The elementary reaction 2 H,O(g) = 2 H,(g) + 0,(g) proceeds at a certain temperature until the partial pressures of H,O, H,, and 0, reach 0.0300 atm, 0.00500 atm, and 0.00150 atm, respectively. What is the value of the equilibrium constant at this temperature?

The elementary reaction 2 H,O(g) = 2 H,(g) + 0,(g) proceeds at a certain temperature until the partial pressures of H,O, H,, and 0, reach 0.0300 atm, 0.00500 atm, and 0.00150 atm, respectively. What is the value of the equilibrium constant at this temperature?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 106CWP: For the reactionN2O4(g)2NO2(g),Kp=0.25 at a certain temperature. If 0.040 atm of N2O4 is reacted...

See similar textbooks

Related questions

Q: The elementary reaction 2 H₂O(g) 2 H₂(g) + O₂(g) = proceeds at a certain temperature until the…

Q: Ammonia and oxygen react to form nitrogen and water, like this: 4NH; (g)+30,(g) 2N,(g)+6H20(g)…

A: Le Chateliers Principle If a system at equilibrium is subjected to change in one or more variables…

Q: For the equilibrium reaction: 2 NOCI(g) –→2 NO(g) + Cl,(g) 2.00 mol NOCI was placed in an otherwise…

Q: The elementary reaction 2 H,O(g) = 2 H,(g) + 0,(g) proceeds at a certain temperature until the…

A: Answer: Given data: PH2O=0.065barPH2=0.0090barPO2=0.0031bar

Q: Carbon dioxide and water react to form methane and oxygen, like this: CO,(9)+2H,0(9) → CH (9)+20,(9)…

A: The equilibrium reaction given is, Given : The reaction is endothermic reaction. Hence the forward…

Q: Consider the following reaction at 25°C with the ΔG°' = +1800 J/mol for the forward reaction. The…

Q: The elementary reaction 2 H,O(g) = 2 H(g) + O2(g) proceeds at a certain temperature until the…

Q: to

A: Please find the file attached for explanation

Q: Carbon dioxide and water react to form methane and oxygen, like this: Co,(g)+2H,0(g) CH,(g)+20,(9)…

Q: Consider this reaction in a closed container. 2NO(g) + 0,(g) – 2NO,(g) An equilibrium mixture is…

A: The direction of a reaction after disturbing the equilibrium of the reaction is predicted by using…

Q: The elementary reaction 2H, O(g) 2 H, (g) + O,(g) proceeds at a certain temperature until the…

A: The partial pressur of a gas is a mixture of thermodynmic activity of the gas molecules.

Q: Assume that the reaction: CO(g) + H2O(g) CO2(g) + H2(g) occurs in an ideal mixture of ideal gases.…

A: Given: CO(g) + H2O(g) <------> CO2(g) + H2(g) Kp = 3.11 Temperature, T = 500K

Q: The reaction H,0(0) + CO,(aq) H,CO,(aq) is at equilibrium. What does this mean?.

A: Given : We have to explain above system of equilibrium using collision theory.

Q: The elementary reaction 2H,O(g) = 2H,(g) +0,(g) proceeds at a certain temperature until the partial…

Q: For each of the following hypothetical reactions calculate the reaction quotient (Q) from the given…

Q: A chemical engineer is studying the following reaction: HCH;CO,(aq)+CH,NH,(aq) → CH,CO,(aq)+CH,NH…

Q: The elementary reaction 2 H,O(g) = 2 H,(g) + 0,(g) proceeds at a certain temperature until the…

Q: In the reaction N2{g) + 3H(8) → 2NH3(g) was allowed to reach equilibrium at 450°C. It was found that…

A: Applying formula Kc = [NH3]2/ [N2] [H2]3

Q: Describe the reaction direction at constant T, P: Cu2S(s) = 2Cu(s) + S(s), AG = 79.5 kJ reactants →…

A: As you know, to perform any reaction generally we need to provide some energy. This energy is…

Q: what is the equilibrium partial pressure of Cl2?

A: The equilibrium partial pressure of Cl2 is 1.984 atm.

