Some N, gas is mixed with some 0, gas, and the sketch below shows a representative sample of the mixture. The total pressure of the mixture is measured, and found to be 1050. torr. key carbon hydrogen nitrogen sulfur охудen chlorine Calculate the mole fraction and partial pressure of each gas in this mixture. Round your answers to 4 significant digits. You may assume each gas behaves as an ideal gas. gas mole fraction partial pressure N2 torr 02 torr

Some N, gas is mixed with some 0, gas, and the sketch below shows a representative sample of the mixture. The total pressure of the mixture is measured, and found to be 1050. torr. key carbon hydrogen nitrogen sulfur охудen chlorine Calculate the mole fraction and partial pressure of each gas in this mixture. Round your answers to 4 significant digits. You may assume each gas behaves as an ideal gas. gas mole fraction partial pressure N2 torr 02 torr

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

ChapterC: Mathematics For General Chemistry

Section: Chapter Questions

Problem 2P

See similar textbooks

Similar questions

A 1.000-g sample of an unknown gas at 0C gives the following data: P(atm) V (L) 0.2500 3.1908 0.5000 1.5928 0.7500 1.0601 1.0000 0.7930 Use these data to calculate the value of the molar mass at each of the given pressures from the ideal gas law (we will call this the apparent molar mass at this pressure). Plot the apparent molar masses against pressure and extrapolate to find the molar mass at zero pressure. Because the ideal gas law is most accurate at low pressures, this extrapolation will give an accurate value for the molar mass. What is the accurate molar mass?
Pressures of gases in mixtures are referred to as partial pressures and are additive. 1.00 L of He gas at 0.75 atm is mixed with 2.00 L of Ne gas at 1.5 atm at a temperature of 25.0 C to make a total volume of 3.00 L of a mixture. Assuming no temperature change and that He and Ne can be approximated as ideal gases, what are a the total resulting pressure, b the partial pressures of each component, and c the mole fractions of each gas in the mix?
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.
5-54 Automobile air bags are inflated by nitrogen gas. When a significant collision occurs, an electronic sensor triggers the decomposition of sodium azide to form nitrogen gas and sodium metal. The nitrogen gas then inflates nylon bags, which protect the driver and front-seat passenger from impact with the dashboard and windshield. What volume of nitrogen gas measured at 1 atm and 27°C is formed by the decomposition of 100. g of sodium azide?
A mixture of N2 and Ne contains equal moles of each gas and has a total mass of 10.0 g. What is the density of this gas mixture at 500 K and 15.00 atm? Assume ideal gas behavior.