The equilibrium constant Kc for the reaction
is 0.83 at 375°C. A 14.6-g sample of ammonia is placed in a 4.00-L flask and heated to 375°C. Calculate the concentrations of all the gases when equilibrium is reached.
Interpretation:
To calculate the equilibrium concentration values are given homogenies equilibrium of ammonia (NH3) dissociation reaction with respective pressure and temperature at
Concept Introduction:
Equilibrium concentration: If Kc and the initial concentration for a reaction and calculate for both equilibrium concentration, and using the (ICE) chart and equilibrium constant and derived changes in respective reactants and products.
Pressure effect in equilibrium: The equilibrium constant calculated from the partial pressures of a reaction equation. It is used to express the relationship between product pressures and reactant pressures. It is unites number, although it relates the pressures.
Homogeneous equilibrium: A homogeneous equilibrium involved has a everything present in the same phase and same conditions, for example reactions where everything is a gas, or everything is present in the same solution.
Temperature affect in equilibrium: This process chemical shifts changes (or) towards the product or reactant, which can be determined by studying the reaction and deciding whether it is exothermic or endothermic.
Le Chatelier's Principle (Kp): The closed system is an increase in pressure, the equilibrium will shift towards the sides of the reaction with some moles of gas. The decrease in pressure the equilibrium will shift towards the side of the reaction with high moles of gas.
Answer to Problem 15.145QP
The reactant and product each equilibrium concentration (ICE) values for the given
Explanation of Solution
To find: The equilibrium concentration should be identified given the gases phase reaction.
Analyze the chemical equilibrium reaction.
Given the gas phase equilibrium concentration reaction is the combined reaction; it is the product of the constants for this component reaction. This equilibrium reaction expression contains same conditions like gas phase. Hence this process homogenous equilibrium further the equilibrium constant can also be represented by Kc, were the Kp represents partial pressure. Then the each (reactant and product) molecule equilibrium concentration
To find: Calculate the each concentration values for given the equilibrium constant (Kc) of ammonia dissociation reaction.
Calculate and analyze the respective concentration values at
First let’s calculate the initial concentration of ammonia.
Further we set up a ICE table to represent the equilibrium concentrations. With respect the amount of (NH3) that reacts as (2x) fallowed by,
The given ammonia dissociation reaction the respective reactant to give a two moles of products, and this reaction proceeds in same phase and this equilibrium reaction expression contains single conditions like gases phase, the equilibrium constant can also be represented by Kp, were the “P” partial pressure. The each reactant and product concentration values are derived given above equation at
The each of reactant and product equilibrium concentration values are derived given the gas phase ammonia
Want to see more full solutions like this?
Chapter 15 Solutions
ATOMS FIRST
- At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?arrow_forwardThe diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.arrow_forwardAt 1 atm and 25 C, NO2 with an initial concentration of 1.00 M is 3.3103 decomposed into NO and O2. Calculate the value of the equilibrium constant for the reaction. 2NO2(g)2NO(g)+O2(g)arrow_forward
- Consider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forwardNitrosyl chloride, NOC1, decomposes to NO and Cl2 at high temperatures. 2 NOCl(g) ⇌ 2 NO(g) + Cl2(g) Suppose you place 2.00 mol NOC1 in a 1.00–L flask, seal it, and raise the temperature to 462 °C. When equilibrium has been established, 0.66 mol NO is present. Calculate the equilibrium constant Kc for the decomposition reaction from these data.arrow_forwardDinitrogen tetroxide, N2O4, is a colorless gas (boiling point, 21C), which dissociates to give nitrogen dioxide, NO2 a reddish brown gas. N2O4(g)2NO2(g) The equilibrium constant Kc at 25C is 0.125. What percentage of dinitrogen tetroxidc is dissociated when 0.0400 mol N2O4 is placed in a 1.00-L flask at 25C?arrow_forward
- The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?arrow_forwardKc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?arrow_forwardThe following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forward
- An equilibrium mixture of SO2, O2, and SO3 at a high temperature contains the gases at the following concentrations: |SO2| = 3.77 103 mol/L, [O2] = 4.30 103 mol/L, and [SO3] = 4.13 103 mol/L. Calculate the equilibrium constant, Kc, for the reaction. 2 SO2(g) + O2(g) 2 SO3(g)arrow_forwardThe equilibrium constant Kc for the synthesis of methanol, CH3OH. CO(g)+2H2(g)CH3OH(g) is 4.3 at 250C and 1.8 at 275C. Is this reaction endothermic or exothermic?arrow_forwardSuppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning