Concept explainers
Interpretation:
The bond enthalpies have to be used to determine the reaction that will occur readily.
Concept Introduction:
Bond Enthalpy:
The measure of stability of molecule is bond enthalpy. The change in enthalpy is related in breaking a specific bond of 1 mole of gaseous molecule. In solids and liquids bond enthalpies are affected by neighboring molecules. There is possibility to predict the enthalpy of reaction using the average bond enthalpies. Energy is always needed for the breaking of
The enthalpy of reaction in gas phase is given by,
Where,
BE= Bond enthalpy and
To identify: Which reaction occurs rapidly
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
CHEMISTRY:ATOMS FIRST-W/ACCESS>CUSTOM<
- The reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardWith a platinum catalyst, ammonia will burn in oxygen to give nitric oxide, NO. 4NH3(g)+5O2(g)4NO(g)+6H2O(g);H=906kJ What is the enthalpy change for the following reaction? NO(g)+32H2O(g)NH3(g)+34O2(g)arrow_forward
- 9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forward
- Hydrazine, N2H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the process in which hydrazine is formed from its elements? N2(g)+2H2(g)N2H4(l) Use the following reactions and enthalpy changes: N2H4(l)+O2(g)N2(g)+2H2O(l);H=622.2kJH2(g)+12O2(g)H2O(l);H=285.8kJarrow_forwardWhen lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- Hydrogen, H2, is prepared by steam reforming, in which hydrocarbons are reacted with steam. For CH4, CH4(g)+H2O(g)CO(g)+3H2(g) Calculate the enthalpy change H for this reaction, using standard enthalpies of formation.arrow_forwardEnthalpy changes for the following reactions can be determined experimentally: N2(g) + 3 H2(g) 2 NH3(g) rH = 91.8 kJ/mol-rxn 4 NH3(g) + 5 O2(g) 4 NO(g) + 6 H2O(g) rH = 906.2 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn Use these values to determine the enthalpy change for the formation of NO(g) from the elements (an enthalpy change that cannot be measured directly because the reaction is reactant-favored). N2(g) + O2(g) NO(g) rH = ?arrow_forward
- World of ChemistryChemistryISBN:9780618562763Author:Steven S. ZumdahlPublisher:Houghton Mifflin College DivChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning