Concept explainers
You are given the following data.
Calculate ΔH° for the reaction
Interpretation:
The standard enthalpy of reaction has to be calculated.
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
To calculate: The enthalpy of the reaction
Answer to Problem 10.95QP
The enthalpy of the reaction is
Explanation of Solution
Record the given info
To obtain the desired equation, the given equations are arranged.
The enthalpy of the reaction was calculated using the standard enthalpies of reactants and the products. The enthalpy of reaction was found to be
Want to see more full solutions like this?
Chapter 10 Solutions
CHEM ATOMS FIRST ALEKS 360 ACCESS 2 SEM
- The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardWhich of the following substances have an enthalpy of formation equal to zero? a. Cl2(g) b. H2(g) c. N2(l) d. Cl(g)arrow_forward
- The complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forward
- The temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forward9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)arrow_forwardExplain the difference between heat capacity and specific heat of a substance.arrow_forward
- Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax