Interpretation:
The standard enthalpies of formation of
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
Answer to Problem 10.131QP
Standard enthalpy of formation of
Standard enthalpy of formation of
Change in enthalpy of formation of
Explanation of Solution
The chemical equations can be given,
Using the values of standard enthalpies of formation,
Standard enthalpy of formation of
Standard enthalpy of formation of Water =
The equations can be given as,
The equations are summed up to get the standard enthalpy of formation of
Therefore, standard enthalpy of formation of
Similarly, the equations are summed up to get the standard enthalpy of formation of
To calculate the change in enthalpy of formation of
The equation can be given as,
Change in enthalpy of formation of
The change in enthalpy of formation of
Want to see more full solutions like this?
Chapter 10 Solutions
Chemistry: Atoms First V1
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardCalculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forward
- Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardMethanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.arrow_forwardThe standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forward
- Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forwardWhite phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- A 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardSodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning