When determining the energy of a reaction where 0.250 mol of a substance with a AH = -2250.0 kJ/mol reacts, we perform this calculation: comb -2250.0 kJ x kJ -2250.0 kJ OR 0.250 mol 1mol 0.250 mol 1mol Why can't we simply say that the energy of the reaction is -2250.0 kJ?

When determining the energy of a reaction where 0.250 mol of a substance with a AH = -2250.0 kJ/mol reacts, we perform this calculation: comb -2250.0 kJ x kJ -2250.0 kJ OR 0.250 mol 1mol 0.250 mol 1mol Why can't we simply say that the energy of the reaction is -2250.0 kJ?

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter10: Energy

Section: Chapter Questions

Problem 13A

See similar textbooks

Related questions

Q: A chemist measures the energy change AH during the following reaction: C;Hg(9)+5O,(g) →3…

A: We have to find whether this reaction is exothermic or endothermic. Also, we have to find the amount…

Q: First Law of thermodynamics I. Calculate AU for each of the following cases & identify if the…

A: Exothermic reaction :- In a reaction the amount of heat released then the reaction is known…

Q: Consider the reaction. 2Fe2O3⟶4Fe+3O2ΔH∘rxn=+824.2 kJ2Fe2O3⟶4Fe+3O2ΔHrxn°=+824.2 kJ a) The…

A: The heat change that occurs in the formation of any compound that amounts 1 mole is called enthalpy…

Q: Which expression describes the heat evolved in a chemical reaction when the reaction is carried out…

Q: For the reaction2CO(g) + 2NO(g)2CO2(g) + N2(g)ΔH° = -746.6 kJ and ΔS° = -198.0 J/KThe maximum amount…

A: The given balanced equation can be expressed as: Calculate the standard free energy by using the…

Q: Consider the reaction H2(g) + Cl2(g) 2HCI(g) AH = -384.6 kJ/mol. If 3 moles of H2 react with 3 moles…

A: Given data H2(g) + Cl2(g) → 2 HCl(g) ∆H=-384.6 KJ/mole Number of H2 mole react = 3 mole Number…

Q: At one time, a common means of forming small quantities ofoxygen gas in the laboratory was to heat…

A: Energy change takes place when reactants convert into product. The heat change of a reaction is…

Q: How is enthalpy related to the spontaneity of a reaction? A. AH does not affect spontaneity. B. AH0…

Q: How much energy is released when 30.0g of water are formed in the reaction below? 2H2(g) + O2(2) →…

Q: Ozone (O3) in the atmosphere can react with nitric oxide (NO): O3(g) + NO(g) --> NO2(g) +…

A: Record the given data, ΔH° = -199 kJ/mol ΔS° = - 4.1 J/K·mol Temperature, T = 25° C = 25 + 273 K =…

Q: 1) Consider this reaction: Pb + PbO2 + 2SO3 → 2PBSO4 AH°rxn = -775 kJ How much heat will be released…

Q: Given the data: N2(g) + O2(g) ---> 2NO(g) DH = +180.7 kJ 2NO(g) + O2(g)…

A: (1) N2g + O2g → 2NOg ∆H = +180.7 KJ 2NO(g) + O2(g) → 2NO2(g) ∆H = -113.1 KJ…

Q: Dichotomize between thermodynamics and thermochemistry.

A: We have to discuss the dichotomize between thermodynamics and thermochemistry.

Q: Q2: label the following picture and answer the following questions: 120 100 80 60 40 reaction…

A: A reaction pathway in graphical representation with blanks and 4 related question with blanks, which…

Q: What is the ΔSo of the reaction based on the following standard entropies: Al(s) + 3HCl(l) →…

Q: SECOND LAW OF THERMODYNAMICS Why is it so important? How can the 2nd law of thermodynamics relate…

A: Second law of Thermodynamics states that for any spontaneous process the energy of the process is…

Q: A reaction has the following thermochemical values at 272.15 K: ΔH = -189.3 kJ mol-1 ΔS = -166.0 J…

A: Given-> Temperature (T) = 272.15 K ∆H = -189.3 kJ.mole-1 = -189300 J.mole-1(1KJ=1000J) ∆S =…

Q: A chemist measures the energy change H during the following reaction at 1 atm pressure and 25.00 C…

A: 36 g of H2O means 2 moles of water is produced . so from the equation we can see that 1 moles of…

Q: A reaction has the following thermochemistry values at 281.15 K ΔH = - 180.2 KJ mol-1 ΔS = - 158.8…

A: Given, Change in enthalpy = ΔH = - 180.2 KJ mol-1 Change in entropy = ΔS = - 158.8 J mol-1K-1…

Q: s reaction endothermic or exothermic? ts) oinnerdtoxca no tobne Additionally, rewrite the…

Q: Using the provided table, determine the enthalpy for the reaction 2 K(s) + 2 H20(1) → 2 KOH (aq) +…

Q: A chemist measures the energy change AH during the following reaction: CH (9)+20,(9) →…

Q: A chemist measures the energy change AH during the following reaction: CH,(9)+20,(9) →…

Q: Ammonium Nitrate, NH,NO3, powder is used as the ice pack for sports injury. When water in the sack…

A: Given, Ammonium Nitrate powder is used as the ice pack for sports injury. When water in the sack is…

Q: Consider the reaction. 2Fe2O3⟶4Fe+3O2 Δ?∘rxn=+824.2 kJ The formation of 77.0 g77.0 g of Fe…

A: Molar mass of Fe = 55.845 g/mol 4 moles of Fe = 223.38 gm Means, 223.38 g Fe forms with absorption…

Q: CH3OH(g) ---> CO(g) + 2H2(g) DH = +90.7 kJ Calculate the amount of heat tranferred when 1.54 kg of…

Q: - For the formation of one mole of each of these gases from their elements, which reaction is most…

A: The change in enthalpy that takes place during the formation of 1 mole of a chemical substance from…

Q: In the late eighteenth century Priestley prepared ammonia by reacting HNO3(g) with hydrogen gas. The…

A: We are given the balanced chemical equation for the preparation of NH3 as follows: HNO3(g) +…

Q: Calculate Δ?ΔH for the reaction B2H6 (g) + 6 Cl2 (g) ⟶⟶ 2 BCl3 (g) + 6 HCl (g) from the following…

A: We have to Calculate Δ?ΔH for the reaction B2H6 (g) + 6 Cl2 (g) ⟶⟶ 2 BCl3 (g) + 6 HCl (g) from the…

Q: Determine the temperature of a reaction if K = 1.20 x 10⁻⁶ when ∆G° = +20.70 kJ/mol

Q: 14. Given the 2 reactions below: 2NOE I. 2NO + 0z8) II. 2Li,Og + 1192 KJ → 4Lig Which statement is…

A: The energy difference of the products and reactants is known as the energy change of a reaction.

Q: Determine the AH° for the overall reaction based on the three-step thermochemical processes below:…

A: ∆H values - Reaction 1 = 167.5 KJ Reaction 2 = 341.4 KJ Reaction 3 = 43.4 KJ Final reaction = ?

Q: A reaction has the following thermochemical values at 283.15 K: ΔH = -183.3 kJ mol-1 ΔS = -160.6 J…

Q: Determine the AH (AH ) for the reaction CH,(g) + 20, (g) → 2H,0(g) + CO,(g) Given: Substance AH? mol…

A: Answer is explained below.

Q: A chemist measures the enthalpy change AH during the following reaction: 2 Al(s) + Fe,O3(s)→Al,03(s)…

A: Heat of reaction is defined as difference of energy of product and energy of Reactant. If heat of…

Q: For the following reaction: CS2(l) + 3 O2(g) →CO2(g) + 2 SO2(g) determine the constant pressure heat…

A: Given that - C(s) + O2(g) → CO2(g); ΔHf1=-393.5 kJ/mol .........(1) S(s) + O2(g) → SO2(g);…

Q: Exothermic Endothermic Heat Heat Heat Heat Which statement is correct? O When an endothermic process…

A: Endothermic process is a process which involves heat absorption from the surroundings, so as to…

Q: Given: 2C(s) + O₂(g) → 2CO(g) ∆H = -218 kJ C(s) + O₂(g) → CO₂(g) ∆H = -393 kJ How much energy is…

A: The given reactions are: 2C(s) + O₂(g) → 2CO(g) ∆H = -218 kJ C(s) + O₂(g) → CO₂(g)…

Q: Determine how the following changes affect the given equilblirium reaction that is held in a closed…

A: Question 20 According to Le Chateliers principle, when a system under equilibrium is subjected to a…

Q: Given the following three reactions: C (s) + 2 H2 (g) ------> CH4 (g) AH = -33.1 kJ C (s) + 2 Cl2…

Q: For the reaction 4HCl(g) + O2(g)------>2H2O(g) + 2Cl2(g) ΔH° = -114.4 kJ and ΔS° = -128.9 J/K The…

Q: The first law of thermodynamics is extremely important in every chemical reaction, but what exactly…

A: First law of thermodynamics talk about conservation of energy.

Q: 10 of 11 <. Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) 2…

A: Delta H Is calculated as follows

Q: The reaction N2(g) + 3H2(g) 2 2NH3(g) has K, = 6.9 × 105 at 25.0 °C. Calculate AG° for this reaction…

Q: The energy of an exothermic reaction is O released into the environment O consumed in the reaction O…

A: Exothermic reaction is the reaction in which energy/heat is released as the total energy of products…

Q: Given the individual step reactions: 2O3(g) -> 3O2(g) ΔH = -427…

A: This can be done as

Q: Substance AH, AgCl AgCN HCl -129.888 kJ/mol 141.8 kJ/mol -171.728 kJ/mol HCN 108.5 kJ/mol HCl + AgCN…

Q: The enthalpy change for the exothermic reaction N2 + 3H2(g) à 2NH3(g) is 92.2kJ. molar enthalpy for…

A: The given thermochemical reaction is: N2(g) + 3H2(g) -----> 2NH3(g) ; ∆Ho = - 92.2 kJ

Q: Given the data in the table below, AH, for the reaction rxn IF5 (g) + F2 (g) → IF7 (g) AHᵒf…

A: The standard enthalpy of formation is the enthalpy change of reaction in standard conditions when…

Q: Consider the reaction. 2 Fe, O, 4 Fe + 30, = +824.2 kJ The formation of 84.0 g of Fe results in O…

A: Recall the given reaction, 2 Fe2O3 ------> 4 Fe + 3 O2 ∆Hrxn = + 824.2 KJ We have…

Question

Unit Name: Thermodynamic Chemistry

investigate and analyse energy changes and rates of reaction in physical and chemical processes, and solve related problems;

When determining the energy of a reaction where 0.250 mol of a substance with a
AH = -2250.0 kJ/mol reacts, we perform this calculation:
comb
-2250.0 kJ
x kJ
-2250.0 kJ
OR 0.250 mol
1mol
0.250 mol
1mol
Why can't we simply say that the energy of the reaction is -2250.0 kJ?

Science that deals with the amount of energy transferred from one equilibrium state to another equilibrium state.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Explain in your own words what is meant by the term entropy. Explain how both matter spread and energy spread are related to the concept of entropy.
You have a large balloon containing 1.0 mol of gaseous water vapor at 80 C. How will each step affect the internal energy of the system? (a) The temperature of the system is raised to 90 C. (b) The vapor is condensed to a liquid, at 40 C.
9.20 State the first law of thermodynamics briefly in your own words.
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
9.83 A student performing a calorimetry experiment combined 100.0 mL of 0.50 M HCl and 100.0 mL of 0.50 M NaOH in a coffee cup calorimeter. Both solutions were initially at 20.0°C, but when the two were mixed, the temperature rose to 23.2°C. (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 mL of 0.50 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCl and 100.0 mL of 1.00 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why?
Thermodynamics provides a way to interpret everyday occurrences. If you live in northern climates, one common experience is that during early winter, snow falls but then melts when it hits the ground. Both the formation and the melting happen spontaneously. How can thermodynamics explain both of these seemingly opposed events?
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
9.54 The phase change between graphite and diamond is difficult to observe directly. Both substances can be hurned, however. From these equations, calculate H for the conversion of diamond into graphite. C(s,graphite)+O2(g)CO2(g) H= -393.51 kJ C(s,diamond)+O2(g)CO2(g) H= -395.94 kJ
The reaction between magnesium metal and water (l) produces solid magnesium hydroxide and hydrogen gas. Calculate G for the formation of one mole of Mg(OH)2 at 27C and at 39C.
One statement of the second law of thermodynamics is that heat cannot be turned completely into work. Another is that the entropy of the universe always increases. How are these two statements related?
Some water is placed in a coffee-cup calorimeter. When 1.0 g of an ionic solid is added, the temperature of the solution increases from 21.5C to 24.2C as the solid dissolves. For the dissolving process, what are the signs for Ssys, Ssurr, and Suniv?
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.