The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?

At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?

Kp for the formation of phosgene, COCl2, is 6.5 1011 at 25 C. CO(g) + Cl2(g) COCl2(g) What is the value of Kp for the dissociation of phosgene? COCl2(g) CO(g) + Cl2(g)

At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?

Consider the system 4 NH3(g) + 3 O2(g) ⇌ 2 N2(g) + 6 H20(ℓ) ΔrH° = −1530.4 kJ/mol How will the amount of ammonia at equilibrium be affected by removing O2(g) without changing the total gas volume? adding N2(g) without changing the total gas volume? adding water without changing the total gas volume? expanding the container? increasing the temperature? Which of these changes (i to v) increases the value of K? Which decreases it?

The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1

Ammonia is produced by the Haber process, in which nitrogen and hydrogen are reacted directly using an iron mesh impregnated with oxides as a catalyst. For the reaction N2(g)+3H2(g)2NH3(g) equilibrium constants (Kp values) as a function of temperature are 300C, 4.34 103 500C, 1.45 105 600C, 2.25 106 Is the reaction exothermic or endothermic?

Write the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)

12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.