To treat a burn on his hand, a person decides to place an ice cube on the burned skin. The mass of the ice cube is 10.6 g, and its initial temperature is -14.4 'C. The water resulting from the melted ice reaches the temperature of his skin, 31.0 "C. How much heat is absorbed by the ice cube and resulting water? Assume that all of the water remains in the hand. Constants for water can be found in this table.

To treat a burn on his hand, a person decides to place an ice cube on the burned skin. The mass of the ice cube is 10.6 g, and its initial temperature is -14.4 'C. The water resulting from the melted ice reaches the temperature of his skin, 31.0 "C. How much heat is absorbed by the ice cube and resulting water? Assume that all of the water remains in the hand. Constants for water can be found in this table.

Living by Chemistry

2nd Edition

ISBN:9781464142314

Author:Angelica M. Stacy

Publisher:Angelica M. Stacy

ChapterU5: Fire: Energy , Thermodynamics, And Oxidation-reduction

Section: Chapter Questions

Problem 4STP

See similar textbooks

Similar questions

Grilling What mass of propane (C3H8) must be burnedin a barbecue grill to release 4560 kJ of heat? The Hcomb of propane is -2219 kJ/mol.
When ethanol (grain alcohol, is burned in oxygen, approximately 1360 kJ of heat energy is released per mole of ethanol. mg src=Images/HTML_99425-10-44QAP_image002.jpg alt="" align="top"/> What quantity of heat is released for each gram of ethanol burned? i>What is for the reaction as written? How much heat is released when sufficient ethanol is burned so as to produce 1 mole of water vapor?
Differentiate between the enthalpy of formation of H2O(l)andH2O(g) . Why is it necessary to specify thephysical state of water in the following thermochemicalequation CH4(g)+2O2(g)CO2(g)+2H2O(lorg)H=?
9.21 Which type of energy heat or work, is valued more by society? What evidence supports your judgment?
Suppose heat flows into a vessel containing a gas. As the heat flows into the gas, what happens to the gas molecules? What happens to the internal energy of the gas?
How much heat is evolved when 1255 g of water condensesto a liquid at 100°C?
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
A7.50-gpiece of iron at 100.0C is dropped into 25.0g of water at 22.0C. Assuming that the heat lost by the iron equals the heat gained by the water,determine thefinal temperature of the iron/watersystem. Assume a heat capacity of water at 4.18 J/g.K and of iron at 0.452J/g.K.
A sample of ammonia (Hsolid=5.66kJ/mol) liberates5.66 kJ of heat as it solidifies at its melting point.What is the mass of the sample?
Equal masses of liquid A, initially at 100C, and liquid B, initially at 50C, are combined in an insulated container. The final temperature of the mixture is 80C. All the heat flow occurs between the two liquids. The two liquids do not react with each other. Is the specific heat of liquid A larger than, equal to, or smaller than the specific heat of liquid B?
9.47 If 14.8 kJ of heat is given off when 1.6 g of HCl condenses from vapor to liquid, what is Hcond for this substance?
A calorimeter contains 72.0g of water at 19.2C. A 141-g piece of tin is heated to 89.0C and dropped into the water. The entire system eventually reaches 25.5C. Assuming all of the energy gained by the water comes from the cooling of the tin-no energy loss to the calorimeter or the surroundings-calculate the specific heat of the tin.