Q: At 430°C, the equilibrium constant (Kp) for the reaction 2NO(g) + 02(g) 5 2NO2(g) is 1.5 x 10°. In…

A: The equilibrium reaction is represented as: 2 NO (g)+02 (g) →2 NO2 (g) The reaction quotient (Qp) is…

Q: Nitrogen monoxide and water react to form ammonia and oxygen, like this: 4 NO(g)+6H,0(g) → 4…

Q: Consider the reaction: Br2(g) + Cl2(g) 2 BrCI(g) K, = 1.11 x 10at 150 K A reaction mixture initially…

A: Given: Initial partial pressure of Br2 (PBr2) = 755 torr Initial partial pressure of Cl2 (PCl2) =…

Q: Enter your answer in the provided box. Pure phosgene gas (COCI,), 0.0340 mol, was placed in a 1.40-L…

A: Consider the given information is as follows; Initial moles of COCl2 (n) = 0.0340 molVolume (V) =…

Q: Nitrogen monoxide and ozone react to form nitrogen dioxide and oxygen, like this: NO(g)+03(9)…

Q: The elementary reaction 2H20(g) –---2H2(g)+O2(g) proceeds at a certain temperature until the partial…

A: Given: The equilibrium pressure of the following species are given as:- H2O=0.0100 atmH2=0.00250…

Q: The initial concentrations or pressures of reactants and products are given for each of the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Hydrogen chloride and oxygen react to form water and chlorine, like this: 4HCI (g)+O,(g) →…

A: Some Cl2(g) is added We know that Kp for the reaction can be written as Kp = (P’ H2O)2 . (P’Cl2)2 /…

Q: Consider the reaction of reactants A and B in equilibrium with products C and D. Given the following…

A: The equilibrium constant is the ratio between the product of concentration of products to that of…

Q: At 25°C, for the reaction Br. (g) + 2Br (g) We have AG = 161.67 kJ/mol, and AH = 192.81 kJ/mol a.…

A: Given: The reaction: Br2 (g) ↔ 2Br (g) ∆G∘ = 161.67 kJ/mol∆H∘ = 192.82 kJ/mol

Q: The elementary reaction 2 H20(g) = 2 H2(g) + O2(g) proceeds at a certain temperature until the…

Q: Hydrogen sulfide and oxygen react to form sulfur dioxide and water, like this: 2H,s(g)+3O,(g) →…

Q: The elementary reaction 2H2O(g)↽−−⇀2H2(g)+O2(g) proceeds at a certain temperature until the partial…

A: If reactants and products are in gaseous state, we can still find the equilibrium constant but…

Q: The elementary reaction 2H2O(g)↽−−⇀2H2(g)+O2(g) proceeds at a certain temperature until the partial…

A: Equilibrium constant defines a relation between the concentration of reactants and products or…

Q: Carbon dioxide and water react to form methane and oxygen, like this: CO,(9)+2H,O(9) - CH(g)+20;(9)…

Q: how is equilibrium constant different from a reaction quotient? B) Explain how comparing the values…

A: The answer and explanation is given below:

Q: The elementary reaction 2H,O(g) = 2H,(g) + 0,(g) proceeds at a certain temperature until the partial…

Q: A chemical engineer is studying the following reaction: HCH; CO,(aq)+CH;NH,(aq)– CH;Co, (aq)+CH;NH…

A: W have given the equilibrium constant for the reaction. Now we know if K > Q than the reaction…

Q: Hydrogen chloride and oxygen react to form water and chlorine, like this: 4HCI(g)+O,(8) 2H,0(g)+2Cl,…

Q: The elementary reaction 2 H,O(g) =2 H,(g) + 0,(g) proceeds at a certain temperature until the…

A: Note: As per our guidelines, we are supposed to answer only one question when multiple questions are…

Q: The elementary reaction 2 H, O(g) = 2 H,(g) + 0,(g) proceeds at a certain temperature until the…

Q: Hydrogen chloride and oxygen react to form water and chlorine, like this: 4HCI(g)+0,(g)…

A: Le Chatelier's principle: According to the Le Chatelier's principle when a change in concentration…

Q: The elementary reaction 2 H, O(g) = 2 H,(g) + O,(g) proceeds at a certain temperature until the…

Q: g equilibrium pressures were observed at a certain temperature for the reaction

Q: following equilibrium reaction at 160.00 °C. If 0.420 atm of H2O2(g) is initially present,…

A: Consider the given information is as follows; H2 g + O2g ⇌ H2O2g Kc=7.109…

Q: Consider the reaction. Br2(g)+Cl2(g)⇌2BrCl(g) Kp=1.11×10−4 at 150 K A reaction mixture initially…

A: The ICE table or the given reaction can be drawn as follows-

Q: The elementary reaction 2 H,O(g) = 2 H,(g) +O2(g) proceeds at a certain temperature until the…

A: Equilibrium constant (Kp): It show relationship between ratio of partial pressure of product to…

Q: Amounts of H2O, CO, H2, and CO2 are put into a flask so that the compositions corresponds to an…

A: No the 14C will not be found only in CO molecules after an indefinite period of time.

Q: Hydrogen chloride and oxygen react to form water and chlorine, like this: 4HCI(g)+O,(g) →…

A: A question based on equilibrium concept that is to be accomplished.

Q: The elementary reaction 2H2O(g)↽−−⇀2H2(g)+O2(g) proceeds at a certain temperature until the partial…

A: 2H2O(g)↔2H2(g)+O2(g)expression of equilbrium constant at this temperature,Kp=PO2×(PH2)2(PH2O)2…

Question

Kp=?

The elementary reaction
2 H, O(g) = 2 H, (g) + 0,(g)
proceeds at a certain temperature until the partial pressures of H,0, H,, and O, reach 0.0300 atm, 0.00500 atm, and
0.00150 atm, respectively. What is the value of the equilibrium constant at this temperature?
Kp =
about us
careers
privacy policy
terms of use contact us
help
MacBook Air
888
DII
F4
F5
F6
F7
F8
F9
F10
F11
BE
&
4
5
R
T.
Y
P
F
G
K
V
N
command
option
V
Σ
00

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Old-fashioned smelling salts consist of ammonium carbonate, (NH4)2CO3. The reaction for the decomposition of ammonium carbonate (NH4)2CO3(s)2NH3(g)+CO(g)+H2O(g) is endothermic. Would the smell of ammonia increase or decrease as the temperature is increased?
Consider the reaction: A(g)+2B(g)+C(s)2D(g)At 25C, only A, B, and C are present. The partial pressures of A, B, and D are given as PA, PB, and PD. Equilibrium is established 18 minutes after the reaction starts. Use terms is less than (LT), is greater than (GT), is equal to (EQ), or insufficient information (X) to answer the following questions. (a) PD at 5 min PA. (b) PA at 21 min PA at 27 min. (c) PB at 7 min PB at 13 min.(d) After 20 min, more B is added. When equilibrium is reestablished, K before the addition K after the addition. (e) After 20 min, the temperature is increased to 35C. PA before the temperature increase PA after the temperature increase after equilibrium is reestablished.
When heated, iodine vapor dissociates according to this equation: I2(g)2I(g) At 1274 K, a sample exhibits a partial pressure of I2 of 0.1122 atm and a partial pressure due to I atoms of 0.1378 atm. Determine the value of the equilibrium constant, Kp, for the decomposition at 1274 K.
In Table 12.1 (←Sec. 12-3a) the equilibrium constant for the reaction ⇋ is given as 4.2 × 1052. If this reaction is so product-favored, why can large piles of yellow sulfur exist in our environment (as they do in Louisiana and Texas)?
The direct reaction of iron(III) oxide. Fe2O3, to give iron and oxygen gas is a nonspontaneous reaction; normally, iron combines with oxygen to give rust (the oxide). Yet we do change iron(III) oxide, as iron ore, into iron metal. How is this possible? Explain.
For the reactionN2O4(g)2NO2(g),Kp=0.25 at a certain temperature. If 0.040 atm of N2O4 is reacted initially, calculate the equilibrium partial pressures of NO2(g) and N2O4(g).
7-64 As we shall see in Chapter 20, there are two forms of glucose, designated alpha and betawhich are in equilibrium in aqueous solution. The equilibrium constant for the reaction is 1.5 at 30°C. (a) If you begin with a fresh 1.0 M solution of D-glucose in water, what will be its concentration when equilibrium is reached? (b) Calculate the percentage of glucose and of glucose present at equilibrium in aqueous solution at 30°C.
The initial concentrations or pressures of reactants and products are given for each of the following systems. Calculate the reaction quotient and determine the direction in which each system will proceed to reach equilibrium. (a) 2NH3(g)N2(g)+3H2(g) Kc=17;[NH3]=0.50M,[N2]=0.15M,[H2]=0.12M (b) 2NH3(g)N2(g)+3H2(g) Kp=6.8104 initial pressures NH3=2.00atm,N2=10.00atm,H2=10.00atm (c) 2SO3(g)2SO2(g)+O2(g) Kc=0.230;[SO3]=2.00M,[SO2]=2.00M,[O2]=2.00M (d) 2SO3(g)2SO2(g)+O2(g) Kp=16.5 initial pressures SO2=1.00atm,O2=1.130atm,SO3=0atm (e) 2NO(g)+CI2(g)2NOCI(g) Kp=2.5103 ; initial pressures; NO=1.00atm,CI2=1.00atm,NOCI=0atm (f) N2(g)+O2(g)2NO(g) Kc=0.050 ; [N2]=1.00M,[O2]=0.200M,[NO]=1.00M
. Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the inter-conversion reaction?

Recommended textbooks for you

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Principles of Modern Chemistry

Chemistry

ISBN:

9781305079113

Author:

David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:

Cengage Learning

Chemistry: Principles and Reactions

Chemistry

ISBN:

9781305079373

Author:

William L. Masterton, Cecile N. Hurley

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Principles of Modern Chemistry

Chemistry

ISBN:

9781305079113

Author:

David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:

Cengage Learning

Chemistry: Principles and Reactions

Chemistry

ISBN:

9781305079373

Author:

William L. Masterton, Cecile N. Hurley

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS