Answered: Why is the amount of heat absorbed by…

Why is the amount of heat absorbed by the water not equal to the amount of heat produced by the combustion of benzoic acid sample?

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter18: Acids And Bases

Section: Chapter Questions

Problem 117A

See similar textbooks

Related questions

Q: What is the final temperature (in °C) of 470.1 g of water (specific heat = 4.184 J/g･°C) at 24.20°C…

Q: Why is that the surrounding temperature of ice cubes is cold and has condensation? What process…

A: In this problem we are required to explain why the temperature around the ice cubes are cold and why…

Q: how much heat is required to heat 38 g of steam form 115 C to 120 C?

A: A numerical problem based on heat energy required, which is to be accomplished.

Q: A calorimeter is pictured below. When substances are dissolved in water, they can absorb or release…

Q: when hydrogen and oxygen are burned to produce water. heat is produced at 58 kcal mol of water. A…

A: We are given with the heat produced for 6.02×10-23 molecules = 58 KCal. So , to find heat produced…

Q: A student is investigating the energy released during the combustion of different alcohols. The…

A: Given: A student is investigating the energy released during the combustion of different alcohols.…

Q: How many moles of H₂ are required to give off 2951 kJ of heat in the following reaction? N₂ (g) + 3…

Q: Knowing the direction of heat flow, explain why if you leave a hot bowl of soup out in the open on…

A: A question based on chemical thermodynamics that is to be accomplished.

Q: A metal sample of with a mass of 0.0500 kg at 100°C is placed into 0.400 kg of water at 20°C. If the…

A: Given : Mass of metal = 0.05 kg Initial temperature for metal = 100°C Mass of water = 0.400 kg…

Q: What is the definition of standard heat of formation of ethanol? What is the definition of the…

Q: Calculate the amount of energy (in calories) needed to heat the cold water. Use the heat equation…

A: Since you have posted multiple questions, we are entitled to answer the first only. 2) Given: Mass…

Q: When we heat the cheetos was all the heat released actually captured by the water?

A: In cheetos experiment, a chip is burnt and heat released by it is used to raise the temperature of…

Q: le chatelier's principle S8(g) + 1202(g) ↔ 8 SO3(g) + 808kcals what will happen when... (A)…

A: Le Chatelier's principle: This principle is used to predict the effect of a change in conditions on…

Q: 1. In the calorimeter experiment, you mixed 50 mL of 1.0 M NaOH with 50 mL of approximately 1.0 M…

Q: 1. (Heat) The combustion of 0.0222 g of isooctane vapor, C3H18(g), at constant pressure raises the…

Q: A 36.62 g sample of a substance is initially at 24.8 °C. After absorbing 1921 Jof heat, the…

Q: What effect does the initial temperature of the water have on the change in temperature of the water…

A: While hot metal was added into the water. The hot metals lose its temperature (energy) into the…

Q: Which letter indicates the heat (energy change) of entire reaction?

A: Given reaction is irreversible reaction, i.e reaction proceeds only one direction , forword…

Q: What is the final temperature (in °C) of 850.1 g of water (specific heat = 4.184 J/g･°C) at 24.20°C…

Q: A 31.72 g31.72 g sample of a substance is initially at 21.0 °C.21.0 °C. After absorbing 1895 J1895 J…

A: The amount of heat energy required is related to specific heat capacity as,…

Q: enthalpy change if

Q: Calculate the amount of heat required to raise the tempature of an 91 g sample of water from 39C to…

A: Given: Specific heat of water = 4.18 J/g⋅∘C. Mass of water = 91 g. Initial temperature (T1) = 39 ∘C…

Q: The specific heat of mercury is 0.140 J/g°C. Calculate the heat necessary to raise the temperature…

Q: determine the heat of reaction

A: This problem is based on Hess's law of thermodynamics The Hess law states that the change of…

Q: 1. Consider the following situation: "A ocean breeze blows over cold ground at night, and fog…

A: A bond is a strong or weak attraction between two atoms in the same environment. The new grouping…

Q: Choose the INCORRECT statement. The energy stored in chemical bonds or generated from intermolecular…

A: 1. Correct statement.The energy stored in chemical bonds or generated from intermolecular forces is…

Q: If 40.0 kJ of energy is absorbed by 500.0 g of water at 10.0 oC, then what is final temperature of…

A: Q = m . s . (T2-T1)

Q: A 52.03 g sample of a substance is initially at 28.5 °C. After absorbing 1165 J of heat, the…

Q: What is the final temperature (in °C) of 230.1 g of water (specific heat = 4.184 J/g°C) at 24.20°C…

Q: What is the final temperature of 420.1 g of water (specific heat = 4.18 J/g･°C) at 24.2°C that…

A: The final temperature of water is to be calculated. 14.00 Normal 0…

Q: When you put the iron cube in the olive oil and the brick cube in the water what loses heat more…

A: Heat capacity is the quantity of heat required to increase the temperature of an object or a…

Q: Relate the heat gained by the calorimeter and water with the heat lost by the metal. EXPLAIN

A: The heat gained by the calorimeter or water is always equal to the heat lost by the metal.This the…

Q: The specific heat of zinc is 0.096 cal/goC. Determine the amount of heat energy required to raise…

A: Applying formula Q= mc∆t

Q: Q1: Three identical flasks contain three different gases at standard temperature and pressure. Flask…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: A 51.76 g51.76 g sample of a substance is initially at 28.0 °C.28.0 °C. After absorbing 1755 J1755 J…

A: We have mass of sample as 51.76 g , initial temperature as 28°C, heat absorbed as 1755 J, final…

Q: Part A) The standard molar heat of formation of water vapor (steam) is -242 kJ/mol. What amount…

A: Only first question is answered according to the policy

Q: Let’s say that an inventor creates a new instrument to control the temperature using the salts given…

A: Energy changes associated with physical or chemical changes as well as the heat capacity can be…

Q: How much heat must be lost to change 35 grams of gaseous water into ice from 155 ˚C to -65˚C?

Q: How much heat is gained by the water? B. How much heat heat is lost by the zinc metal? C. From the…

A: To solve this problem we will use the formula q = m • C •∆T Where , q = heat released or absorbed…

Q: How many moles of H₂ are required to give off -9551 kJ of heat in the following reaction? N₂ (g) + 3…

A: A exothermic reaction always produces heat energy during the reaction. If more reactants reacts then…

Q: The following diagram represents the Carnot cycle. Which of the following processes present when…

A: Carnot Cycle: An ideal machine to explain about the maximum conversion of heat into the work.…

Q: What is the specific heat of water? (cwater)

Q: Question 22 of 30 How much heat, in kJ, will be absorbed by a 25.0 g piece of aluminum (specific…

Q: A 52.76 g sample of a substance is initially at 28.4 °C. After absorbing 1985 J of heat, the…

A: In given question use formula q = mc∆T Given : q = 1985 J m = 52.76 g ∆T = 133.4 - 28.4 = 105 °C…

Q: A 39.60 g sample of a substance is initially at 23.9 °C. After absorbing 1521 J of heat, the…

Q: specific heat

Q: Which compound is capable of hydrogen bonding with itself? 1-PROPANOL - (71-23-8) - Physical…

A: Hydrogen bonding is the bonding of Hydrogen with any electronegative atoms such as Flurine, Oxygen…

Q: It is advantageous to use the hydrogen gas for your fuel because it gives high calorific value.

A: Interpretation : We have to tell why hydrogen for you fuel because it has high calorific value.

Q: What is specific heat and what does it measure? How is specific heat determined? What data is…

A: Given : To define specific heat capacity and find out its importance.

Question

Why is the amount of heat absorbed by the water not equal to the amount of heat produced by the combustion of benzoic acid sample?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

About combustion

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

9.21 Which type of energy heat or work, is valued more by society? What evidence supports your judgment?
The enthalpy change when 1 mol methane (CH4) is burned is 890 kJ. It takes 44.0 kJ to vaporize 1 mol water. What mass of methane must be burned to provide the heat needed to vaporize 1.00 g water?
A calorimeter contains 72.0g of water at 19.2C. A 141-g piece of tin is heated to 89.0C and dropped into the water. The entire system eventually reaches 25.5C. Assuming all of the energy gained by the water comes from the cooling of the tin-no energy loss to the calorimeter or the surroundings-calculate the specific heat of the tin.
Which requires the absorption of a greater amount of heatâ€”vaporizing 100.0 g of benzene or boiling 20.0 g of water? (Use Table 8.2.)
From the molar heats of formation in Appendix G, determine how much heat is required to evaporate one mole of water: H2O(l)H2O(g)
Are changes in state physical or chemical changes? Explain. What type of forces must be overcome to melt or vaporize a substance (are these forces intramolecular or intermolecular)? Define the molar heat of fusion and molar heat of vaporization. Why is the molar heat of vaporization of water so much larger than its molar heat of fusion? Why does the boiling point of a liquid vary with altitude?
When ethanol (grain alcohol, is burned in oxygen, approximately 1360 kJ of heat energy is released per mole of ethanol. mg src=Images/HTML_99425-10-44QAP_image002.jpg alt="" align="top"/> What quantity of heat is released for each gram of ethanol burned? i>What is for the reaction as written? How much heat is released when sufficient ethanol is burned so as to produce 1 mole of water vapor?
n Section 10.7, two characteristics of enthalpy changes for reactions are listed. What are these characteristics? Explain why these characteristics are true.
Differentiate between the enthalpy of formation of H2O(l)andH2O(g) . Why is it necessary to specify thephysical state of water in the following thermochemicalequation CH4(g)+2O2(g)CO2(g)+2H2O(lorg)H=?
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7KJ: a. What quantity of heat is required to produce 1 mole of mercury by this reaction? b. What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c. What quantity of heat would be released in the following reaction as written? 2Hg(l)+O2(g)2HgO(s)
For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7kJ: a.What quantity of heat is required to produce 1 mole of mercury by this reaction? b.What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c.What quantity of heat would be released in the following reaction as written? 2Hg(l) + O2(g) 2HgO(s)