Concept explainers
Given the following information, calculate the standard enthalpy of formation of acetylene (C2H2) from constituent elements.
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Student Solutions Manual For Chemistry: Atoms First
- Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardCalculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forward
- The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forwardThe standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forward
- Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardWhite phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardFind the enthalpies of the combustion reactions for methane through n-octane. Plot them versus the number of carbon atoms in the molecule, and determine an equation that gives H for the combustion of a given hydrocarbon. Then use the equation to predict the enthalpy of combustion for n-C12H26 and compare it to experimental values.arrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forward
- Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax