Physical Science + Connect Access Card
Physical Science + Connect Access Card
11th Edition
ISBN: 9781259731006
Author: Bill W. Tillery
Publisher: McGraw-Hill College
bartleby

Concept explainers

Question
Book Icon
Chapter 10, Problem 4PEB

(a)

To determine

To write: The balanced chemical equation for the reaction NO + O2NO2

(a)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NO + O22NO2.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of N on the right hand side and the left hand sides are equal but the number of atoms of O is not equal on the right hand side and the left hand side. So to balance the number of O atoms multiply 2 with NO2 and NO.

Now the equation becomes.

2NO + O22NO2

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NO + O22NO2.

(b)

To determine

To write: The balanced chemical equation for the reaction KClO3KCl+O2

(b)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2KClO32KCl+3O2.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of K and Cl on the right hand side and the left hand sides are equal but the number of atoms of O is not equal on the right hand side and the left hand side. So to balance the number of O atoms multiply 2 with KCl and KClO3. The K and Cl atoms are balanced, now to balance O multiply 3 with O2.

Now the equation becomes.

2KClO32KCl+3O2

Conclusion:

Hence, the balanced chemical equation for the reaction is 2KClO32KCl+3O2.

(c)

To determine

To write: The balanced chemical equation for the reaction NH4Cl+Ca(OH)2CaCl2+NH3+H2O

(c)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of N and Ca on the right hand side and the left hand side are equal but the number of atoms of H, O and Cl are not equal on the right hand side and the left hand side. So to balance the number of H, O and Cl atoms multiply 2 with NH3, H2O and NH4Cl.

Now the equation becomes.

2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O.

(d)

To determine

To write: The balanced chemical equation for the reaction NaNO3+H2SO4Na2SO4+HNO3

(d)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NaNO3+H2SO4Na2SO4+2HNO3.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Na atom on the left hand side is 1 and on the right hand side is 2 which is not balanced. Similarly, number of Na atom on the left hand side is 1 which is not equal to the number of N atom on the left hand side of the equation. Number of S and O atoms on the left hand side of the equation are same. In order to balance the number of atoms on both sides of the equation we need to multiply NaNO3 by 2 and HNO3 by 2.

Now the equation becomes.

2NaNO3+H2SO4Na2SO4+2HNO3

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NaNO3+H2SO4Na2SO4+2HNO3.

(e)

To determine

To write: The balanced chemical equation for the reaction PbS+H2O2PbSO4+H2O

(e)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is PbS+4H2O2PbSO4+4H2O.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Pb, S and H atoms are balanced on both sides of the equation and are equal but number of O atoms are not equal on the both side of this chemical equation. In order to balance the number of atoms on both sides of the equation we need to multiply H2O2 by 4 and HNO3 by 4.

Now the equation becomes.

PbS+4H2O2PbSO4+4H2O

Conclusion:

Hence, the balanced chemical equation for the reaction is PbS+4H2O2PbSO4+4H2O.

(f)

To determine

To write: The balanced chemical equation for the reaction Al2(SO4)3+BaCl2AlCl3+BaSO4

(f)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is Al2(SO4)3+3BaCl22AlCl3+3BaSO4.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Ba atoms is equal on both sides. The number of Al, S, H, Cl and O atoms are not equal on both the sides of the chemical equation. In order to balance the number of atoms on both sides of the equation we need to multiply BaCl2  by 3, AlCl3 by 2 and BaSO4 by 3.

Now the equation becomes.

Al2(SO4)3+3BaCl22AlCl3+3BaSO4

Conclusion:

Hence, the balanced chemical equation for the reaction is Al2(SO4)3+3BaCl22AlCl3+3BaSO4.

Want to see more full solutions like this?

Subscribe now to access step-by-step solutions to millions of textbook problems written by subject matter experts!
Students have asked these similar questions
4. How many milliliters of 0.200 M NH2OH are needed to react with 12.0 mL of 0.550 M FeCl3? FeCl3 + 3NH4OH → Fe(OH)3 + 3NH4Cl
A 60.0 g of CaC2 reacts with water to produce C2H2 and 81.2 g of Ca(OH)2. The reaction between these two substances are chemically written as:   _______ CaC2 + ______ H2O → _____ C2H2 + _______ Ca(OH)2 Balance the chemical equation. Calculate the molar mass of CaC2 and Ca(OH)2? What is the theoretical yield of Ca(OH)2? What is the percent yield of this reaction if the actual yield of Ca(OH)2 exceeds 2.1 g ?
Part B. Write a balanced molecular equation describing each of the following chemical reactions. You may use the internet to search for the chemical symbol of each substance.   B. Gaseous butane, C4H10, reacts with diatomic oxygen gas to yield gaseous carbon dioxide and water vapor.

Chapter 10 Solutions

Physical Science + Connect Access Card

Knowledge Booster
Background pattern image
Physics
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, physics and related others by exploring similar questions and additional content below.
Recommended textbooks for you
Text book image
An Introduction to Physical Science
Physics
ISBN:9781305079137
Author:James Shipman, Jerry D. Wilson, Charles A. Higgins, Omar Torres
Publisher:Cengage Learning
Text book image
Intro Spectroscopy
Physics
ISBN:9781305221796
Author:PAVIA
Publisher:Cengage