forms octahedral complexes with six ligands located at the corners of an octahedron.…

Q: Explain why the complex Fe(en)3]2 is far less prone to ligand substitution reaction than its…

A: Interpretation - To explain the complex [Fe(en)3]2+ is far less prone to ligand substitution…

Q: The absorbance of a 0.1 M solution of a complex was 0.15 at Amas What is th value of molar…

A: Lambert law:- This law states that the rate of decrease in intensity with thickness of the medium(L)…

Q: In the complex ion, [Fe(CN)6], the primary valence of Fe is +6 +2 +4 -4

A: Here, Let 'x' be the primary valence of Fe in the complex [Fe(CN)6]4-. Total charge of the complex =…

Q: diagram for this complex ion. [trans-disquatetrachlorocuprate(II) ion] b) Explain why…

A: Crystal field splitting of the complex molecules.

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: How did conductivity help to confirm the structure of complexes [Co(NH3)4CO3]NO3 and [Co(NH3)5Cl]Cl2

A: The conductivity measurement of a coordination compoud [Co(NH3)4CO3]NO3 shows that it dissociates…

Q: (b) Copper forms the hydrated complex, [CU(H;O)J*

A: (i) Name of complex - Hexaaquacopper(II) Shape of complex - Octahedral

Q: sample contains Pb2+, Mg2+ and Zn2+. 0.4085 g of the sample is weighed and dissolved. Once dissolved…

A: It is an example of complexometric titration.

Q: 7. a. Which has higher stability: the complex between Li' and NH3 or the complex betweer K* and NH3?…

A: Given: stability of the complex between Li+ and NH3 or the complex between K + and NH3 solubility…

Q: X and Y form a complex whose fluorescence can be measured. Use the following data to determine the…

Q: B. Čomplexes of the Copper(II) Ion Ligand ©Color Formula of Complex OEffect of OH- NH3…

A: As Cu2+ system is d9 system. It undergo J-T distortion in octahedral chemistry When there is OH -…

Q: TiCl(Cp)2(CN)] and [TiCl(Cp)2(NH3)]Cl [IrMe(PMe3)4] and [Ir(C≡C-Ph)(PMe3)4] - Include the…

A: There are some coordination complexes .... 1) [TiCl(Cp)2(CN)] and [TiCl(Cp)2(NH3)]Cl 2)…

Q: spectrum

A: Dear student I have given answer to your question in the image format.

Q: A lab student analyzed his/her cool nickel-en complex for ethylenediamine, en, content. A 0.515 g…

Q: Which statement is incorrect about CO ligands? a. A CO ligand can accept electrons into its * MO;…

A: Carbonyl complexes contain carbon monoxide ligand. Carbon monoxide is a common ligand in transition…

Q: The compound X2Y is only partially dissociated in water solution to form X+ and Y2- ions. A 0.0100 m…

Q: multidentate ligands impreferable for complexometric titrations (А тоже. false doe B

A: multidentate ligand are preferable for complexometric titration

Q: Considering a dissociative mechanism for octahedral complexes, explain why metallic centers with…

A: Second and third grade metals are larger compare to first grade metals. Hence, there is less steric…

Q: Write out structure representations for all isomers of the following complexes: (c) Pd(en)(SCN)2…

Q: There has been three bands (264 nm, 408 nm and 575 nm) observed in the UV-Vis spectrum of the…

A: Step 1

Q: 91 Scandium and Zinc are not considered as atween Sc Zn magnetism hydrated ions in aquecus…

A: D block elements:

Q: Association reaction is less preferable than dissociation reaction in forming an octahedral complex…

A: Association reaction is the process in which ligand exchange takes place. Ligand firstly binds to…

Q: The hickel coördinátión compound bis(P,P-dialkylphosphinic-N-ethylamidato-N,S) nickel sounds…

A: If all the electrons of the central atom of a complex molecule are paired up then the compound is…

Q: Fill in the space below with DIGITS only. The condition for a complex to be low spin; from the…

A: For low spin coupling energy must be small than crystal field cleavage energy. If coupling energy is…

Q: General module on Medical Chemistry Variant 4 The compound formula is [Al(OH)JCI3 1. Indicate…

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: Answer True or False 1. The complex (RHCIP Ph) NH is an organic physical compound. 2- Compound, BMe…

Q: question one

A: Here, the cation is Co2+. Octahedral Co(NH3)4Br2Cl shows geometrical isomerism which results into…

Q: Early transition metal ions are generally quite Lewis whereas the ligands they coordinate are Lewis…

A: Eartly transition metal ions are generally quite lewis acids whereas the Ligands they co ordinate…

Q: Consider this metal complex: 3- F он OH Cr F OH OH Complex A Now decide whether each complex in the…

Q: Scott test is one of the methods used for screening for Cocaine in Forensic Chemistry. The multi…

A: Scott test in chemistry is done for the detection of cocaine a sample. It basically consist of 3-4…

Q: OUEST. 2. There has been three bands (264 nm, 408 nm and 575 nm) observed in the UV-Vis spectrum of…

A: The complex can be written asCrH2O63+ The electronic configuration of chromium…

Q: As a result of the colour change, what can be concluded about the [FeSCN2+(aq)]? Explain. Explain…

A: "Since there are multiple sub-parts in this question and it is not mentioned that which one has to…

Q: . Co(NH3)63+ is a low-spin complex while CoF63- is a high-spin complex. Give a rational for this…

A: A question based on coordination chemistry, which is to be accomplished.

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

I'm doubting my answers..

Matching Type
C. v a monodentate ligand
A. EBT
D. v a bidentate ligand
B. silver diammine
E. v a hexadentate
C. ammonia
A. v a chelating indicator
D. oxalate
v a polydentate
E. ethylenediaminetetraacetic acid
B. v a metal ligand complex ion

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Define the ambidentate ligand and give two examples.
a. Briefly describe the chelate effect b. Give the structure of a ligand that will exhibit the chelate effect when bound to a metal ion.
Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Whycan en act as a bidentate ligand whereas water cannot?
Determine the symmetry of the orbital groups for the donor sigma bonds (σ) of the ligand in an octahedral complex. Construct an MO diagram for the formation of this complex and indicate which orbitals determine the Δo. Clearly indicate the procedure.
Explain the difference between double salt and metal complexes with examples?
Why are multidentate ligands preferable to unidentate ligands for complexometric titrations? Explain.